**Oxidation-Reduction Reaction Balancing in Basic Solution****Problem Statement:**Balance the following oxidation-reduction reaction in a basic solution. **Hint:** - Oxygen oxidation number is -2 in \( \text{Cr}_2\text{O}_7^{2-} \) (aqueous), -1 in \( \text{H}_2\text{O}_2 \) (aqueous), and 0 in \( \text{O}_2 \) (gas).- Hydrogen oxidation number is +1.**Reaction:** \[ \text{Cr}_2\text{O}_7^{2-} (aq) + \text{H}_2\text{O}_2 (aq) \rightarrow \text{Cr}^{3+} (aq) + \text{O}_2 (g) \]

Given: Cr2O72-(aq)+H2O2(aq)→Cr+3(aq)+O2(g) Calculation for oxidation state of Cr in Cr2O72-: let x…

Balance the following oxidation-reduction reaction in basic solution. Hint: Oxygen oxidation number is -2 in Cr2072 (aq) and -1 in H2O2(aq) and 0 in O2(9) . Hydrogen oxidation number is +1. Cr* (aq) O2(9) + Cr2072 (aq) + H2O2(aq)

Balance the following oxidation-reduction reaction in basic solution. Hint: Oxygen oxidation number is -2 in Cr2072 (aq) and -1 in H2O2(aq) and 0 in O2(9) . Hydrogen oxidation number is +1. Cr* (aq) O2(9) + Cr2072 (aq) + H2O2(aq)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: 4) Using the following standard reduction potentials, Fe3+ (aq) + e- →→ Fe2+(aq) E° = +0. 77 V…

A: Standard reduction potential,Fe3+(aq) + e- -----> Fe2+(aq) E° = +0.77 VNi2+(aq) + 2e- ------>…

Q: Balance the following redox reaction. Cr₂O72- (aq) + (aq) → 103 (aq) + Cr³+ (aq) (acidic conditions)

Q: Write balanced half-reactions for the following redox reaction: 12 Fe"(aq)+C,H;OH(1)+12 OH¯(aq) → 12…

A: Reduction - It is the addition of electrons to an atom or ion to decrease its oxidation number.…

Q: Show work, thank you!

A: Given: Cr2O7(aq)2−+HNO2(aq)→Cr(aq)3++NO3(aq)−Step 1: Write the…

Q: Given the following 2AgCl(s) +X(s) → 2Ag(s) + 2Cl-(aq) + X2+(aq) E°cell = 0.73 V and…

A: Given reaction: 2AgCl(s) +X(s) → 2Ag(s) + 2Cl-(aq) + X2+(aq) E°cell = 0.73 V AgCl(s) → Ag(s)…

Q: or Questions 11-16: Balance the following oxidation-reduction reaction in acidic conditions using…

A: Redox reaction is the chemical reaction in which oxidation and reduction reactions take place…

Q: Write the balanced equation, including states of matter, for the oxidation half-reaction. 2. Write…

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Q: 2NANO3 (aq) + 5CO (g) + 2HCI (aq) – > N2 (g) + H2O (e) + 5CO2 (g) + 2NACI (aq) - -- Write the…

Q: Consider the following two half-reactions and their standard reduction potentials, and answer the…

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

A: Recall the given redox reaction, 6 Cl- aq + 2 NO3- aq + 8 H+ aq → 3 Cl2 g…

Q: Complete and balance the following redox reaction in basic solution 3c₂2²- 1 + C MnO4 (aq) + C₂O4²-…

Q: [1] Balance the following redox reaction in acidic solution. CrO (aq) + HSNO2¯(aq) → CrO2 (aq) +…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Complete the stepwise process of balancing the following reaction in acidic conditions. Cr20;²"(aq)…

A: The unbalanced equation is Cr2O7–2 (aq) + HNO2 (aq) -------> Cr+3 (aq) + NO3– (aq) In this…

Q: When the following skeletal equation is balanced under basic conditions, what are the coefficients…

A: To balance the equation following steps are involved : 1) write oxidation and reduction half…

Q: a. Choose the item that correctly describes the oxidizing agent and the reducing agent in the…

A: a) Answer: Option: C changes from oxidation number +2 to +4. The CO is the reducing agent. Al…

Q: Give the balanced Oxidation and Reduction half reactions for CO2(g)+H2O(l)C6H12O6+O2(g)

A: During photosynthesis in presence of sunlight (hv) carbon-di-oxide and water reacts to form…

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

Q: [4] Balance the following redox reaction in basic solution. SO;2- (aq)+ Cr207 (aq) → Cr*(aq) +…

A: Redox reaction is combination of both oxidation and reduction

Q: When the Hg2+ concentration is 1.18 M, the observed cell potential at 298K for an electrochemical…

A: We have to find the concentration of Mn²+ and ∆G° and hence tell about value of K

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

A: Relation between standard cell potential and standard Gibbs free energy change is shown below:…

Q: Standard Reduction Potentials (Volts) at 25 °C Cl2 (g) + 2 e- 2 Cl- (aq) 1.360 O2(g) + 4 H3O+(aq) +…

A: The process of electrolysis is a combination of oxidation and reduction. When any element releases…

Q: Give the explanation of correct and incorrect options.Which one of the following processes…

A: In chemistry, oxidation is a process where a substance loses electrons. This can occur through the…

Q: Use standard reduction potentials to calculate the standard free energy change (ΔGº) for the…

A: The standard reduction potential is the reduction potential of a molecule which measures the…

Q: Identify the oxidizing and reducing agents in the skeletal (unbalanced) reaction. Then, balance the…

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

A: Answer: Relation between standard cell potential and standard Gibbs free energy change is shown…

Q: Complete and balance the following redox reaction in acidic solution 2+ MnO4 (aq) + S₂O3(aq) →…

Q: Balance the following equation and write the sum of the coefficients of the reactants and products…

A: To solve this problem we have to balanced the given chemical equation in basic conditions.

Q: Balance the following using half-reaction method: HCOOH(aq) + MnO4 (aq) Mn²+ (aq) (acidic) CO2(g) +

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

A: Here we are required to calculate the standard reaction free energy for the given redox reaction.

Q: Balance the following redox reaction in an acidic and a basic solution: Hg(1) + H₂SO4 (aq) +…

A: we have to balance the given equation

Q: a b с Zn d Cu2+ (aq) + 2e → Cu(s) Cu(s) → Cu²+ (aq) + 2e Zn(s) → Zn²+ (aq) + 2e™ Zn²+ (aq) +2e →…

A: The cell presented in the given question is a Zn-Cu galvanic cell, Where zinc is oxidised and copper…

Q: Balance the following equations. When balancing equations for redox reactions in aqueous solution,…

Q: Identify what is undergoing oxidation-reduction in the following reactions (some of the following…

Q: Balance the following in basic solution. Lowest possible coefficients. Omit phases. Show oxidation…

A: Oxidation half : Zr(OH)2 + 2OH- -----> ZrO2 +2H2O + 2e- Reduction half : O2 + 2H2O + 4e-…

Q: Balance the following redox reaction in basic solution. H2(g)+Cl₂(9) H2O(l)+Cl (aq) H2(g) + C₁₂ (g)…

A: Step 1 The chemical reaction involves the reaction between the reactant and the reagent, and the…

Q: Balance the following half-reactions by adding the appropriate number of electrons (e-). Then,…

A: Given half reaction, I2(s) +6H2O ------> 2IO3 - + 12H+ To balance the half reaction, species on…

Question

100%

**Oxidation-Reduction Reaction Balancing in Basic Solution**

**Problem Statement:**

Balance the following oxidation-reduction reaction in a basic solution.

**Hint:**
- Oxygen oxidation number is -2 in \( \text{Cr}_2\text{O}_7^{2-} \) (aqueous), -1 in \( \text{H}_2\text{O}_2 \) (aqueous), and 0 in \( \text{O}_2 \) (gas).
- Hydrogen oxidation number is +1.

**Reaction:**
\[ \text{Cr}_2\text{O}_7^{2-} (aq) + \text{H}_2\text{O}_2 (aq) \rightarrow \text{Cr}^{3+} (aq) + \text{O}_2 (g) \]

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Give detailed Solution with explanation needed
please help me to answer this question and show all work so that i may understand, thank you!
The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced OXIDATION half reaction. S2O32- + Bi(OH)3Bi + SO32- Reactants Products
Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free energy following redox reaction. Be sure your answer has the correct number of significant digits. ■ 10Fe²+ (aq) +2103 (aq) +12H* (aq) → 10Fe³ KJ 10Fe³+ (aq) + ¹₂ (s) + 6H₂O (1) x10 X Ś AGO for the ? olo 18 Ar
Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free energy AGO for the following redox reaction. Round your answer to 3 significant digits. 2C1 (aq) + 2HNO₂ (aq) + 2H* (aq) → Cl₂ (g) + x10 +2NO(g) + 2H₂O (1) X
balance the following redox reaction if it occurs in basic solution. what are the coefficients in front of CLO2 and H2O in the balanced reaction? H2O2(1) + ClO2 (aq) --> ClO2- (aq) + O2(g)
Answer the four questions below related to the spontaneous redox reaction that occurs whenCr(OH)3(s) reacts with NO3–(aq) to produce CrO42–(aq)and NO2–(aq) under basic conditions. Write the balanced net ionic equation, including states of matter, for the overall reaction.
In the following half reaction, what class of reaction is shown? 202 (aq) 0₂ (8) + 4e dissociation decomposition oxidation. O replacement O reduction
[3] Balance the following redox reaction in basic solution. Sb;O;(s) + NO; (aq) → H;SbO4(aq) + NO(g)
Given the following2AgCl(s) +X(s) → 2Ag(s) + 2Cl-(aq) + X2+(aq) E°cell = 0.73 V and AgCl(s) → Ag(s) + Cl-(aq) E°= 0.222 V What is the standard reduction potential for X2+(aq)?
Identify what is undergoing oxidation-reduction in the following reactions: 6H+(aq) + MnO4−1(aq) + 5H2O2(l) → 2Mn+2(aq) + 5O2(g) + 8H2O(l) a.) What is undergoing oxidation and what is the change in the oxidation numbers? b.) What is undergoing reduction and what is the change in the oxidation numbers? c.) What are the oxidizing and reducing agents?
Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free energy Be sure your answer has the correct number of significant digits. 3+ 4Fe²+ (aq) + O₂(g) + 4H* (aq) → 4Fe³+ (aq) + 2H₂O (1) KJ x10 X Ś AGO for the following redox reaction.