determine the specific activity of Cs-137. M(CS-137) = 136.9 g/mol 30,08 year

Q: Please don't use hend raiting and step by step solutions

A: To identify the oxidizing agent in the given reaction, let's first analyze the oxidation states of…

Q: Check the box under each molecule in the table below that is an isomer of this molecule: OH OH If…

A: positional isomers - same molecular formula but if position of functional group change called…

Q: Aqueous solutions of which ion would be expected to be more basic? O HPO32- H2PO3 O PO33-

A: Step 1:The Anion would  undergoes hydrolysis to form basic solution   Step 2:The phosphite ions…

Q: None

A: To calculate the energy required to melt 153 g of ice into liquid water at 0 °C, you can use the…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: highest second ionization energy is for lithium (Li)because after losing one electron, it achieves a…

Q: None

A: To determine the major product of the reaction between bromine (Br₂) and sodium ethoxide (NaOCH2CH3)…

Q: A penny has a mass of 2.50 g and the Moon has a mass of 7.35 × 10^22 kg.  What is the mass of 1 mole…

A: In chemistry, a mole is a unit of measurement for amount of substance. It is defined as exactly…

Q: None

A: Part 1: Answer: The correct balanced chemical equation for the decomposition of hydrazine is:…

Q: Check In: If pH is 5.3, what is the [H3O+]? a. 1.99 x 105 M b. 5.01 x 10-6 M C. Not sure H3O+…

A: Firstly, we can answer this question by using a bit of common sense and knowledge of pH.  The given…

Q: Give me detailed Solution with explanation needed. don't give Handwritten answer

A: NOTE: Curved arrows are used to show the movement (flow) of electrons during bond breaking and/or…

Q: None

A: We need to convert "mol / kg.m2" into "mol / g.cm2" First let us convert the kg to g1 kilogram (kg)…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: To analyze the Pourbaix diagram for the CuO-H2O system at 1M concentration based on the given…

Q: 10.3 Concentrated phosphoric acid may be used in the preparation of HBr and HI. give an equation for…

A: Step 1: Step 2: Step 3: Step 4:

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: The reaction proceeds as follows:In order to have better understanding I write the answer in…

Q: Suppose a 500. mL flask is filled with 0.30 mol of CO, 0.10 mol of NO and 1.9 mol of CO2. The…

A:

Q: What type of reaction is occurring: AB-> A+B double-displacment redox synthesis single-displacement

A: Step 1:   A Decompopsition reaction involves the breakdown of a compound into two or more…

Q: None

A: To answer the scenario, let us first analyze the given data to proceed with the reaction.The…

Q: The acid dissociation constant K of carbonic acid (H2CO3) is 4.5 × 10¯7. Calculate the pH of a 3.8M…

A: Carbonic acid:H2CO3 + H2O <-< H3O+ + HCO3- Ka = [H3O+][HCO3-]/[H2CO3]initially[H3O+]= 0[HCO3-]…

Q: Chemistry

A: Step 1: Step 2:

Q: bioo avinsdoni 14. Which of the following binary acid would have the largest acid dissociation…

A: The acid dissociation constant, Ka, is a measure of the strength of an acid in solution. It is the…

Q: Does any element with Z ≤ 92 match the description? A noble gas with a lower atomic number than…

A: The question is asking if there is a noble gas with an atomic number less than that of iodine, and…

Q: None

A: Step 1: The Arrhenius equation in linear form is:ln K=R−Ea​​×T1​+ln Awhere:K is the rate constantEa…

Q: The buffer from the above question was made by mixing 150.0 mL of 0.10 M HC7H502 with 100.0 mL of…

A: First, we need to calculate the initial moles of HC7H5O2 and NaC7H5O2. The moles of a substance can…

Q: Macmillan Learning Draw the major organic product of the reaction. Show the stereochemistry, if…

A: Your answer: Thank you

Q: When the reaction equation is balanced with the smallest whole number coefficients, what is…

A: The unbalanced chemical equation is given as: MnO2 + HCl → MnCl2 + Cl2 + H2O. In this equation, the…

Q: 6-41 Allylic halides have the structure cccx a. Show how the first-order ionization of an allylic…

A:

Q: Curved arrows are used to illustrate the flow of electrons. Use he reaction conditions provided and…

A: Step 1:This reaction is nucleophilic addition reactionIn this reaction grignard ( RMgX) act as a…

Q: Explain makovnikov rule

A: According to Markonikov's rule, during the addition reaction of alkene, the negative part is added…

Q: 500 ml of wastewater sample was collected and 200 ml of this sample was analyzed by classical 5 day…

A: To solve this problem, we need to calculate the organic nitrogen, total nitrogen concentrations, and…

Q: 5. A unit of length called the "furlong" is used in horse racing. The units of length called the…

A: 100 links = 1 chain10 chains = 1 furlong8 furlongs = 1 mile1 mile = 63360 inchesMultiply 1 link with…

Q: None

A:

Q: Give detailed mechanism Solution with explanation needed. Don't give Handwritten answer. Don't use…

A: The reaction shown in the problem is an epoxidation reaction in which an alkene is converted into an…

Q: 20.25 If the J = 2 to 3 rotational transition for a diatomic molecule occurs at λ = 2.00 cm, find λ…

A:

Q: Uranium-238 undergoes radioactive decay until a stable isotope is reached. One of the steps is shown…

A: GUIDE: (1) Alpha Decay ZA​X→Z−2A−4​Y+24​αwhere:X = Parent NucleusY = Daughter Nucleusα = alpha…

Q: Check In: Determine the pH of a 0.232 M Sr(OH)2 solution at 25°C. a. 12.73 b. 13.37 c. 13.67 d.…

A: The Sr(OH)2​ shows the dissociation in water as:Sr(OH)2​(aq)⇌Sr2+(aq)+2OH−(aq)By looking at the…

Q: How is MgI₂ linear?

A: In summary, the molecular shape of magnesium iodide, MgI2, is linear due to the central magnesium…

Q: Which proton abstraction produces the E configuration product? C Br. Hc Ha A E2 H3C HR B

A: Step 1:Ha Abstraction: If the Ha proton is abstracted, the double bond will form with the Br and R…

Q: None

A: Chloride (Cl-) The student did not observe a reaction when adding barium ion to the solution, which…

Q: What mass of Fe2O3 must react to produce 100.0 g of Fe?   Question 6 options:…

A: The balanced chemical equation for the reaction of iron(III) oxide (Fe2O3) to produce iron (Fe)…

Q: Practice 4: Calculate the pH, the pOH, the [H3O+] and [OH-] of a 0.356 M HCIO solution.

A: First, we need to identify the nature of the solution. HCIO is a weak acid, meaning it does not…

Q: Please show reaekson and don't use hend raiting

A: To determine the product formed in an E2 reaction with [(1S,2R)-1-bromo-2-phenylpropyl]benzene and…

Q: Chemistry

A: The upper and lower heating values (also known as higher heating value, HHV, and lower heating…

Q: Chemistry

A: Bituminous pavement primarily consists of bitumen. Bitumen is a viscous, black, and sticky substance…

Q: Draw the structure of the major organic product of the reaction below. Zn(Cu) CHCH3 + CH212 • Use…

A: Step 1: Step 2:CH2 adds to the alkene in a syn manner   Step 3: Step 4:

Q: None

A: Step 1: GivenKeq = 5.87 x 10-37T = 298 K2N2(g) + O2(g) → 2N2O(g)ΔG°rxn = ?  Step 2: Gibbs free…

Q: Cryolite, Na, AlF6(s), an ore used in the production of aluminum, can be synthesized using aluminum…

A: To solve this problem, we need to balance the given chemical equation, determine the limiting…

Q: 3. Draw the compound structures A-E to complete the following reactions. KOC(CH3)3 Br2 KOC(CH3)3 (2…

A: Step 1: Step 2: Step 3: Step 4:

Q: None

A: Choices and Explanations:a. Br2/H2OExplanation: Bromine in water is used for the halohydrin…

Q: None

A: To distinguish the identity of the three Newman projections in relation to molecule A. We must first…

Q: None

A: To answer the question correctly, let's analyze the ionization steps provided:M(g)→M+(g)+e−;…