DQUESTION 1, THREE (3) moles of H2(2) and THREE (3) moles of I2(2) are introduced into a 2L container at a temperature of 490 °C. Determine the concentration of HI when the equilibrium is established. Given that the reaction quotient (Qc) for this reaction is 45.9. А. 2.3162 M В. 4.6325 M C. 3.3162 M D. O 6.6324 M

DQUESTION 1, THREE (3) moles of H2(2) and THREE (3) moles of I2(2) are introduced into a 2L container at a temperature of 490 °C. Determine the concentration of HI when the equilibrium is established. Given that the reaction quotient (Qc) for this reaction is 45.9. А. 2.3162 M В. 4.6325 M C. 3.3162 M D. O 6.6324 M

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter13: Chemical Equilibrium

Section: Chapter Questions

Problem 6RQ: Distinguish between the terms equilibrium constant and reaction quotient. When Q = K, what does this...

See similar textbooks

Similar questions

Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
For the reaction C(s)+CO2(g)2CO(g) K=168 at 1273 K. If one starts with 0.3 atm of CO2 and 12.0 g of C at 1273 K, will the equilibrium mixture contain (a) mostly CO2? (b) mostly CO? (c) roughly equal amounts of CO2 and CO? (d) only C?
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
Methanol can be synthesized by means of the equilibriumreaction CO(g)+2H2(g)CH3OH(g) for which the equilibrium constant at 225°C is 6.08103. Assume that the ratio of the pressures of CO(g) and H2(g) is 1:2. What values should they have if the partial pressureof methanol is to be 0.500 atm?
For the given chemical equilibrium, these data are determined experimentally: T K 350K 3.76102 450K 1.86101 Determine H for this reaction.
Distinguish between the terms equilibrium constant and reaction quotient. When Q = K, what does this say about a reaction? When Q K, what does this say about a reaction? When Q K. what does this say about a reaction?
The following equilibrium is established in a closed container: C(s)+O2(g)CO2(g)H=393kJmol1 How does the equilibrium shift in response to each of the following stresses? (a) The quantity of solid carbon is increased. (b) A small quantity of water is added, and CO2 dissolves in it. (c) The system is cooled. (d) The volume of the container is increased.
Consider the following reaction at 250C: A(s)+2B(g)C(s)+2D(g) (a) Write an equilibrium constant expression for the reaction. Call the equilibrium constant K1. (b) Write an equilibrium constant expression for the formation of one mole of B(g) and call the equilibrium constant K2. (c) Relate K1 and K2.
Show that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.
A gaseous material XY(g) dissociates to some extent to produce X(g) and Y(g): XY(g)X(g)+Y(g) A 2.00-g sample of XY (molar mass = 165 g/mol) is placed in a container with a movable piston at 25C. The pressure is held constant at 0.967 atm. As XY begins to dissociate, the piston moves until 35.0 mole percent of the original XY has dissociated and then remains at a constant position. Assuming ideal behavior, calculate the density of the gas in the container after the piston has stopped moving, and determine the value of K for this reaction of 25C.
What is the approximate value of the equilibrium constant KP for the change C2H5OC2H5(l)C2H5OC2H5(g) at 25 C. {Vapor pressure was described in the previous Chapter on liquids and solids; refer back to this chapter to find the relevant information needed to solve this problem.)
Explain why an equilibrium between Br2(l) and Br2(g) would not be established if the container were not a closed vessel shown in Figure 13.5.