Consider the reaction 2Fe(s) + 3Cl2(g) >>2FeCl3(s) Using standard thermodynamic data at 298K, calculate the entropy change for the surroundings when 2.12 moles of Fe(s) react at standard conditions. AS° surroundings J/K

What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the formation of hydrogen sulfide from the elements? H2(g)+18S8(s)H2S(g)

It has been demonstrated that buckminsterfullerene (C60), another allotrope of carbon (Section 2.3), may be converted into diamond at room temperature and 20,000 atmospheres pressure (about 2 GPa). The standard enthalpy of formation, fH, for buckminsterfullerene is 2320 kJ/mol at 298.2 K. a. Calculate rH for the conversion of C60 to diamond at standard state conditions and 2982 K. b. Assuming that the standard entropy per mole of carbon in both C60 and diamond is comparable (both about 23 J/K mol), is the conversion of C60 to diamond product-favoredat room temperature?

Billions of pounds of acetic acid are made each year, much of it by the reaction of methanol with carbon monoxide. (AssumeT= 298 K.) CH3OH() + CO(g) CH3COOH() (a) By calculating the standard Gibbs free energy change, rG, for this reaction, show that it is product-favored. (b) Determine the standard Gibbs free energy change, rG,for the reaction of acetic acid with oxygen to form gaseous carbon dioxide and liquid water. (c) Based on this result, is acetic acid thermodynamicallystable compared with CO2(g) and H2O()? (d) Is acetic acid kinetically stable compared with CO2(g)and H2O()?

Use data from Appendix D to calculate the standardentropy change at 25°C for the reaction CH3COOH(g)+NH3(g)CH3NH2(g)+CO2(g)+H2(g) Suppose that 1.00 mol each of solid acetamide, CH3CONH2(s), and water, H2O(l), react to give thesame products. Will the standard entropy change belarger or smaller than that calculated for the reactionin part (a)?

A 220-ft3 sample of gas at standard temperature and pressure is compressed into a cylinder, where it exerts pressure of 2000 psi. Calculate the work (in J) performed when this gas expands isothermally against an opposing pressure of 1.0 atm. (The amount of work that can be done is equivalent to the destructive force of about 1/4 lb of dynamite, giving you an idea of how potentially destructive compressed gas cylinders can be if improperly handled!)

What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)

Limestone is predominantly CaCO3, which can undergo the reaction CaCO3(s)CaO(s)+CO2(g). We know from experience that this reaction is not spontaneous, yet S for the reaction is positive. How can the second law of thermodynamics explain that this reaction is not spontaneous?

What is the second law of thermodynamics? For any process, there are four possible sign combinations for Ssys and Ssurr. Which sign combination(s) always give a spontaneous process? Which sign combination(s) always give a non-spontaneous process? Which sign combination(s) may or may not give a spontaneous process?

The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the entropy change for the vaporization of 1 mol methanol (use data from Table 16.1 or Appendix J). (b) Calculate the enthalpy of vaporization of methanol, assuming that rS doesnt depend on temperature and taking the boiling point of methanol to be 64.6C.