Which equation represents the standard enthalpy change of combustion of ethane, AH°?A. O 2C2H6(g) + 7O2(g) → 4CO2(g) + 6H2O(g)B. O C2H6(g) + 3.50zlA) →+ 3.50alg) –2CO2(g) + 3H2O(g)C. O 2C2H6(g) + 7O2(g) → 4CO2(g) + 6H2O(1)D. O C2H6(g) + 3.502(g) → 2CO2(g) + 3H20(1)

Answered: A. O 2C2H6(g) + 702(g) 4CO2(g) +…

A. O 2C2H6(g) + 702(g) 4CO2(g) + 6H2O(g) B. O C2H6(g) + 3.5014) → 2CO2(g) + 3H2O(g) C. O 2C2H6(g) + 702(g) → 4CO2(g) + 6H20(1) D. O C2H6(g) + 3.502(g) 2CO2(g) + 3H20(1)

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter4: Energy And Chemical Reactions

Section4.10: Standard Formation Enthalpies

Problem 4.18CE

See similar textbooks

Similar questions

A sample of sucrose, C12H22O11, is contaminated by sodium chloride. When the contaminated sample is burned in a bomb calorimeter, sodium chloride does not burn. What is the percentage of sucrose in the sample if a temperature increase of 1.67C is observed when 3.000 g of the sample are burned in the calorimeter? Sucrose gives off 5.64103kJ/mol when burned. The heat capacity of the calorimeter and water is 22.51 kJ/C.
Ethylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJ
Calculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.
When solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?
A 21.3-mL sample of 0.977 M NaOH is mixed with 29.5 mL of 0.918 M HCl in a coffee-cup calorimeter (see Section 6.6 of your text for a description of a coffee-cup calorimeter). The enthalpy of the reaction, written with the lowest whole-number coefficients, is 55.8 kJ. Both solutions are at 19.6C prior to mixing and reacting. What is the final temperature of the reaction mixture? When solving this problem, assume that no heat is lost from the calorimeter to the surroundings, the density of all solutions is 1.00 g/mL, the specific heat of all solutions is the same as that of water, and volumes are additive.
The complete combustion of acetylene, C2H2(g), produces 1300. kJ of energy per mole of acetylene consumed. How many grams of acetylene must be burned to produce enough heat to raise the temperature of 1.00 gal water by 10.0c if the process is 80.0% efficient? Assume the density of water is 1.00 g/cm3
A 29.1-mL sample of 1.05 M KOH is mixed with 20.9 mL of 1.07 M HBr in a coffee-cup calorimeter (see Section 6.6 of your text for a description of a coffee-cup calorimeter). The enthalpy of the reaction, written with the lowest whole-number coefficients, is 55.8 kJ. Both solutions are at 21.8C prior to mixing and reacting. What is the final temperature of the reaction mixture? When solving this problem, assume that no heat is lost from the calorimeter to the surroundings, the density of all solutions is 1.00 g/mL, and volumes are additive.
Sodium carbonate, Na2CO3, is used to manufacture glass. It is obtained from sodium hydrogen carbonate, NaHCO3, by heating. 2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) Calculate the standard enthalpy of reaction, using enthalpies of formation (Table 6.2).
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
Salicylic acid, C7H6O3, is one of the starting materials in the manufacture of aspirin. When 1.00 g of salicylic acid burns in a bomb calorimeter, the temperature of the bomb and water goes from 23.11C to 28.91C. The calorimeter and water absorb 21.9 kJ of heat. How much heat is given off when one mole of salicylic acid burns?
A 10.00-g sample of acetic acid, HC2H3O2, was burned in a bomb calorimeter in an excess of oxygen. HC2H3O2(l)+2O2(g)2CO2(g)+2H2O(l) The temperature of the calorimeter rose from 25.00C to 35.84C. If the heat capacity of the calorimeter and its contents is 13.43 kJ/C, what is the enthalpy change for the reaction?
Explain the difference between heat capacity and specific heat of a substance.