C What mass of O2, in grams, is required for complete combustion of 39.0 g of methane? Mass = 155.52 Correct 1. Convert the mass of CH4 to amount of CH4. 2. Use the stoichiometric factor to calculate the amount of O2 required. 3. Calculate the mass from amount. 2 mol O2 32.00 g 1 mol CH4 16.04 g 39.0 g CH4 x = 156 g O2 1 mol CH4 1 mol O2 dWhat is the total mass of products expected from the combustion of 39.0 g of methane? Total mass =

C What mass of O2, in grams, is required for complete combustion of 39.0 g of methane? Mass = 155.52 Correct 1. Convert the mass of CH4 to amount of CH4. 2. Use the stoichiometric factor to calculate the amount of O2 required. 3. Calculate the mass from amount. 2 mol O2 32.00 g 1 mol CH4 16.04 g 39.0 g CH4 x = 156 g O2 1 mol CH4 1 mol O2 dWhat is the total mass of products expected from the combustion of 39.0 g of methane? Total mass =

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

4.- According to the following reaction: C3H8 + CO2 + H₂O What is the mass of CO2 produced if 865 g of C3H8 are consumed?
Suppose the following reaction was carried out in the presence of excess Al. Al + Cl2 ---> AlCl3 How many moles of Al are consumed if 9.07 moles of Cl2 were fully reacted?
TABLE 3. PERCENT YIELD Mass salicylic acid 9 Mass of synthesized aspirin g 9 Theoretical Yield (aspirin) Percent Yield % Calculations: Note: Show calculations in a separate bond paper. (For the percent yield, you must first determine the limiting reactant from the following data: molar mass of salicylic acid = 138 g; molar mass of acetic anhydride = 102 g; density of acetic anhydride = 1.08 g/mL). TABLE 4. MELTING POINT DATA Sample Melting Point Range salicylic acid synthesized aspirin
10. Balance the equation for the combustion of butane, C,H,. C.H10 + O, > со, + H2O a. If 31.4 grams of butane burn according to this reaction, how many grams of oxygen would you need to ensure all the butane burned? (112 g O,)
If a reaction is run that is supposed to produce 125 g (theoretical yield) of product and the actual yield of product that was produced was 73.5 g, what is the percent of yield of this reaction? A. 170% B. 1.70% C. 73.5% D. 58.8%
10
8 This is for my reviewer please help me with the step by step solution and answer, thank you
the reaction of 15 moles of carbon with 30 moles of oxygen will result in a theoretical yield of ____ moles of CO2 is what?
2 Mg(s) + O2(g) -> 2 MgO(s) When 1.5 g of magnesium burns, the theoretical yield of magnesium oxide is ____ g.
How many grams of N2 are needed to completely (stoichiometrically) react with 222 g of Br2 ? N2 + 3 Br2 2 NB13 + 44.0 kJ The molar mass of Br2 is g and the molar mass of N2 is mol Br2 (2.22 x 102 g Br2)(- mol Br2 g Br2 mol N2 mol Br2 (-- -) = mol N2 mol Br2 g N2 mol N2 (-- -) = |v g N2 mol N2 а. 1 b. 2 С. 3 d. 4 е. 5 f. 253.719 g. 3.38 х 100 h. 3.26 x 103 i. 44.0 j. 1.33 x 102 k. 9.77 x 103 I. 4.44 x 102 m. 6.66 x 10² n. 500.0 o. 556 р. 90.0 q. 3.2852 r. 159.81 s. 28.013 t. 1.750 u. 0.8750 v. 13.0 w. 0.46306 х. 1.3892 у. 24.5 z. 38.5 аа. 2.190 bb. evolved Cc. absorbed dd. exothermic ee. endothermic
Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield
10. What are shared in covalent bonds?* Cations Protons Electrons Anions 11. What type of reaction does the equation describe? LICIO2 --> LICI + 02 * Synthesis Double Replacement Single Replacement Decomposition 12. Molybdenum has a molar mass of 95.94 g/mol. How many moles are in 150.0g of Molybdenum? O 0.1563 mol O 0.6396 mol O 1.563 mol 6.396 mol O O