Based on their calculations, a student expected their synthesis to yield 5.3 mmol of triphenylcarbinol (MW = 260.33 g/mol). After their reaction is completed, they report an actual yield of 0.82 g. What was their percent yield? O a. 16% b. 4.0% O c. 59% d. 0.59%

Based on their calculations, a student expected their synthesis to yield 5.3 mmol of triphenylcarbinol (MW = 260.33 g/mol). After their reaction is completed, they report an actual yield of 0.82 g. What was their percent yield? O a. 16% b. 4.0% O c. 59% d. 0.59%

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: What are the theoretical yields of H2O and CO2 (in grams)? a.103.51 g and 152.27 g b. 56.50 g and…

Q: Thymol, a substance used as an antiseptic in mouthwash, is composed of C, H, and O. When a 0.1658-g…

A: Empirical formula: The simplest positive integer ratio of atoms present in a compound is known as…

Q: Acetylene gas, HCCH, is commonly used in high temperature torches. a. Write a balanced chemical…

A: a. The balanced chemical reaction of acetylene with hydrogen gas to form ethane is given as, C2H2…

Q: atter.) 115 g of methane is reacted with an equal mass of sulfur.

A: In balanced chemical reaction number of atoms of each element in product side is equal to number of…

Q: a. Write the balanced chemical equation for the diagram above b. If you have 0.031 moles of…

A: A balanced chemical reaction is one where the number of atoms of each element is same on the product…

Q: 5. Aspartame is an artificial sweetener that is 160 times sweeter than sucrose (table sugar) when…

A: Molecular formula is C14 H18 N2 O5 We need to find it's molar mass. Amount of molecules in 10.0 g…

Q: Aluminum carbide reacts with water to form aluminum hydroxide and methane. If 3.30 g of aluminum…

A: The mass of aluminum carbide = 3.30 gThe mass of water = 3.60 gThe mass of excess reagent left =?…

Q: 3. Hydrogen reacts with nitrogen to form ammonia by the following equation: 3 H₂(g) + N2(g) → 2…

A: We will first convert the mass of H2 and N2 to moles and determine the effective moles using the…

Q: 7. What do the symbols of s, I, g, and aq stand for in a chemical equation?

A: Since you have asked multiple questions, according to guidelines I will answer the first one for…

Q: nsider the following reaction: 3 Hg(OH)2 + 2 H3PO4  Hg3(PO4)2 + 6 H2O…

A: Moe concept is being used to solve such problems. The mole concept was proposed by Avogadro. It…

Q: 4. Sodium reacts with water to form sodium hydroxide and hydrogen gas. a. Write a balanced equation…

Q: 2. Pentane combusts with oxygen to form carbon dioxide and water by the following reaction: C5H12(1)…

A: Note: As per our guidelines, we are supposed to answer only one question when multiple questions are…

Q: Consider the balanced chemical reaction below. Calculate the percent yield for the reaction. MnO: +…

A: Limiting reagent is the reactant molecule that is consumed first in the reaction and therefore…

Q: 13)A hydrocarbon is an organic compound that contains carbons and hydrogens only. What is the…

A: Molar mass of hydrocarbon = 86 g/mol% of hydrogen in the hydrocarbon = 16.4

Q: 32. Find the mass of oxygen present in 1.50 mole of sucrose (C12H22011). a. 195 g b. 200 g c. 245 g…

A: 1mol is defined as 1/12th part of the mass of C-12 atom.

Q: Titanium (Ti) is a strong, lightweight metal used in the construction of rockets, jet engines, and…

A: Answers are explained below.

Q: 3. 2 H2O + 2 Li -> 2 LiOH + H2 25.4 g of water reacts with 12.2 g of lithium. Which reactant will…

Q: Acetylene gas, HCCH, is commonly used in high temperature torches. a. write a chemical equation…

A: Limiting reactant :- A reactant which is present in lesser number of moles than required as per…

Q: What mass of carbon dioxide is produced when 5.0 g of methane (CH4) combusts with 17.1 g of oxygen…

A: Given:- Mass of methane=5.0 g Mass of oxygen = 17.1 g To find:-Mass of carbon dioxide

Q: 92. Aluminum metal reacts with elemental chlorine to form aluminum chloride, as shown here: 2 Al (s)…

Q: 150. g of carbon tetrachloride reacts with 100. g antimony (III) fluoride to produce…

Q: C What mass of O2, in grams, is required for complete combustion of 12.7 g of ethane? Mass = g O2…

Q: 1. Caproic acid, which is responsible for the foul odor of dirty socks, is composed on C, H, and O…

A: 1) Using the given information, we have to calculate the empirical formula and molecular formula

Q: A mixture of 112.1 g112.1 g of PP and 115.8 g115.8 g of O2O2 reacts completely to form P4O6P4O6 and…

Q: For the combustion of butanol (C4H10O), what mass (in g) of butanol must we react to produce 60.7 g…

A: Step 1:- First, a balanced chemical equation for the combustion of butanol is written. Step 2: Then…

Q: 16. A metal has the mass of 12.00 g and 5.850 x 1022 atoms. Calculate molar mass of the metal. O…

Q: a. Write a balance equation for the reaction described above. b. How many kilograms of N2 are…

A: (a) The balance chemical equation for the prepration of NH3, using Haber process is :- N2 + 3 H2 ⇌…

Q: 3. Hydrogen reacts with nitrogen to form ammonia by the following equation: 3 H₂(g) + N₂(g) → 2…

Q: 50. Calculate the number of moles in a 10.0 g sample of NaOH. 23 23 a. 0.250 mole b. 1.66 x 10 mole…

Q: Diarsenic trioxide reacts with water to form arsenous acid (H3AsO3). a. Write a balanced equation…

A: Balanced chemical reaction is the chemical equation that contains an equal number of atoms of each…

Q: 3. If 50.0 g of O2 are mixed with 50.0 g of H₂ according to the balanced reaction below, what mass…

A: A question based on mole concept. A balanced equation for the formation of water from H2 gas and O2…

Q: 6. A compound contains C, H, and I. Burming 18.42 g of this compound produced 0.42 g H2O. Treatment…

A: Given : Mass of compound burning = 18.42 g Mass of H2O produced on burning = 0.42 g Mass of compound…

Q: Complete combustion of a 1.448 g sample of a hydrocarbon (only carbon and hydrogen present),…

A: Given -> Weight of hydrocarbon = 1.448 gm Weight of CO2 = 3.128 gm Weight of H2O = 1.121 gm

Q: Titanium (Ti) is a strong, lightweight metal that is used in the construction of rockets, jet…

A: The answer to the given question is as follows:

Q: In each chemical reaction below, an atom or group of atoms is moving. It is bonded to something…

A: #18) Rxn : 4H2 + CO2 --> CH4 + 2H2O

Q: For each of the following unbalanced chemical equations, suppose 10.0 g of each reactant is taken.…

A: We will calculate the expected mass for each product by using limiting reagent .

Concept explainers

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.

Question

Based on their calculations, a student expected their synthesis to yield 5.3 mmol of
triphenylcarbinol (MW = 260.33 g/mol). After their reaction is completed, they report an
actual yield of 0.82 g. What was their percent yield?
%3D
a. 16%
O b. 4.0%
c. 59%
O d. 0.59%

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

How many sodium ions are present in 20.0 mL of 0.10 M Na2S
For the combustion of butanol (C4H10O), what mass (in g) of butanol must we react to produce 60.7 g of product? N.B. combustion is the reaction of a substance with molecular oxygen (O2) to produce what and carbon dioxide.
Which of the following represents a combustion reaction? A. 2Na(s) + 2H2O(l) → 2NaOH(aq) + H2(g) B. LiOH(aq) + HNO3(aq) → LiNO3(aq) + H2O(l) C. N2(g) + 3H2(g) → 2NH3(g) D. 2C2H6(g) + 7O2(g) → 4CO2(g) + 6H2O(l) E. 2Al(s) + 3H2SO4(aq) → Al2(SO4)3(aq) + 3H2(g)
A mixture of 132.1 g of P and 136.5 g of O, reacts completely to form P¸O, and P,0,o: Find the masses of P,0, and P,O10 that are formed by the reaction. mass of P406: g mass of P¿010: g 4
For the following reaction: N2(g) + 3 H2(g) -----> 2 NH3(g) a. Determine the limiting reactant from 28.0g of N2 and 8.00g of H2. b. Determine the theoretical yield of NH3 in grams. c. Calculate the percent yield if the actual yield was 29.6 grams.
a. A 2.0 M potassium chloride solution is prepared by dissolving 37.3 g of potassium chloride in distilled water. What is the volume of the solution formed?(Relative atomic masses: K = 39.1, Cl = 35.5) b. What volume of 0.05 M Na2CO3 solution can be prepared from 2.65 g of Na2CO3?(relative atomic mass Na=23.0, C=12.0, O=16.0) c. Which of the following apparatus is usually used to deliver 25.0 cm3 of a solution into a conical flask?A. BuretteB. PipetteC. Beaker D. Volumetric flask
If a reaction is run that is supposed to produce 125 g (theoretical yield) of product and the actual yield of product that was produced was 73.5 g, what is the percent of yield of this reaction? A. 170% B. 1.70% C. 73.5% D. 58.8%
Pls helo ASAP. Pls help in all asked questions.
What amount (moles) is represented by each of these samples? a. 20.8 mg caffeine, C3H10 N4O2 Amount = mol b. 3.43 x 1021 molecules of ethanol, C2 H; OH Amount = mol c. 1.48 g of dry ice, CO2 Amount = mol
4. Modern pewter is composed of 91.0% Sn, 7.5% Sb and 1.5 % Cu. What mass of pewter contains 150. g of Sb? What mass of Cu is in 212 g of pewter? 91.0g Snx Imole In X I mole In = 108 mole In 118.71g Sn
ABS plastic is a polymer consisting of three monomer units: acrylonitrile (C₃H₃N), butadiene (C₄H₆), and styrene (C₈H₈). A sample of ABS plastic contains 11.9% N by mass. It took 1.56 g of Br₂ to react completely with a 2.00 g sample of ABS plastic. Bromine reacts 1:1 (by moles) with the butadiene units in the polymer and nothing else, so bromination is a method for determining the quantity of butadiene in the polymer. What is the percent by mass of styrene in the polymer?
Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield