Answered: Calculate the standard molar enthalpy…

Calculate the standard molar enthalpy of formation of NO(g) (in KJ) from the following data: 2NO(g)+O2¬2NO2(g) AHº=-114.1kJ N2(g)+2O2¬2NO2(g)AH°=66.4kJ Type your answer. Previous

Chemistry & Chemical Reactivity

10th Edition

ISBN:9781337399074

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter5: Principles Of Chemical Reactivity: Energy And Chemical Reactions

Section5.7: Enthalpy Calculations

Problem 5.10CYU: Calculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3...

See similar textbooks

Similar questions

Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
A student performing a calorimetry experiment combined 100.0 ml. of 0.50 M HCI and 100.0 ml. of 0.50 M NaOH in a StyrofoamTM cup calorimeter. Both solutions were initially at 20.0 C, but when the two were mixed, the temperature rose to 23.2 C (a) Suppose the experiment is repeated in the same calorimeter but this time using 200 mL of 0.50 M HCl and 200.0 ml of 0.50 M NaOH. WIII the AT observed be greater than, less than, or equal to that in the first experiment, and why? (b) Suppose that the experiment is repeated once again in the same calorimeter, this time using 100 mL of 1.00 M HCI and 100.0 ml. of 1.00 M NaOH. Will the T observed be greater than, less than, or equal to that in the first experiment, and why?
The statement Energycan beneithercreatednor destroyedis sometimes used as an equivalent statement of the first law of thermodynamics. There areinaccuracies to the statement, however. Restate it tomake it less inaccurate.
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
When 1.000 g of ethylene glycol, C2H6O2, is burned at 25C and 1.00 atmosphere pressure, H2O(l) and CO2(g) are formed with the evolution of 19.18 kJ of heat. a Calculate the molar enthalpy of formation of ethylene glycol. (It will be necessary to use data from Appendix C.) b Gf of ethylene glycol is 322.5 kJ/mol. What is G for the combustion of 1 mol ethylene glycol? c What is S for the combustion of 1 mol ethylene glycol?
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
The decomposition of ozone, O3, to oxygen, O2, is an exothermic reaction. What is the sign of q? If you were to touch a flask in which ozone is decomposing to oxygen, would you expect the flask to feel warm or cool?
Principles of Heat Flow Titanium is a metal used in jet engines. Its specific heat is 0.523 J/g C. If S.SS g of titanium absorb 4.78 J, what is the change in temperature?
At 298 K, the standard enthalpies of formation for C2H2(g) and C6H6(l) are 227 kJ/mol and 49 kJ/mol, respectively. a. Calculate H for C6H6(l)3C2H2(g) b. Both acetylene (C2H2) and benzene (C6H6) can be used as fuels. Which compound would liberate more energy per gram when combusted in air?
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?