a. 3-ethyl-2-methylhexane b. sec-butylcyclopentane f. 4-butyl-1,1-diethylcyclooctane g. 6-isopropyl-2,3-dimethylnonane c. 4-isopropyl-2,4,5-trimethylheptane h. 2,2,6,6,7-pentamethyloctane d. cyclobutylcycloheptane i. cis-1-ethyl-3-methylcyclopentane e. 3-ethyl-1,1-dimethylcyclohexane j. trans-1-tert-butyl-4-ethylcyclohexane

a. 3-ethyl-2-methylhexane b. sec-butylcyclopentane f. 4-butyl-1,1-diethylcyclooctane g. 6-isopropyl-2,3-dimethylnonane c. 4-isopropyl-2,4,5-trimethylheptane h. 2,2,6,6,7-pentamethyloctane d. cyclobutylcycloheptane i. cis-1-ethyl-3-methylcyclopentane e. 3-ethyl-1,1-dimethylcyclohexane j. trans-1-tert-butyl-4-ethylcyclohexane

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

O A. 4-ethyl-5-methyloctane O B. 4-methyl-5-ethyloctane OC. 4-methyl-3-propylheptane O D.4-methyl-5-propyloctane
A student was given the structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed. a. 4-bromo-3-pentanol b. 2,2-dimethyl-4-ethylheptane c. 5-methylcyclohexanol d. 1,1-dimethyl-2-cyclohexanol e. 5-(2,2-dimethylethyl)nonane f. isopentylbromide g. 3,3-dichlorooctane h. 5-ethyl-2-methylhexane i. 1-bromo-4-pentanol j. 3-isopropyloctane k. 2-methyl-2-isopropylheptane l. 2-methyl-N,N-dimethyl-4-hexanamine
XIII. Draw skeletal structures corresponding to the following names. a. 1-chloro-2-isopropylcyclopentane b. 3,5-dicyclohexylnonane c. 3,3-Diethyl-2,5-dimethylnonane d. 4-Isopropyl-3-methylheptane
1. Identify the SYSTEMATIC name of the aliphatic hydrocarbon a. 1-pentenyicyclopentane b. 1-cyclopentylpent-2-yne c. 1-pentenecyclopent-2-yne d. 1-pentenyicyclopentane 2. Identify the SYSTEMATIC name of the aliphatic hydrocarbon a. Trans-1,2-propylcyclopropane b. Trans-1,2-diisopropylcyclopropane c. Cis-1,2-propylcyclopropane d. Cis-1,2-diisopropylcyclopropane 3. Identify the SYSTEMATIC name of the aliphatic hydrocarbon 3,10-dimethyl-2-decacen-6-yne 3,10-dimethyl-2-dodocen-6-yne 3,10-dimethyl-10-decacen-6-yne d. 3,10-dimethyl-10-dodocen-6-yne a. b. C. 4. Identify which type of isomer the following structures represent HO a. Skeletal Isomer b. E/Z isomer c. Cis/Trans isomer OH OH d. Positional isomer 5. Identify which type of isomer the following structures represent a. Skeletal Isomer Br b. E/Z isomer c Cis/Trans isomer Br d. Positional isomer
2. Draw the correct structure for each given name below. a. 1-butyl-3-ethyl-2-propylcycloheptane b. cis-1,3-diisopropylcyclohexane c. cyclobutylcyclohexane
Compound III (in the provided image) is I. CH3-CH2-C = C-CH3 III. CH3-CH-C=C-CH-CH3 O a. 2-ethyl-5-methyl-3-heptyne O b. 2,5-dimethyl-3-heptyne O c. 2,5-dimethyl-3-hexyne O d. 2-ethyl-5-methyl-3-hexyne CH3 CH2-CH3 II. CH2=CH-CH2-CH-CH3 CH3
What is the condensed structural formula for 3,3-diethyl-2-methylhexane? A. CH3CH2CH(CH2CH3)CH2(CH3)CH2CH3 B. CH3CH2C(CH2CH3)2CH2(CH3)CH2CH3 C. CH3CH(CH3)C(CH2CH3)2CH2CH2CH3 D. CH3C(CH3)2C(CH2CH3)2CH2CH2CH3
Write the formula correctly for the following like shown in the image below. 4,4,5-trimethyl-2-hexyne b. Ethylpropanoate c. 3,4-diethyl-2,3,4-trimethyl-1-hexene d. 3-heptanone e. 2,4-dimethyloct-1-ene-3-ol
I need your help.
2. Draw and write down the expanded formula (see previous question for expanded formula) for the following. a. 4,4,5-trimethyl-2-hexyne b. Ethylpropanoate c. 3,4-diethyl-2,3,4-trimethyl-1-hexene d. 3-heptanone e. 2,4-dimethyloct-1-ene-3-ol Expanded formula shown in the image write exactly like that
5. What is the IUPAC name for the structure below? ОН A. 3-ethyl-4-methyl-2-hexanol B. 2-ethyl-1,3-dimethyl-1-heptanol C. 4-ethyl-3,5-dimethyl-5-hexanol D. (1-hydroxyethyl)-3-methylhexane
doublet 2H triplet 2H triplet 1H P-M NO. B. selectone. Ne Previous pag