A solution containing 0.40249 g of CoCl2. xH2O was exhaustively electrolyzed to deposit 0.09937 g of metallic cobalt on a platinum cathode. What is the number of moles of water per mole of cobalt in the reagent?  FW  CoCl2 = 129.84 g/mol  H2O = 18.02 g/mol AW  Co = 58.93 g/mol

Q: A total of 1.740 F of electricity (1 F=1 mol e−) was required to electrodeposit all of the Zn and Co…

A: The mass of each compound is calculated by the number of moles of the compound. The number of moles…

Q: What quantity of electric current is required to deposit 0.750 g of Pt(s) from a solution containing…

A: The number of moles of a substance is defined as the mass of the substance upon molar mass.The…

Q: How many grams of Cr would plate out from a solution of Cr(NO3)3 when 9.65 × 105 coulombs of charge…

A: Since Cr is initially in Cr3+ state in  Cr(NO3)3  Hence the reaction for Cr3+  is  Cr3+  + 3 e-…

Q: Complete and balance the following half-reaction in acidic solution H2SO;(aq) → SO,² (aq)

A:

Q: Cuag) + NO2(9) in acidic solution Сu(s) + NO3 (aq) (aq)

A:

Q: Permanganate, MnO4–, can act as an oxidizing agent in both acidic and basic aqueous solutions.…

A: The given reaction is :               MnO4- + Al → MnO2 + AlOH4- Here, Mn is getting reduced from +7…

Q: what is the standard reduction potential of the formation of O2 from OH-

A: The standard reduction potential of to the formation of O2 from OH- can be calculate by coupling O2…

Q: Balance the equation in basic conditions. Phases are optional. equation: N2H4 + Cu(OH)2 N2 + Cu

A:

Q: Balance the following oxidation - reduction reaction. Identify the oxidizing and the reducing agent.…

A: Oxidation/reducing agent means adding of oxygen and reduction /oxidising agent means removal of…

Q: What quantity of electric current is required to deposit 0.750 g of Pt(s) from a solution containing…

A: Here, The amount of Pt(s) deposited from [PtCl4]2- ion solution = 0.750g. Time required for…

Q: Use standard reduction potentials to calculate the standard free energy change in kJ for the…

A: The objective of the question is to calculate the standard free energy change for the given reaction…

Q: Question 39. The correct answer is in pink.

A: Given half-cell reactions:

Q: Calculate the gibbs free energy (ΔGo)  in kilojoules (KJ) for ColCo2+ II Cd2+I Cd   The faraday…

A: In an electrochemical cell, the electrode with higher electrode potential acts as cathode. The…

Q: Balance the equation in basic conditions. Phases are optional. equation: SO3 + Co(OH)₂ Co+SO

A: Recall the given equation,                           SO32-  +  CoOH2  →  Co  +  SO42-We have to…

Q: Using the following equation: Pb(S04)2 + 4 LINO3 → Pb(NO3)4 + 2 LizSO4 How many grams of lithium…

A:

Q: [1] Balance the following redox reaction in acidic solution. CrO (aq) + HSNO2¯(aq) → CrO2 (aq) +…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Give the balanced Oxidation and Reduction half reactions for CO2(g)+H2O(l)C6H12O6+O2(g)

A: During photosynthesis in presence of sunlight (hv) carbon-di-oxide and water reacts to form…

Q: When the Hg2+ concentration is 1.18 M, the observed cell potential at 298K for an electrochemical…

A: We have to find the concentration of Mn²+ and ∆G° and hence tell about value of K

Q: In many residential water systems, the aqueous Fe³⁺ con-centration is high enough to stain sinks and…

A: To balance a redox reaction, follow the below steps, Identify the oxidation number of every atom.…

Q: Identify the oxidizing and reducing agents in the skeletal (unbalanced) reaction. Then, balance the…

A:

Q: can cadmium metal (Cd(s)) reduce cobalt (II) ions (Co2+(aq)) to cobalt metal

A: cadmium can only reduce cobalt if its reduction potential is smaller than that of cobalt.

Q: PART 3: Complete and balance the reaction below in basic solution: H2O2(aq) + Cl02(aq) cloz(aq) +…

A:

Q: Calculate the grams of nickel (58.69 g/mol) can be electroplated from a solution of Ni(NO3)2(aq)…

A:

Q: In acidic solution, sodium oxalate, Na,C,0,, is oxidized to CO, by MnO, . In the process, MnO, is…

A:

Q: 1. Ga(s) Ga³+ (aq)||Ag+ (aq)|Ag(s)

A: The cell representation of an electrochemical cell is given as follows:Ga (s) | Ga3+ (aq) || Ag+…

Q: Calculate the number of kilowatt-hours of electricity required to produce 1.0 x 103 kg of aluminum…

A:

Q: Use the following standard reduction potentials to determine which species is the strongest reducing…

A: ->The species which has highest reduction potential that will get reduce itself and oxidize…

Q: 7. Balance the equation for the following reaction in basic solution: Hg₂(CN)₂ + Ce+4-----> CO3² +…

A: We would use half reaction method to balance the given redox reaction .

Q: How many coulombs are released when H2O is oxidized to liberate 1.00 mol O2 in the reaction 2H2O S…

A: The given reaction is: 2H2O → O2 + 4H+ + 4e-

Q: The reduction potential of ferricyanide to ferrocyanide ion occurs at +0.36 V when both ions are 1M…

A: Reduction potential : It is the tendency of an element to  gain electrons and converted into lower…

Q: How many metric tons of charcoal is required to reduce 1500 kg of arsenic trioxide? AS2O3 + C = CO +…

A: Since you have posted multiple questions, we are entitled to answer the first only. 1) The reaction…

Q: Balance the following chemical reaction.   C3H8O             +          O2            -->…

A: To balance the chemical equation, we will balance each type of atoms on both sides of the equation…

Q: What is the chemistry behind why the presence of salt will increase rusting of metals?

A: The solution is given below -

Q: 1. Balance the ff skeleton reactions and identify the oxidizing and reducing agents: a) O2(g) +…

A:

Q: Write equations for the oxidation and reduction half-reactions and the net reaction describing the…

A: Oxidation is loss of electrons while reduction is gain of electrons.

Q: Balance the following in basic solution. Lowest possible coefficients. Omit phases. Show oxidation…

A: Oxidation half :   Zr(OH)2 + 2OH- -----> ZrO2 +2H2O + 2e-  Reduction half :  O2 + 2H2O +  4e-…

Q: Consider the following redox reaction: Cl207 (aq) + H202 (aq) CIO2 (aq) + 02 (g) ->

A: Step : 1             Balance the redox reaction.

Q: Use the following standard reduction potentials to determine which species is the strongest…

A: Oxidizing agent oxidizes other substance and reduced itself. Strongest oxidizing agent has the half…