An AgCl (molecular weight of 143.2) surface is grown on an Ag electrode by an electrolyti process. The current in mA passing through the cell is measured and found to be represented by the following equation /= 100 e-t/10 a. If the reaction is allowed to run for a long time, so that the current at the end of this period is essentially zero, how much charge is removed from the battery during the reaction?

An AgCl (molecular weight of 143.2) surface is grown on an Ag electrode by an electrolyti process. The current in mA passing through the cell is measured and found to be represented by the following equation /= 100 e-t/10 a. If the reaction is allowed to run for a long time, so that the current at the end of this period is essentially zero, how much charge is removed from the battery during the reaction?

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 76AP

See similar textbooks

Similar questions

An alloy made up of tin and copper is prepared by simultaneously electroplating the two metals from a solution containing Sn(NO3)2 and Cu(NO3)2.If 20.0% of the total current is used to plate tin, while 80.0% is used to plate copper, what is the percent composition of the alloy?
The table below lists the cell potentials for the 10 possible galvanic cells assembled from the metals A. B. C. D. and E. and their respective 1.00 M 2+ ions in solution. Using the data in the table, establish a standard reduction potential table similar to Table 17-1 in the text. Assign a reduction potential of 0.00 V to the half-reaction that falls in the middle of the series. You should get two different tables. Explain why, and discuss what you could do to determine which table is correct. A(s)in A2+(aq) B(s)in B2+(aq) C(s)in V2+(aq) D(s)in D2+(aq) E(s)in E2+(aq) 0.28V 0.81V 0.13V 1.00V D(s)in D2+(aq) 0.72V 0.19V 1.13V C(s)in V2+(aq) 0.41V 0.94V B(s)in B2+(aq) 0.53V
the electroplating of a silver spoon, the spoon acts as thecathode and a piece of pure silver as the anode. Both dipinto a solution of silver cyanide (AgCN). Suppose that acurrent of 1.5 A is passed through such a cell for 22 minutesand that the spoon has a surface area of 16cm2. Calculatethe average thickness of the silver layer deposited onthe spoon, taking the density of silver to be 10.5gcm3.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Assume the following electrochemical cell simulates the galvanic cell formed by copper and zinc in seawater at pH 7.90 and 25 C. Zn | Zn(OH)2(s) | OH(aq) || Cu(OH)2(s) | Cu(s) a. Write a balanced equation for the reaction that occurs at the cathode. b. Write a balanced equation for the reaction that occurs at the anode. c. Write a balanced chemical equation for the overall reaction. d. Determine the potential (in volts) of the cell.
The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Cu2+(aq)+Ni(s)Cu(s)+Ni2+(aq) (b) 2Ag(s)+Cl2(g)2AgCl(s) (c) Cl2(g)+2I(aq)2Cl(aq)+I2(s)
How long would it take to electroplate a metal surface with 0.500 g nickel metal from a solution of Ni2+ with a current of 4.00 A?
A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment (assume 1.00 L of total solution after the addition). The silver ion reacts with ammonia to form complex ions as shown: Ag+(aq)+NH3(aq)AgNH3+(aq)K1=2.1103AgNH3+(aq)+NH3(aq)Ag(NH3)2+(aq)K2=8.2103 Calculate the cell potential after the addition of 15.0 moles of NH3.