Draw and explain the reaction mechanism METHYL MAGNESIUM BROMIDE with PROPANAL AND PROPANONE

Q: Rank each set of compounds in order of increasing basicity.pyrrole, imidazole, 3-nitropyrrole

A: Basicity is the tendency of the substance to accept the protons or having a tendency to donate its…

Q: Consider the following compounds: Compound E: benzoic acid Compound F: benzoyl chloride Compound G:…

A: Oxidation is a process by which a carbon atom gains bonds to more electronegative elements like…

Q: Polyethylene terephthalate is also prepared by the transesterification of dimethyl terephthalate…

A:

Q: Describe how 3-methyl-1-phenyl-3-pentanol can be prepared from benzene. You can use any inorganic…

A: 3-methyl-1-phenyl-3-pentanol from benzene is shown below, Benzene is react with ethyl chloride in…

Q: When butanoic acid and 18O-labeled methanol react under acidic conditions, what compounds are…

A: Since the methanol and butanoic acid will react and form ester and water. hence the reaction is…

Q: Rank each set of compounds in order of increasing basicity.aniline, pyrrole, pyridine, piperidine

A: The nitrogen has lone pair of electrons which can be donated. The donation of lone pair of electrons…

Q: Arrange the following compounds in order of increasing reactivity in nucleophilic acyl substitution.…

A: nucleophilic acyl substitution reactivity order anhydrides> esters> amides

Q: Acetals are formed from the reaction of two alcohols with a carbonyl under acidic conditions. Acetal…

A: During the acetal formation by 1,2-ethanediol and two molecules of ethanol, the same types of bond…

Q: What are the products of ozonolysis of 3-Methylpent-2-ene? A Ethanal and Butanal B Ethanal and…

A: Ozonolysis: It is the organic chemical reaction where ozone is employed to cleave the unsaturated…

Q: Starting from benzylamine, draw the structure of the major products upon reaction with the following…

A: Given:

Q: Which of the following aromatic compound has a hydroxy substitution?  There can only be 1 answer.…

A: Aromatic compounds are those which has 4n+2 pie electrons. Aromatic compounds obey Huckel's rule.…

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: Given Chemical reaction: CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Mass of butanoic…

Q: O The Wolf-Kishner reduction is a reaction used in Organic Chemistry to convert carbonyl…

A: The overall chemical reaction of Wolf-Kishner reduction is:

Q: preparation from 1-butanol to butylamine

A: N-butylamine (a clear and colorless liquid) is used in the manufacturing process of pharmaceuticals.…

Q: Which of the following compounds will NOT undergo nucleophilic substitution reaction? isopropanol O…

A: a) Isopropanol:  Alcohols cannot undergo nucleophilic substitution reactions because of hydroxy…

Q: What structural and/or molecular properties of aldehyde/ketonecontributes to their reactivity with…

A: Ag2O+4NH3+H2O→2Ag(NH3)+2+ 2OH− (Tollens reagent)

Q: Predict the products formed when cyclohexanone reacts with the following reagents.phenylhydrazine…

A: The products formed when cyclohexanone reacts with the given reagent phenylhydrazine and weak acid…

Q: Draw the products formed when attached carbonyl compound reacts with the following amines: [1]…

A:

Q: Which of the following reagent is used for hydroboration?   a Phosphoric acid   b Tetrahydrofuran…

A: ★ Answer : Correct option is (b) Tetrahydrofuran.   ★ Hydroboration reaction is a two-step hydration…

Q: Starting with cyclohexanone and ethanol as the only organic reagents, use any inorganic reagents to…

A:

Q: 15.) Which of the following esters, upon hydrolysis, produces a diol as one of the products? A)…

A: There are many mechanisms in organic chemistry such as nucleophilic substitution, nucleophilic…

Q: Phenylethanol can be oxidised to phenylethanal or phenylethanoic acid, depending on the reagents…

A:

Q: Which of the following compounds yields a yellow precipitate when warmed with a mixture of iodine in…

A:

Q: Starting from cyclohexanone, show how to make the two given products, include conditions to use in…

A:

Q: How many proton signals would be expected for isopentyl acetate? O 5 6 4 3.

A: a). The number of protons signals in the given molecules is 5 because 5 types of H atoms(H- in the…

Q: Compare the physical properties of acid derivatives, and explain the unusually highboiling points…

A: The carboxylic acid and its derivatives have higher boiling point and melting point than the…

Q: Which reagent would you use to prepare benzene from benzene diazonium chloride?

A:

Q: How would you explain the o-p directing formation of phenol, while nitro benzene is m-directional?…

A: Explained as follows

Reactions at the Alpha Carbon Atom

The position next to the ketone or aldehyde functional group is termed as alpha position and the reaction which occurs at alpha position is called alpha substitution reaction. In an alpha substitution reaction, the alpha proton atom is substituted by an electrophile by the formation of an enol intermediate or enolate ion intermediate. Most of the carbonyl compounds go through an alpha substitution reaction.