A Moving to the next question prevents changes to this answer.Question 2Calculate AH for the formation of benzoic acid from its constituent elements7C(s) + 3H2(g) + O₂(g) → C6H5COOH(s)Given:C6H5COOH(s) + 15/2 O2(g) → 7CO2(g) + 3H₂O(l)C(s) + O2(g) - CO₂(g)H2(g) + O2(g) → H₂O(l)Attach FileBrowse Local FilesAH = -771.2 kcalAH-94.05 kcalAH = -68.32 kcalMoving to the next question prevents changes to this answer.(2)(3)

The required reaction : 7C(s) +3H2(g)+O2(g)→C6H5COOH(s)

Calculate AH for the formation of benzoic acid from its constituent elements 7C(s) + 3H₂(g) + O₂(g) → C6H5COOH(s) - Given: C6H5COOH(s) + 15/2 O2(g) → 7CO2(g) + 3H₂O(l) C(s) + O2(g) - CO2(g) H2(g) + O2(g) → H₂O(1) AH-771.2 kcal AH-94.05 kcal AH = -68.32 kcal (2) (3)

Calculate AH for the formation of benzoic acid from its constituent elements 7C(s) + 3H₂(g) + O₂(g) → C6H5COOH(s) - Given: C6H5COOH(s) + 15/2 O2(g) → 7CO2(g) + 3H₂O(l) C(s) + O2(g) - CO2(g) H2(g) + O2(g) → H₂O(1) AH-771.2 kcal AH-94.05 kcal AH = -68.32 kcal (2) (3)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: Consider the following thermochemical equations (Note: HA is a weak acid) H+(aq) + OH-(aq) → H2O(l)…

A: Choose the equation that shows the correct relationship between their enthalpy changes--

Q: Using the equations Sro (s) + CO, (g) → SrCO, (s) AH° = -234 kJ/mol 2 Sr(s) + O, (g) → 2 SrO (š) AH°…

Q: From the enthalpies of the reaction H2(g)+F2(g)→2HF(g)AH=-537kJ C(s)+2F2(g) →CF4(g)AH=-680kJ…

A: Hess's law states that the enthalpy of a reaction is same whether the reaction takes place in one or…

Q: The lead-acid storage battery is the oldest rechargeable battery in existence. It was invented in…

A: Given that : There are two reactions that take place during the discharge of the lead-acid storage…

Q: A chemist measures the enthalpy change AH during the following reaction: 8 SO,(g) + 16 H,S(g)→3…

Q: Given the reactions, X(s) + 0,(g) → XO(s) ΔΗ-861.9 kJ XCO,(s) → XO(s) + CO,(g) ΔΗ+339.3 J what is AH…

Q: Given the following combustion data for three different fuels: CH4 (g), C8H18 (l) and CH3OH (l), CH4…

A: The ratio of energy to the molar mass is known as energy density.

Q: CH,(9) + 2 0,(g) AH = -809.0 kJ/mol Co,(g) + 2 H,0(g) AH = -81.3 kJ cond 2 H,0() Given the energy…

A: In combustion of methane two steps are given as per diagram . So first we would calulate ∆Hrxn ( in…

Q: (Equation 1) 4 Fe2O3(s) + 20 NO2(g) + 22 H2O(l) + 5 O2(g) → 8 Fe(OH)3(s) + 20 HNO3(aq) AH= -1811.2…

A: Given Equations Equation 1: 4 Fe2O3 (s) + 20 NO2 (g) + 22 H2O (l) + 5O2 (g) → 8 Fe(OH)3 (s) +…

Q: crose, C2HO1, is common table sugar. The enthalpy change at 25°C and 1 atm for the complete burning…

Q: What is the enthalpy of the reaction P406 (s) + 202(g)→P4010(s), given a) P4(s) + 302(g)→P406 AH =…

Q: How much work, w, must be done on a system to decrease its volume from 20.0 L to 13.0 L by exerting…

A: Since you have posted multiple questions, we are entitled to answer the first only. Given: Constant…

Q: Ethylene (C₂H4) plays an important role in the ripening of certain fruits and vegetables. It is…

A: Answer:ai and bi are the stoichiometric coefficients of products and reactants respectively.

Q: Calculate the AH for the reaction NO(g)+ 0(g) → NO2(g) given the following information NO(g) + O3(g)…

A: The change in enthalpy ( ΔH ) of a reaction can be found out using Hess's law of heat summation.…

Q: CH,(g) + 2 0,(g) AH rxn = -809.0 kJ/mol co,(g) + 2 H,O(g) AH = -81.3 kJ cond 2 H,O(/) Given the…

A: Combustion is the process of reaction of a hydrocarbon in presence of oxygen to form carbon dioxide…

Q: Given the standard enthalpy changes for the following two reactions: (1) 2C(s) + H₂(g) → C₂H₂ (9)…

A: C2H2(g)→2C(s)+H2(g) ∆H1∘=-226.7kJ2C(s)+2H2(g)→C2H2(g) ∆H2∘= 52.3kJC2H2(g) +H2(g)→C2H4(g)…

Q: The addition of HBr to CH2=CH2, an exothermic reaction. Define this ?

A: A reaction is said to be exothermic when the energy is released in the reaction due to which change…

Q: Given the standard enthalpy changes for the reactions: Pals) + 302(8) → PaO6[s) AH° = -1640 kJ/mol…

A: Equation 1: P4(s) + 3O2(g) → P4O6(s) ∆H° = - 1640 KJ/mol Equation 2: P4(s) + 5O2(g)→ P4O10(s)…

Q: Consider the following reaction: 3 C(s) + 4 H₂(g) → C3H8(g) Which of the following statements is…

A: The spontaneous nature of a system can also be predicted by the Gibbs free energy change of the…

Q: B Ethanol (C,H.OH) is an alternative to gasoline or octane as a fuel for automobiles. Standard…

A: By combustion it evolves heat and that amount of heat can be calculated by using Hess' law of…

Q: 3 Draw labelled energy level diagrams for the following reactions: a S(s) + O₂(g) → SO₂(g) AH-297 kJ…

A: The amount of energy released or absorbed when one unit of reactants are changed into products.

Q: Using the equations N2 (g) + O2 (g) → 2 NO (g) AH° = 180.6 kJ/mol N2 (g) + 3 H2 (g) → 2 NH3 (g) AH°…

A: The reactions given are, 1) N2 (g) + O2 (g) ------> 2 NO (g) ΔHo = 180.6…

Q: kJ H2(g) + 0.502(g) → H₂O(g) AH-241.8- AS-44.5 J-mol¯-K-¹ mol So, mol¹KI החומר ??? H₂O(®) 130.7…

Q: Given the following reaction, calculate the enthalpy of reaction. Identify whether the reaction is…

Q: Target Equation: (1) Mg(s) + 1/2 O2 (g) → MgO(s) Reactions: (2) MgO (s) + 2 HCl (aq) → MgCl2…

A: Given: Reaction Mass (grams) of MgO(s) Mass (grams) of Mg(s) Volume (mL) of HCl(aq)…

Q: It is interesting to compare the “fuel value” of a hydrocarbonin a hypothetical world where oxygen…

A: If we have to find which reaction is more exothermic we can do it by finding the deltaH value for…

Q: What is the heat of reaction, ΔH°? CO2(g) + H2O(l) à H2CO3(aq) –20.2 kJ mol–1 –1379 kJ mol–1…

A: Multiple questions

Q: 11. Consider the following reaction. CH;CH3 + O2- Co, + H,0 a) Calculate the enthalpy of the…

A: Introduction: We have to calculate the enthalpy of reaction. Since, data is not given so, we can…

Q: enthalpy

Q: Calculate ΔH (in kJ/mol) for the reaction described by the equation. 6 NH3(g) + 5 O3(g) → 6 NO(g) +…

A: Tha delta H represents the enthalpy change during the reaction. Now if the enthalpy change is…

Q: Given the standard enthalpy changes for the following two reactions: (1) 2Pb(s) + O₂(g) → 2PbO(s)…

A: Recall the given reactions, 1 2 Pb s + O2 g → 2 PbO s…

Q: The combustion of methanol is shown by the following equation: 2 CH₂OH()+30₂(g) → 2 CO₂(g) + 4H₂O(g)…

A: Given ,Objective :To find enthalpy of reaction.To find molar enthalpy of combustion of methanolFind…

Q: Calculate AH for the reaction NH3 (g) + CH4 (g) → HCN (g) + 3 H, (g), from the following data. N2…

Q: 12. Consider the following process. + 2H,O(e) AH = -802 kJ %3D CH4 (8) + 202 (8) 2 CO2 (8) A) Is the…

A: We have to predict the change in enthalpy and it's nature.

Q: Write a balanced equation for the formation of CO2(g) from C(s) and O2(g). Calculate the enthalpy…

A: Basic concepts: Balanced chemical equation: Balanced chemical equation may be stated as the number…

Q: Use the enthalpy for the combustion of propane (C3H8) to compare the energy from this common fuel to…

A: It is impossible to create energy from nothing in accord with the "conversation of energy" and…

Q: Given these reactions, where X represents a generic metal or metalloid 1) H, (g) + 0,(g) → H,O(g)…

A: Given,

Q: 9-3. Find the enthalpy change for this reaction using the data below. Clearly show how you got the…

A: Concept is based on Hesses law:

Q: (a) The atomic weight of carbon is 12, hydrogen is 1 and oxygen is 16, and the formula for the…

A: The balanced chemical reaction is as follows; CH4 + 2O2 --------------> CO2 + 2H2O +…

Q: 6A + 2C 6D Determine the enthalpy(AH) in kJ of the above reaction using the reactions below: 6B 2C…

A: The enthalpy change is a state function and the Hess law states that the change of enthalpy in a…

Q: Given these reactions, where X represents a generic metal or metalloid 1) H, (g) + 0,(g) H,O(g) AH,…

A: The ΔH of the desired reaction can be determined using Hess’s Law. According to Hess’s Law, if a…

Q: Determine the enthalpy (in kJ/mol) for the reaction 3 SiCl₄ (s) + 4 Fe (s) → 4 FeCl₃ (s) + 3 Si (s)…

A: To solve this we have to do some mathematical operations with the given two equations to get the…

Q: Combustion reactions involve reacting a substance with oxygen When compounds containing carbon and…

A: The reaction taking place is given as, => C2H2 (g) + 2 H2 (g) ------> C2H6 (g) Given : Heat of…

Q: What is the enthalpy of reaction (in kJ/mol rxn) for CaCO3(s) → CaO(s) + CO2(e) if Ca(s) + Cgraphite…

Q: 26. From the relevant bond energies given below, find the approximate AH° ( in kilojoules) for the…

A: The given chemical equation is: CH4(g) + 3Cl2(g) ----> CHCl3(g) + 3HCl(g) When bond energy…

Question

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Explain why each of the following chemical equations is not a correct formation reaction:(a) 4 AI(s) + 3 O2(g)→2 AI2O3(s)(b) N2(g) +3/2 H2(g) → NH3(g)(c) 2 Na(s) + O(g) → Na2O(s)
Consider the following thermochemical equations (Note: HA is a weak acid)H+(aq) + OH-(aq) → H2O(l) ΔH1HA(aq) → H+(aq) + A-(aq) ΔH2HA(aq) + OH-(aq) → A-(aq) + H2O(l) ΔH3Choose the equation that shows the correct relationship between their enthalpy changes. A.) ΔH1 = ΔH3 - ΔH2 B.) ΔH2 = ΔH1 + ΔH3
Which reaction is the formation reaction for CaO(s)? In other words, which equation has a AHn value equal to the AH; value for CaO(s) Ca?+(aq) + O2-(aq) · CaO(s) Ca(s) + 0,(g) — СаО(s) O 2 Ca(s) + O,(g) — 2 СаО(s) O 2 CaO(s) 2 Ca(s) + O2(g) > О Са0(s) — Сa('s) + 30,(g)
The reaction that was on the screen when you started and its derivative demonstrate that the reaction enthalpy, ΔH, changes sign when a process is reversed. Consider the reaction H2O(l)→H2O(g), ΔH =44.0kJ What will ΔH be for the reaction if it is reversed?
2 (a) In this investigation, you will use a polystyrene-cup calorimter to determine the amount of heat released during acid-base neutralization reactions. Find information in your textbook, an encyclopedia, or a web site about calorimetry. Sketch the apparatus for a polystrene-cup calorimeter. (b) For more precise heat of reaction measurnments, chemists use a device called bomb calorimeter. How is a bomb calorimeter similar to and different from a polystyrene-cup calorimeter?
Hydrazine, N3H4, is a colorless liquid used as a rocket fuel. What is the enthalpy change for the process in which hydrazine is formed from its elements? N3(9) + 2H2 (9) + N2H4 (1) Use the following reactions and enthalpy changes: N2H, (1) + O2 (9) + N2(9) + 2H, 0(1); AH = -622.2 kJ H2 (9) +O2(g) H20(1); AH = -285.8 kJ ΔΗ- k)
Consider the following thermochemical equations (Note: HA is a weak acid)H+(aq) + OH-(aq) → H2O(l) ΔH1HA(aq) → H+(aq) + A-(aq) ΔH2HA(aq) + OH-(aq) → A-(aq) + H2O(l) ΔH3Choose the equation that shows the correct relationship between their enthalpy changes.
(a) Draw a Lewis diagram for carbonic acid, H,CO3, with a central carbon atóm bonded to the three oxygen atoms. (b) Carbonic acid is unstable in aqueous solution and converts to dissolved carbon dioxide. Use bond enthal- pies to estimate the enthalpy change for the following reaction: H,CO;→ H,O + CO,
19 Hydrogenation of double and triple bonds is an important industrial process. Calculate (in kJ) the standard enthalpy change ΔH° for the hydrogenation of ethyne (acetylene) to ethane using average bond enthalpies (use exam data sheet values). H–C≡C–H(g) + 2H2(g) → H3C–CH3(g)
What is the average bond energy in CO2? CO2(g) ΔH°f, = –393.5 kJ mol–1 CO(g) ΔH°f, = –110.5 kJ mol–1 C(g) ΔH°f, = +715 kJ mol–1 CO32–(aq) ΔH°f, = –676.3 kJ mol–1 O(g) ΔH°f, = +249.0 kJ mol–1 Question 5 options: 207 kJ mol–1 1607 kJ mol–1 804 kJ mol–1
calculate the reaction energy of the following reactions and then determine if they are endothermic or exothermic:C3H8 + 5O2 => 3CO2 + 4H2O
What is the enthalpy change when a 50.00 g sample of methane undergoes complete combustion according to the equation CH4(g) + 2O2(g) → CO2(g) + 2H2O(ℓ) What is the enthalpy of the reaction per mole of O2(g) consumed, CO2(g) produced, and H2O(ℓ) produced?