-COOH +CH,CH(CH, )NH,

Q: Provide the IUPAC name of (CH3)3CCH₂CH₂NHCH₂CH3. N-methyl-3-ethyl-1-butanamine…

A: ->Aliphatic amines are named by naming the alkyl group or groups attached to nitrogen and…

Q: Draw the structures for the four amines of molecular formula C 3H 9N. Give the systematic name for…

A: Given, C3H9N

Q: Draw the structure of a compound of molecular formula C 9H 11NO that contains a benzene ring and a:…

A: Nitrogen is connected to a single carbon within a primary (1°) amide; it is linked to two carbons in…

Q: List the products of each amine reaction. H CH, —N—CH—сH, + CH, CH, CH;-CH-CH;-C-OH

A: Condensation reaction: In this type of reaction two molecules joined together and forms a new…

Q: 7-50ך Draw the structure of the amine salt produced when each of the following amines reacts with…

A: Amines are basic in nature due to the presence of lone-pair on nitrogen atom. Hydrochloric acid, HCl…

Q: What is the IUPAC name of a benzene ring with an amine group (NH2-) attached at carbon 1 and a…

A: Write IUPAC name as indicated in the structure---

Q: 19. Which of the following molecules contain an amide? H2N-CHC-OH ČH3 a. c. NH2 NH2 b. H2N…

A: An amide group consists of a carbonyl group attached to the nitrogen atom in an organic compound.…

Q: Amides can undergo a two-step hydrolysis process. H 1. NaOH 2. HCI, H₂O

A: Answer:Amide is a derivative carboxylic acid and its hydrolysis in basic medium is performed and we…

Q: Ester compounds often have a sweet, pleasant odor. Many characteristic fruit scents are largely due…

A: " Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: Write the systematic (IUPAC) names for the amines. The names should have the format alkanamine.…

A: RULES for IUPAC nomenclature; In first step, we identify functional groups present.  We make longest…

Q: Give the IUPAC name for the following acid amide: CH3CH2CH(CH3)CH2CH(CH3)CH₂C NH2

A: Structure of acid amide:find out IUPAC name

Q: Draw the amide formed when 1-methylethylamine (CH,CH(CH, )NH,) is heated with each carboxylic acid.…

A: Given reaction,   Reaction of  1‑methylethylamine with carboxylic acids.

Q: Classify each of the molecules below. O CH3—C—NH–CH2–CH3 O 1° amide O 2° amide 3° amide not an amide…

A: ->Amides are classified according to the number of substituents connected to the nitrogen of…

Q: Which of the following contains an amide? НО А. N B. НО. ОН с. OH H₂N D.

A: Organic compounds are formed by two main elements, carbon, and hydrogen. The specific group of atoms…

Q: Draw the condense structure for the following carboxylic acids: a) 2-propyamine b)…

A: Since you have posted multiple questions, we are entitled to answer the first only.

Q: Which of the following molecules is an amide? B OH NH2 A) A OH B) B C) C D) D `NH2

A: The organic compound is formed by two main elements, carbon, and hydrogen. The specific group of…

Q: Compare N-methylacetamide with its amide isomers propanamide and N,N-dimethylformamide. Which do you…

A: Compare N-methylacetamide with its amide isomers propanamide and N,N-dimethylformamide. Which do you…

Q: 2. When a carboxylic acid and an amine functional group are in the same compound, what group has the…

A:

Q: Draw the structures of the carboxylic acid and amine needed to prepare phenacetin.

A:

Q: In a 0.28 mM aqueous solution of trimethylacetic acid (C4H9CO2H), what is the percentage of…

A: A strong acid will completely ionize in water while a weak acid will only partially ionize. It…

Q: Draw several molecules of methanamide and show the intermolecular hydrogen bonding that account for…

A: In this question we have to draw the structure of methanamide which shows H bonding between…

Q: accept

A: n-propylamine is basic because the nitrogen of the amine group consists of a lone pair which is…

Q: Name the following amine by the IUPAC system of nomenclature: NH ₂ CHCHỊCH CH(CH3)

A:

Q: Draw the amide formed when 1‑methylethylamine (CH3CH(CH3)NH2)(CH3CH(CH3)⁢NH2) is heated with each…

A: We have to draw the amide formed when the carboxylic acids are treated with the given amine.

Q: Draw the amide formed when 1-methylethylamine (CH3CH(CH3)NH2) is heated with each carboxylic acid.

A:

Q: Draw molecules with the formula C9H19NO.two different secondary amides, none of which have branched…

A:

Q: 11. Write the chemical reaction for the acid hydrolysis of each amide sample. Include the condensed…

A: Acid hydrolysis of amide gives carboxylic acid  and salt of ammonia .

Q: True or False Amine salts have increased solubility in water. Amines have a pleasant floral aroma.…

A: The physical properties of organic compounds depend on various factors, including molecular size,…

Q: Identify the functional group(s) that appear in the molecule below -N-

A: Identify functional group present

Q: CH3 O alkene O aromatic O alcohol O ether O alkyne amide O ketone O aldehyde O amine O alkane O…

A: Acetanilide is generally an amide and amides are weak bases. Acetanilide contains different…

Q: What amine is formed by reduction of each amide?

A: (a) 1° amine is formed by the reduction of the given compound.

Q: Name the carboxylic acid that is formed by the acidic hydrolysis of the following acid amide:…

A: Given reaction is an example of an acid catalysed hydrolysis of amide gives a carboxylic acid and…

Q: Tertiary amides have how many C-N bonds?

A:

Q: Name the following amine. H3C−CH2−CH2−NH−CH2−CH2−CH3 Spell out the full name of the compound.   B )…

A:

Q: Classify the formulas as amines, amides, or neither. Amines Amides Neither Answer Bank II…

A:

Q: What is true regarding protein backbones? The protein backbone is different for each protein and…

A: Proteins are the chain of amino acid that assembe through peptide bonds.Proteins are generally high…

Q: 2. Draw the product when each of the amines acts as a base when combined with water, Name the lon…

A: The reactions are as follows:

Q: 1. Provide the correct IUPAC name for the following amines. CH3 H3C. H3C. NH H3C CH3 H. CH3 CI N H…

A: Given compounds are :  Provide the correct IUPAC names of the following amines  The general…

Q: Which represents the acid form of a primary amine? OR-NH₂ OR-NH OR-NH OR-NH₂

A:

Q: What are the products of the reaction between acetyl chloride and diethylamine? O a. HCl and…

A: The products of the reaction between the acetyl chloride and diethylamine are shown by the following…

Q: a.Primary amides tend to exist as dimers in the solid and liquid state. b.Dimethylacetamide,…

A: The statement which are correct are, c.Nitrile is often classified as an acid derivative because it…

Q: Valacyclovir is an antiviral drug that slows the growth and spread of the herpes virus to help the…

A:

Q: To make an amide, you could react an amine with a(n) alkene ether alcohol O acid anhydride

A: Amine + ?    -----> Amide

Q: Draw the structure of the following three isomeric amides with chemical formula C6H11NO. Amide #1:…

A:

Q: Please draw a hydrogen bond between an amine group and a carboxyl group. Use a dotted line to…

A: The objective of this question is to describe a hydrogen bond between an amine group and a carboxyl…