Aqueous hydrochloric acid (HC1) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and liquid water (H₂O). What is the theoretical yield of water formed from the reaction of 16.4 g of hydrochloric acid and 35.8 g of sodium hydroxide? Round your answer to 3 significant figures. g 0x1.

Aqueous hydrochloric acid (HC1) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium chloride (NaCl) and liquid water (H₂O). What is the theoretical yield of water formed from the reaction of 16.4 g of hydrochloric acid and 35.8 g of sodium hydroxide? Round your answer to 3 significant figures. g 0x1.

World of Chemistry

7th Edition

ISBN:9780618562763

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 49A

See similar textbooks

Similar questions

3.82 The particulate scale drawing shown depicts the products of a reaction between N2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
3.81 The particulate scale drawing shown depicts the products of a reaction between H2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
When corn is allowed to ferment, the fructose in the corn is converted to ethyl alcohol according to the following reaction C6H12O6(aq)2C2H5OH(l)+2CO2(g)(a) What volume of ethyl alcohol (d=0.789g/mL) is produced from one pound of fructose? (b) Gasohol can be a mixture of 10 mL ethyl alcohol and 90 mL of gasoline. How many grams of fructose are required to produce the ethyl alcohol in one gallon of gasohol?
3.115 The average person exhales 1.0 kg of carbon dioxide in a day. Describe how you would estimate the number of CO2 molecules exhaled per breath for this average person.
In an experiment designed to produce calcium oxide by the chemical reaction 2Ca + O2 2CaO 177.2 g of CaO was obtained out of a possible 203.9 g ofCaO. a. What is the theoretical yield of CaO? b. What is the actual yield of CaO? c. What is the percent yield of CaO?
list at least three quantities that must be conserved in chemical reactions.
4.36 Sometimes students in chemistry labs determine percentage yields greater than 100%. Assuming there is no calculation error, how could this happen?