B1 Consider the inside and outside of a cel, where the 8-nanometer-thick cell membrane has a large number of open Na lon channels. The major contributor to these lons is dissolvedNaCL Lets analyze a "toy moder of the cell's resting potential in which the Na" lon channels are the only ion channels, they are permanontly open, and Nacl is the only oontributor ofNa* ions. Assume the outside of the cell has a concentration of 150 mM NaCI and that the concentration inside the cell is much, much lower.in this problem, use a temperature of 290K, at which kT= 0.025 K.Part AI the Nermat potential for the sodium ions in our toy model is 60 mV, what would the concentration of NoCi be on the inside of the cel? ignore the Cl iona]mMSubmitReguest AnswerPart BNow let us refine our model by noting that there is a second source of Na ions in the cell: Nal. Supposo the outside of the cell has a concentration of Nal of 0.04 mM and the insidehas a Nal concentration of 4 mM. How will the presence of these ions change the Na" Nornst potential across the membrane? (Assume the Nal io fully ionized in solution)

Here E = 60 mV or 60 × 10-3 V (as 1000mV = 1V). At T = 298 K, (2.303 × RT/F) = 0.059

Science

Chemistry

B1

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter21: Potentiometry

Section: Chapter Questions

Problem 21.11QAP

See similar textbooks

Similar questions

What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Consider the solutions presented: (a) Which of the following sketches best represents the ions in a solution of Fe(NO3)3(aq)? (b) Write a balanced chemical equation showing the p10ducts of the dissolution of Fe(NO3)3.
Calculate K at 25°C for each of the reactions referred to in Question 32. Assume smallest whole-number coefficients.
A concentration cell is constructed having Zn elelctrodes in two ZnSO4 solutions A and B. At 25°C, the osmotic pressure of the two solutions are 56.3 atm and 0.563 atm, respectively. Calculate the Ecell, assuming no ion pair formation. Pi= iMRT
10. Calculate the equilibrium membrane potentials to be expected across a membrane at 37 °C, with a NaCl concentration of 0.10 M on the right and 0.01 M on the left, given the following conditions. In each case, state which side is (+) and which is (-). (a) Membrane permeable only to Na*. (b) Membrane permeable only to Cl. (c) Membrane equally permeable to both ions. 11. In each of a, b, and c of Problem 10, will any appreciable transport of mate- rial take place in establishing the membrane potential? Briefly explain cach answer.
If the mitochondrial electric potential between the matrix and the intermembrane space were 42 mV, how much ATP could be synthesized from the transport of 4.5 mol H+, assuming the pH difference between the matrix and the intermembrane space is -1.5? Note that the standard Gibbs energy for the hydrolysis of ATP to ADP is -31 kJ/mol.
State what you would expect to happen to the cell potential when the following changes are made to the corresponding cells as attached. Confirm your prediction by using the Nernst equation in each case.(a) The molar concentration of si lver nitrate in the left-hand compartment is increased.(b) The pressure of hydrogen in the left-hand compartmentis increased.(c) The pH of the right-hand compartment is decreased.(d) The concentration of HCI is increased.(e) Some iron (lll) chloride is added to both compartments.(f) Acid is added to both compartments.
12. For the following reaction that occurs at 25°C. 3Zn(s) + 2Cr3*(aq) 3Zn2*(aq) + 2Cr(s) (a) Write the cell notation. (b) Calculate the standard electrode potential, E°cell. Calculate the cell potential if the concentrations of Cr3+ and Zn2+ ions are 0.10 M and 0.0090 M respectively. (c) (d) Calculate the equilibrium constant for the reaction: 3Zn(s) + 2Cr3"(aq) 3Zn2*(aq) + 2Cr(s) [+0.02 V, +0.06 V, 1.1×10²]
The electrochemical cell: SCE||H+(a=x)|glass electrodehas a potential of 0.2094 V when the solution in the right-hand compartment is abuffer of pH 4.006. The potential reading for an unknown solution measured by thesame glass electrode was –0.3011 V. Calculate the pH and the hydrogen ion activityof the unknown solution. Assume a Nernstian response for the glass electrode.
(a) In the electrolysis of aqueous NaCl, how many liters of Cl2(g) (at STP) are generated by a current of 81.2 A for a period of 59.2 min? The unbalanced chemical reaction representing this electrolysis is shown below.NaCl(aq) + H2O(l) Cl2(g) + H2(g) + NaOH(aq) liters of Cl2(g) is generated by this electrolysis.(b) How many moles of NaOH(aq) are formed in the solution in this process? moles of NaOH(aq) are formed.
Assume the pe of the surface water of a lake is controlled by the O2/H2O half-reaction. What would the concentration of ferrous iron (Fe2") be in the system if it has a pH of 8 and it is in equilibrium with the atmosphere (Po2 = 0.21 atm)? Assume the temperature is 25 °C. log K pe O2(g) + 4H* + 4e" = 2H,0 83.1 20.78 FEOOH(s) + 3H* + e = Fe2* + 2H2O 13.5 13.50
20.) Ferric oxide is one of the product of rusting. The reaction for the formation of rust is given by: 4Fe + 302 2FE203 Calculate the Gibbs energy of the reaction, if the Gibbs energy of formation of Fe203 (s) is -742.2 k]/mol. A. -742.2 kJ/mol B. +742.2 kJ/mol C. -1484 kJ/mol D. +1484 kJ/mol E.-371 kJ/mol