please see the attached image **Aqueous hydrochloric acid (HCl)** reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and liquid water (H₂O). If 0.569 g of water is produced from the reaction of 1.8 g of hydrochloric acid and 3.9 g of sodium hydroxide, calculate the percent yield of water.Round your answer to 2 significant figures.

he reaction will be as follows: NaOH + HCl -----------> NaCl +H2O. The actual yield of H2O =…

Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and liquid water (H,O). If 0.569 g of water is produced from the reaction of 1.8 g of hydrochloric acid and 3.9 g of sodium hydroxide, calculate the percent yield of water. Round your answer to 2 significant figures.

Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and liquid water (H,O). If 0.569 g of water is produced from the reaction of 1.8 g of hydrochloric acid and 3.9 g of sodium hydroxide, calculate the percent yield of water. Round your answer to 2 significant figures.

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter5: Stoichiometry

Section: Chapter Questions

Problem 116E: Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of...

See similar textbooks

Related questions

Q: Question 16 Prepreg material has the O the matrix by itself. The fibres are added later. O fibres…

A: A multiple choice question based on polymer chemistry, which is to be accomplished.

Q: A chemist prepares a solution of aluminum chloride (AICI,) by measuring out 46. umol of aluminum…

Q: What is the hybridization of the central atom in the sulfur tetrafluoride (SF) molecule?

A: Hybridization of the central atom in the SF4

Q: Calculate the number of hydrogen atoms in a 50.0 g sample of ammonia (NH,). Be sure your answer has…

A: Given that, 50.0 g sample of NH3. We have to calculate the number of hydrogen atoms in this sample.

Q: Please help me, there are 2 parts attached as 2 screenshots and double and triple check your…

A: Coordination number can be defined as the number of neighboring atoms which are in close association…

Q: Answer the questions in the table below about the shape of the sulfur hexabromide (SBr, molecule.…

A: Lewis’s structure: Lewis’s bonding theory is based on the octet rule. The Lewis structure is a…

Q: Predict the products of the following reaction. If no reaction will occur, use the NO REACTION…

Q: f. CH g. 1. NaNH, NH3(liq) 2. Br Lindlar's Catalyst H₂, Pd/BaSO4 Pro

Q: A technical machinist is asked to build a cubical steel tank that will hold 500 L of water.…

A: Given: Cubical tank of 500 L To find : Smallest possible length of a cubical steel tank that can…

Q: If acidified potassium dichromate(VI) (K2Cr207) acts as oxidizing agent, color changes from orange…

A: Potassium Dichromate (K2Cr2O7) is an orange to the red colored inorganic compound. In the presence…

Q: Starting with diethyl malonate, and using any other reagents of your choice, show how you would…

A: Starting with diethyl malonate, and using any other reagents of your choice, show how you would…

Q: O ATOMS, IONS AND MOLECULES Predicting the formula of ionic compounds with common. Write the…

A: Ionic bonds are due to electrostatic force of interaction.

Q: QI. Provide all of the necessary reagents for the following reactions. Me CO,H (a)

Q: What is the hybridization of the central atom in the bromodifluoride ( BrF, ) anion?

A: In BrF2- anion, Br is the Central atom.

Q: Hydrogen (H) gas and oxygen (0,) gas react to form water (H,O) vapor. Suppose you have 1.0 mol of H,…

Q: The weak monoprotic acid, acetic acid, is titrated with the strong base, potassium hydroxide as…

A: In the titration of weak acid with strong base, the pH of the solution is 7 when base is not added…

Q: O BaCl₂ + 2Nal → Bal₂ + 2NaCl Ba(NO3)2 + Na2SO4 → BaSO4 + 2NaNO3 NaNO3 + BaSO4 → BaNO3 + 2Na2SO4…

Q: Use this diagram to complete the table below. What is the energy of the electron in the ground…

A: This energy diagram shows the allowed energy levels of an electron in a certain atom. (Note: the SI…

Q: What is the correct IUPAC name of the following compound? 10: Problem viewing the image. Click…

A: Identify the parent chain. The longest chain serves as a parent chain.Number the parent chain.…

Q: H,SO, SO,H (fuming) . Provide a reasonable curved arrow mechanism for the following

Q: Solid calcium carbonate (CaCo,) decomposes into carbon dioxide gas and solid calcium oxide. Write a…

Q: the answer must be larger than 2,5 mL. Practice Problem 1.13 (a) How many milliliters are contained…

A: We can observe from the provided photograph that the tylenol liquid level is somewhere between 10 mL…

Q: A chemistry student needs 20.0 mL of pentane for an experiment. By consulting the CRC Handbook of…

A: Given data: The volume of pentane = 20.0 mL. The density of pentaane = 0.626 g.cm-3. To calculate:…

Q: Provide a mechanism for the following transformation: 1. PPh 2. Buli Ph Br Ph 3.

A: THIS IS BASICALLY WITTIG REACTION,WHERE FIRST WE GENERATE THE WITTIG REAGENT WITH: PhCH2Br,PPH3,BuLi

Q: Predict the products of the following reaction. If no reaction will occur, use the NO REACTION…

A: Given :- CH3CH2CH3(g) + O2(g) → To complete :- above given reaction with proper balancing

Q: Consider the reaction profiles provided below. Which reaction profile corresponds to the slowest…

A: A slower reaction has a larger energy gap between the energy of reactants and energy of the…

Q: 17. If the following equations are not balanced, please balance them: Br₂ ( a. K b. CaBr₂ + + Cl₂…

A: 17) Balance the following equation, a) K + Br2 ----> KBr b) CaBr2 + Cl2 ----> CaCl2 + Br2…

Q: Complete the balanced molecular chemical equation for the reaction below. If no reaction occurs,…

A: Since the sum of individual atoms on the left side of the equation matches the sum of the same atoms…

Q: A chemist prepares a solution of magnesium fluoride (MgF,) by measuring out 0.00744 umol of…

Q: www.mac 11 10 HSP-00-525 MWAN ppm 2 lil O G C6H1002

A: The question is based on concept of organic spectroscopy. we have to analyse the spectral data and…

Q: 6. Draw the curved arrow mechanism(s) for the following transformation. Be sure to rationalize the…

A: Given is hydrochlorination reaction.

Q: This is the chemical formula for acetic acid (the chemical that gives the sharp taste to vinegar):…

A: Given : Chemical formula of acetic acid = CH3COOH And moles of carbon in acetic acid sample = 42…

Q: Q4. Indicate how many Pi electrons each of the following compounds and label each as aromatic,…

A: We have find out the pi elections and aromatic, anti aromatic , non aromatic compounds

Q: Cyclohexane derivatives exist primarily in the most stable of the available chair conformations.…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

100%

please see the attached image

**Aqueous hydrochloric acid (HCl)** reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and liquid water (H₂O). If 0.569 g of water is produced from the reaction of 1.8 g of hydrochloric acid and 3.9 g of sodium hydroxide, calculate the percent yield of water.

Round your answer to 2 significant figures.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step 5

Step 6

Trending now

This is a popular solution!

Step by step

Solved in 6 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
3.82 The particulate scale drawing shown depicts the products of a reaction between N2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
3.81 The particulate scale drawing shown depicts the products of a reaction between H2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
If baking soda (sodium hydrogen carbonate) is heated strongly, the following reaction occurs: :math>2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) lculate the mass of sodium carbonate that will remain if a 1.52-g sample of sodium hydrogen carbonate is heated.
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
4.36 Sometimes students in chemistry labs determine percentage yields greater than 100%. Assuming there is no calculation error, how could this happen?
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): C5H12(l)+O2(g)CO2(g)+H2O(l) If 20.4 g of pentane are burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
In an experiment designed to produce calcium oxide by the chemical reaction 2Ca + O2 2CaO 177.2 g of CaO was obtained out of a possible 203.9 g ofCaO. a. What is the theoretical yield of CaO? b. What is the actual yield of CaO? c. What is the percent yield of CaO?
3.115 The average person exhales 1.0 kg of carbon dioxide in a day. Describe how you would estimate the number of CO2 molecules exhaled per breath for this average person.