CHE2613/101/0/2022The reaction of methylpropene with HBr, under radical conditions, gives two3.2intermediates. Propose a mechanism for the formation of the two products.(8)Propose a mechanism for the following reaction and use electronic factors to account for3.3the formation of a major product:CH2CH2BrN-Bromosuccinímide (NBS)ho, CCI4(2)3.4Draw the structure of an antioxidant, Vitamin E free radical and use resonance structuresto account for its stability.(9)Question 4[38]4.1Use electronic factors to explain why methyl carbanion is more stable than tertiary butylcarbanion.(9)4.2Rank the following intermediates in order of increasing stability. Account for your choice::CH2:CH2CH2-CH2:CH2NO2CH3OCH3(8)

Free radical takes place when homolysis cleavage takes place.

CHE2613/101/0/2022 3.2 The reaction of methylpropene with HBr, under radical conditions, gives bve intermediates. Propose a mechanism for the formation of the two products. (8) 3.3 Propose a mechanism for the following reaction and use electronic factors to account for the formation of a major product: CH2 CH2BR N-Bromosuccinimide (NBS) ho, CCI4 (7) 3.4 Draw the structure of an antioxidant, Vitamin E free radical and use resonance structures to account for its stability. (6) Question 4 [38] 4.1 Use electronic factors to explain why methyl carbanion is more stable than tertiary butyl carbanion. (6)

CHE2613/101/0/2022 3.2 The reaction of methylpropene with HBr, under radical conditions, gives bve intermediates. Propose a mechanism for the formation of the two products. (8) 3.3 Propose a mechanism for the following reaction and use electronic factors to account for the formation of a major product: CH2 CH2BR N-Bromosuccinimide (NBS) ho, CCI4 (7) 3.4 Draw the structure of an antioxidant, Vitamin E free radical and use resonance structures to account for its stability. (6) Question 4 [38] 4.1 Use electronic factors to explain why methyl carbanion is more stable than tertiary butyl carbanion. (6)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

1. 2. 1. -CH3 H Ph HO 2. + E2 Elimination aqueous H₂SO4 a = Electrophilic addition b = C = SN1 Nucleophilic substitution f = Carbonyl nucleophilic addn Submit Answer NaOH Retry Entire Group OH CH3 d Ph = SN2 Nucleophilic substitution g e Electrophilic aromatic substitution h = Identify the mechanism by which each of the reactions above proceeds from among the mechanisms listed. Use the letters a - i for your answers. = 6 more group attempts remaining Nucleophilic subs at carbonyl(acyl Xfer) Conjugate (nucleophilic) addn
A) 132 L. CH;CI 2) 3) 1.) CH;I 2) Ag,0 3) A B) 1) NAOCH,CH, 2) H,0® HO. D) please include major and minor if more than one product
+ |/ IN B F. option con gE K. { C. P. H. 7. R. 6. & 5. 4. %24 MacBook Pro C-H o C-C T C-C o Answer Bank bond in acetylene that it describes. Acetylene, C2H2 (also known as ethyne), is commonly used as a fuel for welding torches. Label each picture with the type of
When 3-methyl-1-butene is reacted with 9-borabicyclo[3.3.1]nonane, the "1-ol" product is formed. What is the detailed reactin scheme for the transformation? Describe the purification procedure.
(76) What is the major THERMODYNAMIC product for the following reaction?
What would the % yield of ester be if the reaction were simply allowed to equilibrate (i.e. no products are removed)? C3H7OH+C2H5COOH=C6H12O2+H2O Percent yield of ester was 71.6% weight of product= 20.7868g 19.0mL (0.25mol) of n- propanol 18.5 mL (0.25 mol) of propionic acid At room temperature, the equilibrium constant, Keq is approximately 3.
Calculate the percent recovery from recrystallization. Diels-Alder Reaction Data: Mass of anthracene: 0.503g Mass of maleinanhydride: 0.251 g Mass of filter paper: 0.681 g Mass of filter paper and crude product: 1.192 g Mp of crude product: 250-262 C Mass of watch glass: 47.220g Mass of watch glass + recrystallized product: 47.694 g Mp of recrystallized product: 260-262 C
6.14 In the bulk polymerization of methyl methacrylate at 60°C with azo-bis-isobutyronitr- ile as the initiator the initial rates of initiation and polymerization are 1.7×10-6 mol/L-s and 8.8×10-4 mol/L-s, respectively. Predict the initial molecular weight of the polymer formed in this system, if the extent of disproportionation is 70% at 60°C. Neglect chain transfer reactions for the calculation. [Ans. 60,800]
4.1) Propose a mechanism for the following polymerisation reaction: CH3 CH3 AICI3/H₂O H₂C- -CH₂ H₂C= C TI CH3 CH3Jn CH3 CH3 + CI-AI-OH
Draw the product formed when the structure shown below undergoes substitution with OH. Interactive 3D display mode ÇH, H Brl Draw the molecule on the canvas by choosing buttons from the Tools (for bonds), Atoms, and Advanced Template toolbars. The single bond is active by default. Show the appropriate stereochemistry by choosing the dashed or wedged buttons and then clicking a bond on the canvas. O O ® H: EXP. -(7)- %3D H. C
Which compound below is the product expected from the following reaction? но он heat он но он но А. В. С. D. O A O B s/459850/take# MacBook Pro G Search or type URL 23 %$4 & 3. 4 6. 7 8. R J
n-Pentanol (CH3CH2CH2CH2CH2OH) and 2-methylbutan-2-ol (CH3CH2C(CH3)2OH) are converted to their corresponding alkyl chorides on being reacted with hydrogen chloride. (a) Write out an equation for each reaction (b) Assign each the appropriate symbol (SN1 or SN2) (c) Write a suitable mechanism for each reaction