Consider the following galvanic cell: Agls) | Ag"(3,0 x 10“ M) || Fe³"(1.1 × 10³ M), Fe²"(0.040 M) | Pt(s) Choose the correct cell potential. O Esel = +0.12V O Esell = - 0.15 V O Ecel =+0.09 V O Ecel-0.12V Determine the sign of the electrodes in the cell. The left side half-cell is the and charged. The right side half cell is the and charged. Enter the equation for the spontaneous cell reaction. (Enter states of matter in your answer.)

Consider the following galvanic cell: Agls) | Ag"(3,0 x 10“ M) || Fe³"(1.1 × 10³ M), Fe²"(0.040 M) | Pt(s) Choose the correct cell potential. O Esel = +0.12V O Esell = - 0.15 V O Ecel =+0.09 V O Ecel-0.12V Determine the sign of the electrodes in the cell. The left side half-cell is the and charged. The right side half cell is the and charged. Enter the equation for the spontaneous cell reaction. (Enter states of matter in your answer.)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 153CP: Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment...

See similar textbooks

Similar questions

From the standard potentials Ag2SeO4(s)+2e2Ag(s)+SeO42-E0=0.355V Ag++2eAg(s)E0=0.799V calculate the solubility product constant for Ag2SeO4.
The standard potential, E, for the reaction of Zn(s) and Cl2(g) is +2.12 V. What is the standard free energy change, rG, for the reaction?
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
Table 17-1 lists common half-reactions along with the standard reduction potential associated with each half-reaction. These standard reduction potentials are all relative to some standard. What is the standard (zero point)? lf is positive for a half-reaction, what does it mean? If is negative for a half-reaction, what does it mean? Which species in Table 17-1 is most easily reduced? Least easily reduced? The reverse of the half-reactions in Table 17-1 are the oxidation half-reactions. How are standard oxidation potentials determined? In Table 17-1, which species is the best reducing agent? The worst reducing agent? To determine the standard cell potential for a redox reaction, the standard reduction potential is added to the standard oxidation potential. What must be true about this sum if the cell is to be spontaneous (produce a galvanic cell)? Standard reduction and oxidation potentials are intensive. What does this mean? Summarize how line notation is used to describe galvanic cells.
Consider a cell reaction at 25°C where n=2 . Fill in the following table.
What is the cell potential (Ecell) of a spontaneous cell that is run at 25C and contains [Cr3+] = 0.10 M and [Ag+] = 1.0 104 M?
From the standard potentials Tl++eTl(s)E0=0.336V TlCl(s)+eTl(s)+ClE0=0.557V calculate the solubility product constant for TlCl.
Consider the reaction low at 25°C: 3SO42(aq)+12H+(aq)+2Cr(s)3SO2(g)+2Cr3+(aq)+6H2O Use Table 17.1 to answer the following questions. Support your answers with calculations. (a) Is the reaction spontaneous at standard conditions? (b) Is the reaction spontaneous at a pH of 3.00 with all other ionic species at 0.100 M and all gases at 1.00 atm? (c) Is the reaction spontaneous at a pH of 8.00 with all other ionic species at 0.100 M and all gases at 1.00 atm? (d) At what pH is the reaction at equilibrium with all other ionic species at 0.100 M and all gases at 1.00 atm?
What is the voltage of a concentration cell of Fe2+ ions where the concentrations are 0.0025 and 0.750 M? What is the spontaneous reaction?
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Consider the reaction below at 25°C: 2MnO4(aq)+16H+(aq)+10Br(aq)2Mn2+(aq)+5Br2(l)+8H2O Use Table 17.1 to answer the following questions. Support your answers with calculations. (a) Is the reaction spontaneous at standard conditions? (b) Is the reaction spontaneous at a pH of 2.00 with all other ionic species at 0.100 M? (c) Is the reaction spontaneous at a pH of 5.00 with all other ionic species at 0.100 M? (d) At what pH is the reaction at equilibrium with all other ionic species at 0.100 M?
Calculate the standard cell potential of the cell corresponding to the oxidation of oxalic acid, H2C2O4, by permanganate ion. MnO4. 5H2C2O4(aq)+2MnO4(aq)+6H+(aq)10CO2(g)+2Mn2+(aq)+8H2O(l) See Appendix C for free energies of formation: Gf for H2C2O4(aq) is 698 kJ.