please see the attached image **Aqueous hydrochloric acid (HCl)** reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and liquid water (H₂O). If 0.569 g of water is produced from the reaction of 1.8 g of hydrochloric acid and 3.9 g of sodium hydroxide, calculate the percent yield of water.Round your answer to 2 significant figures.

he reaction will be as follows: NaOH + HCl -----------> NaCl +H2O. The actual yield of H2O =…

Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and liquid water (H,O). If 0.569 g of water is produced from the reaction of 1.8 g of hydrochloric acid and 3.9 g of sodium hydroxide, calculate the percent yield of water. Round your answer to 2 significant figures.

Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and liquid water (H,O). If 0.569 g of water is produced from the reaction of 1.8 g of hydrochloric acid and 3.9 g of sodium hydroxide, calculate the percent yield of water. Round your answer to 2 significant figures.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 169CWP: Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced...

See similar textbooks

Similar questions

Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
3.82 The particulate scale drawing shown depicts the products of a reaction between N2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
3.81 The particulate scale drawing shown depicts the products of a reaction between H2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
If baking soda (sodium hydrogen carbonate) is heated strongly, the following reaction occurs: :math>2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) lculate the mass of sodium carbonate that will remain if a 1.52-g sample of sodium hydrogen carbonate is heated.
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
4.36 Sometimes students in chemistry labs determine percentage yields greater than 100%. Assuming there is no calculation error, how could this happen?
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): C5H12(l)+O2(g)CO2(g)+H2O(l) If 20.4 g of pentane are burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
In an experiment designed to produce calcium oxide by the chemical reaction 2Ca + O2 2CaO 177.2 g of CaO was obtained out of a possible 203.9 g ofCaO. a. What is the theoretical yield of CaO? b. What is the actual yield of CaO? c. What is the percent yield of CaO?
3.115 The average person exhales 1.0 kg of carbon dioxide in a day. Describe how you would estimate the number of CO2 molecules exhaled per breath for this average person.