Consider these generic half-reactions.Half-reactionOxO y² +● Z³+X+ (aq) + e¯Y2 (aq) + 2 e¯-Z³+(aq) + 3e¯OZ³+O y² +—Identify the strongest oxidizing agent.Z→ X(s)ΟΥX+OZIdentify the strongest reducing agent.Y(s)Z(s)ΟΥOXOx+E° (V)1.490.70-1.22Identify the weakest oxidizing agent.Ox+OzO Y²+O Z³+Identify the weakest reducing agent.X+Z³+YΟΥOxXOzY²+X

We know, Oxidizing agent: oxidize other and undergo reduction itself Reducing agent: Reduce other…

Consider these generic half-reactions. Half-reaction Ox O y² + Z³+ X+ (aq) + e- Y2 (aq) + 2e Z³+(aq) + 3 e Identify the strongest oxidizing agent. OZ³+ O Y²+ Z Y(s) -Z(s) X(s) ΟΥ X+ Oz Identify the strongest reducing agent. ΟΥ Ox Ox+ E° (V) 1.49 0.70 -1.22 Identify the weakest oxidizing agent. X+ OZ O Y²+ O Z³+ X+ Z³+ Identify the weakest reducing agent. ΟΥ Y X Z y² + X

Consider these generic half-reactions. Half-reaction Ox O y² + Z³+ X+ (aq) + e- Y2 (aq) + 2e Z³+(aq) + 3 e Identify the strongest oxidizing agent. OZ³+ O Y²+ Z Y(s) -Z(s) X(s) ΟΥ X+ Oz Identify the strongest reducing agent. ΟΥ Ox Ox+ E° (V) 1.49 0.70 -1.22 Identify the weakest oxidizing agent. X+ OZ O Y²+ O Z³+ X+ Z³+ Identify the weakest reducing agent. ΟΥ Y X Z y² + X

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 33QRT: Consider these half-reactions: (a) Which is the weakest oxidizing agent? (b) Which is the strongest...

See similar textbooks

Related questions

Q: Which of the following chemical reactions is an oxidation-reduction reaction? O Mg(s) + CO29) →…

Q: Complete and balance the following redox reaction in basic solution Al(s) + OH (aq) → AIO₂ (aq) +…

A: Redox Reaction :Redox reaction is a the reaction that involves the transfer of electrons between…

Q: The following reactions are used in batteries:I 2H₂(g)+ O₂(g) → 2H₂O(l) E(cell)=1.23 V II Pb(s)…

A: (a)

Q: In a reactin between copper metal and aqueous iron(III) chloride, Fe3+(aq) is reduced to Fe2+(aq),…

A: The given information says that reaction is a redox reaction. The overall balanced equation for…

Q: Consider these generic half-reactions. Half-reaction E° (V) X+(aq) + e- → X(s) -1.30 Y²+(aq) + 2 e-…

A: In this question, we have to find out the correct answers of given problem by the help of…

Q: Write balanced half-reactions for the following redox reaction: 2+ 6 Zn²+ (aq) + C₂H₂OH(1) + 3…

Q: Write balanced half-reactions for the following redox reaction: H₂ AsO4(aq) + 4H₂O()+8 CI (aq)…

A: Answer: When in a chemical reaction reduction and oxidation takes place then such reactions are…

Q: Write balanced half-reactions for the following redox reaction: 2CO,(g)+12H* (aq)+12C1 (aq) →…

A: Answer:

Q: Balance the following reactions in acidic medium add H+ or OH - depending on what medium the…

A: The balanced half-cell reactions are: Oxidation half-cell:C2O42- (aq) →2 CO2 (g) + 2e-×6Reduction…

Q: Write balanced half-reactions for the following redox reaction: 3 Cl₂(g) + 2 Cr³+ (aq)+14 OH¯(aq) →…

Q: Write balanced half-reactions for the following redox reaction: 12 CO₂(aq)+C₂H₂OH(1)+12OH¯(aq) →…

A: The addition of electrons or decreases in the oxidation state is known as a reduction reaction and…

Q: Write balanced half-reactions for the following redox reaction: 4 Cl2(g)+ AsH 3(g)+4H,0(1) → 8 Ci…

A: Since in the above reaction Cl2 is converting to Cl- by reduction and As in AsH3 with -3 oxidation…

Q: Write balanced half-reactions for the following redox reaction: Cr,0; (aq)+7H,0(1)+3 Zn(s) →…

A: To solve this problem we have identifie which species is oxidised and which is reduced .

Q: Write balanced half-reactions for the following redox reaction: 2+ + 4 Zn(aq) + AsH3(g) + 4H₂O(1) 4…

A: A reaction in which oxidation & reduction occurs simultaneously is called Redox…

Q: Balance the following redox reactions in basic solution CH,CHO(I) + Cu(s) CH₂COO (aq) + Cu₂O(s)…

A: According to the bartleby guidelines for the multipart questions I can solve only first three…

Q: (1) Identify each of the following half-reactions as either an oxidation half-reaction or a…

A: Since you have posted multiple question , as per guidelines we can answer one per session . If you…

Q: Write balanced half-reactions for the following redox reaction: 8 CO₂(aq) + AsH₂(g) +8 OH¯(aq) →…

Q: (1) Identify each of the following half-reactions as either an oxidation half-reaction or a…

Q: Write balanced half-reactions for the following redox reaction: OH (aq) 412(s)+AsH3(g)+8 - 81…

A: Loss of an electron is oxidation whereas gain of an electron is reduction. On the other hand, we…

Q: Write balanced half-reactions for the following redox reaction: 41(s)+ AsH₂(g)+4H₂O() 81 (aq)+H,AsO…

Q: What is the oxidation half reaction in the following chemical reaction? J(s) + 2 M+(aq) → J2+(aq) +…

A: Answer- oxidation half reaction - A half reaction is obtained by considering the change in…

Q: Write balanced half-reactions for the following redox reaction: 5 Ch(9)+2 Mn (aq)+16 OH (aq) → 10 CI…

Q: Write balanced half-reactions for the following redox reaction: 3+ 3 Cl₂(g) + 2 Cr³+ (aq) +14 OH¯…

A: Oxidation is defined as increase in oxidation state of the element. while reduction is defined as…

Q: Consider the following balanced redox reaction: 16H+(aq) + 2MnO4-(aq) + 10Cl-(aq) →…

A: Species whose oxidation occur is called reducing agent and the species whose reduction occur is…

Q: Write balanced half-reactions for the following redox reaction: 8 CO₂(aq) + AsH3(g) + 8 OH (aq) 4C₂0…

Q: Write balanced half-reactions for the following redox reaction: 2+ 4 Zn²+ (aq) +AsH₂(g) +8 OH (aq)…

Q: Balance the following oxidation-reduction reaction that occurs in an acidic solution using the…

A: First we determine reduction half reaction from given cell reaction. Reduction is the lose of…

Q: Write balanced half-reactions for the following redox reaction: 2+ Fe²+ (aq)+NO3(aq) + 2 H+ (aq) 3+…

Q: Complete and balance the following redox equations using the smallest whole-number coefficients. The…

A: In balancing a chemical equation we will make the elements equal in both the side. In basic medium…

Q: Balance the following reaction in basic solution. Fill in the coefficients for the balanced overall…

Q: + 1.14 V TI Pt Cr3+ (1 M) Cr2+ (1 M) T13+ (1 M) T13+ (aq) + 3e-→ TI (s) Cr2+ (aq) → Cr3+ (aq) + What…

A: From the above electrochemical cell it has been observed that the electrons are being transferred…

Q: Write balanced half-reactions for the following redox reaction: 3+ 3 Cl₂(g) + 2 Cr³+ (aq)+7 H₂O(l) →…

A: Answer: Word Redox is the combination of Red (from reduction) and Ox (from oxidation), that's why…

Q: Balance the following redox reaction under acidic conditions. H2O2(aq) + Cl2O7(aq) = ClO2-(aq) +…

A: The reaction taking place is given as, => H2O2 (aq) + Cl2O7 (aq) ------> ClO2- (aq) + O2 (g)…

Q: Consider the redox reaction below: O2(g) + 2H*(aq) + Fe(s) → Fe2+(aq) + H2O2(aq) The reducing agent…

A: We are given a redox reaction. We need to determine the reducing agent in it. Reducing agent is the…

Concept explainers

Electrolysis

Electrolysis is defined as the process of breaking down ionic compounds into their constituent elements by passing a direct electric current through the compound in a fluid state. The cathode reduces cations, while the anode oxidizes anions. An electrolyte, electrodes, and some form of external power source are the main components required for conducting electrolysis. A partition, such as an ion-exchange membrane or a salt bridge, may also be used, but this is optional. These are primarily used to prevent the products from diffusing near the opposing electrode.

Question

Consider these generic half-reactions.
Half-reaction
Ox
O y² +
● Z³+
X+ (aq) + e¯
Y2 (aq) + 2 e¯-
Z³+(aq) + 3e¯
OZ³+
O y² +
—
Identify the strongest oxidizing agent.
Z
→ X(s)
ΟΥ
X+
OZ
Identify the strongest reducing agent.
Y(s)
Z(s)
ΟΥ
OX
Ox+
E° (V)
1.49
0.70
-1.22
Identify the weakest oxidizing agent.
Ox+
Oz
O Y²+
O Z³+
Identify the weakest reducing agent.
X+
Z³+
Y
ΟΥ
Ox
X
Oz
Y²+
X

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

1. If you wish to convert 0.0100 mol of Au3+ (aq) ions into Au(s) in a “gold-plating” process, how long must you electrolyze a solution if the current passing through the circuit is 2.00 amps? 483 seconds 4.83 104 seconds 965 seconds 1450 seconds
For the reaction Cu2+(aq) + Zn(s) → Cu(s) + Zn2+ (aq), why can’t you generate electric current by placing a piece of copper metal and a piece of zinc metal in a solution containing CuCl2(aq) and ZnCl2(aq)?
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
An electrolytic cell is set up with Cd(s) in Cd(NO3)2(aq) and Zn(s) in Zn(NO3)2(aq). Initially both electrodesweigh 5.00 g. After running the cell for several hours theelectrode in the left compartment weighs 4.75 g. (a) Which electrode is in the left compartment? (b) Does the mass of the electrode in the right compartmentincrease, decrease, or stay the same? If the masschanges, what is the new mass? (c) Does the volume of the electrode in the right compartment increase, decrease, or stay the same? If the volumechanges, what is the new volume? (The density of Cd is8.65 g/cm3.)
Consider the following cell running under standard conditions: Fe(s)Fe2+(aq)Al3+(aq)Al(s) a Is this a voltaic cell? b Which species is being reduced during the chemical reaction? c Which species is the oxidizing agent? d What happens to the concentration of Fe3+(aq) as the reaction proceeds? e How does the mass of Al(s) change as the reaction proceeds?
Order the following oxidizing agents by increasing strength under standard-state conditions: Mg2+(aq), Hg2+(aq), Pb2+(aq).
For the following half-reactions, answer the questions below. Co3+(aq)+eCo2+(aq)E=+1.953VFe3+(aq)+eFe2+(aq)E=+0.769VI2(aq)+2e2I(aq)E=+0.534VPb2+(aq)+2ePb(s)E=0.127VCd2+(aq)+2eCd(s)E=0.402VMn2+(aq)+2eMn(s)E=1.182V (a) Which is the weakest reducing agent? (b) Which is the strongest reducing agent? (c) Which is the strongest oxidizing agent? (d) Which is the weakest oxidizing agent? (e) Will Pb(s) reduce Fe3+(aq) to Fe2+(aq)? (f) Will I-(aq) reduce Pb2+(aq) to Pb(s)? (g) Which ion(s) can be reduced by Pb(s)? (h) Which if any metal(s) can be oxidized by Fe3+(aq)?
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
An electrode is prepared from liquid mercury in contact with a saturated solution of mercury(I) chloride, Hg2Cl, containing 1.00 M Cl . The cell potential of the voltaic cell constructed by connecting this electrode as the cathode to the standard hydrogen half-cell as the anode is 0.268 V. What is the solubility product of mercury(I) chloride?
Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.