Correct1. Calculate the amounts of each reactant.2. Compare the ratio of reactants amounts to the stoichiometric ratio defined by the equation.1 mol Ss256.5 g20.0 g Ss x0.0780 mol S81 mol Cl288.0 g Cl2 x1.24 mol Cl270.90 g4 mol Cl215.9 mol Cl21 mol Sg1.24 mol Cl20.0780 mol S81 mol SgSo Sg is the limiting reactant.(b What is the theoretical yield of S, Cl2 ?Theoretical yieldSubmit

Answered: Image /qna-images/answer/588578c5-f3cf-4e72-a111-3fdb8066e454.jpg

Correct 1. Calculate the amounts of each reactant. 2. Compare the ratio of reactants amounts to the stoichiometric ratio defined by the equation. 1 mol Ss 256.5 g 20.0 g Ss x = 0.0780 mol Ss 1 mol Cl2 70.90 g 88.0 g Cl2 x = 1.24 mol Cl, 1.24 mol Cl 15.9 mol Cl2 4 mol Cl2 0.0780 mol Sg 1 mol Ss 1 mol S8 So Sg is the limiting reactant. b What is the theoretical yield of S2 Cl2 ? Theoretical yield = g Submit

Correct 1. Calculate the amounts of each reactant. 2. Compare the ratio of reactants amounts to the stoichiometric ratio defined by the equation. 1 mol Ss 256.5 g 20.0 g Ss x = 0.0780 mol Ss 1 mol Cl2 70.90 g 88.0 g Cl2 x = 1.24 mol Cl, 1.24 mol Cl 15.9 mol Cl2 4 mol Cl2 0.0780 mol Sg 1 mol Ss 1 mol S8 So Sg is the limiting reactant. b What is the theoretical yield of S2 Cl2 ? Theoretical yield = g Submit

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

If a reaction is run that is supposed to produce 125 g (theoretical yield) of product and the actual yield of product that was produced was 73.5 g, what is the percent of yield of this reaction? A. 170% B. 1.70% C. 73.5% D. 58.8%
the reaction of 15 moles of carbon with 30 moles of oxygen will result in a theoretical yield of ____ moles of CO2 is what?
What is the maximum mass of S, that can be produced by combining 85.0 g of each reactant? 8, 8 SO, + 16 H,S 3 Sg + 16 H,0 mass of Sg: g F TOOLS x10
What is the balanced chemical equation for the chemical reaction depicted in the figure? Be sure your balanced chemical reaction uses the simplest whole number coefficients. = carbon = oxygen OO 8 8 O 2 C +60 04 C+120 OC+ 203 → CO₂ + 2 0₂ 04 C +4032 CO₂ + 2 C + 402 02C+203 →→ CO₂ + C + 2 02 CO₂ + C +40 2 CO₂ + 2 C + 80 8 8
ABS plastic is a polymer consisting of three monomer units: acrylonitrile (C₃H₃N), butadiene (C₄H₆), and styrene (C₈H₈). A sample of ABS plastic contains 11.9% N by mass. It took 1.56 g of Br₂ to react completely with a 2.00 g sample of ABS plastic. Bromine reacts 1:1 (by moles) with the butadiene units in the polymer and nothing else, so bromination is a method for determining the quantity of butadiene in the polymer. What is the percent by mass of styrene in the polymer?
The starting materials in a chemical reaction are called your "initial products". True False If the number of each type of atom on one side of the arrow differs from the number on the other side, the equation is still considered balance. True False Stoichiometry is the qualitative study of reactants and products in a chemical reaction. True False
Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield
Balance the following chemical equations
How many moles of iron (Fe) will be produced from 6.20 moles of carbon monoxide (CO) reacting with excess iron (III) oxide (Fe₂O 23)? Fe₂O3 + 3C0→2Fe +3CO₂ A 4.13 mol Fe 00 B C 28.01 mol Fe 3.14 mol Fe 2.68 mol Fe
Please do this, they are all parts of 1 question do all please.
Sodium and chlorine react to form sodium chloride: What is the theoretical yield of sodium chloride for the reaction of 32.0 g Na with 107.2 g Cl2? A. 1.40 x 104 g NaCl B. 35.4 g NaCl C. 122 g NaCl D. 81.2 g NaCl