A slightly soluble salt has the formula A2B3 and a Ksp of 8.0E-32. What is pB in a solution of this salt?

Q: What is the mole ratio of ammonia (with a pKb of 4.75) to ammonium chloride in a buffer with a pH of…

A:

Q: Carbonate (H2CO3/HCO3-) buffers are important in regulating the pH of blood at 7.40.  Note that the…

A: For the given acidic buffer, pH is given as: pH=pKa+log[HCO3-][H2CO3]----(1)

Q: Calculate the pH of the solution after the addition of each of the given amounts of 0.0530 M HNO3 to…

A: " Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: A buffer system is set up with [HA] = 2[A–]. If pKa = 5.5, what is the pH of the buffer?

A:

Q: What is the pK of the weak acid HA if a solution containing 0.1 M HA and 0.2 M A− has a pH of 6.5?

A:

Q: What is the pH of a buffer that is 0.12 M in lactic acid [CH3CH(OH)COOH, or HC3H5O3] and 0.10 M in…

A: Buffer solution consists of mixture of weak acid and its conjugate base.

Q: Which of the following acid/ conjugate base pairs would function best as a buffer at physiological…

A: 1- First we should know about physiological pH it's value is 7.40 it's maintain the blood pH because…

Q: Explain how the H2CO3/HCO3 buffer system helps maintain blood serum at constant pH with the help of…

A: The objective of the question is to understand how the bicarbonate buffer system (H2CO3/HCO3-) works…

Q: You wish to prepare an HC2H3O2 buffer with a pH of 5.14. If the pKa of is 4.74, what ratio of…

A: Given:pH = 5.14pKa = 4.74We need to find the ratio of C2H3O2⁻/HC2H3O2

Q: What is the solubility product expression for Al(OH)3? O Ksp = [A1³+][3OH-] O Ksp = [A1³+][OH-]³ O…

A: Ksp = [Al3+][OH-]3 ----> option(B)

Q: A student needs to prepare a buffer made from HCO3 and with pH 6.690. If Ka for H2CO3 is 4.20 x…

A: Ka of H2CO3 = 4.2010-7pH = 6.690

Q: Attached! Thanks ?

A: The precipitation reaction of barium phosphate is as follows:

Q: What is the water solubility of PbI2 (Ksp = 8.4 × 10−9) in 0.15 M KI?

A: The balanced equation for the above reaction is : PbI2 <==> Pb2+ + 2I- where the Ksp =…

Q: What is the pH of a river water sample in which [HCO3-] = 1.0 x 10-4 M and the concentration of…

A: The given river water sample in which [HCO3-] = 1.0 * 10-4 (M) and the concentration of dissolved…

Q: Arsenic acid, H3AsO4, has 3 pKa values (pKa1 = 2.31, pKa2 = 7.05, pKa3 = 11.9). What is the K-value…

A:

Q: A chemistry graduate student is given 100. mL of a 1.70M diethylamine ((C2H5)2NH): NH solution.…

A:

Precipitation Titration

Precipitation analysis is used to analyze drugs, and to measure the salt content in food and beverages. It is an important concept from the examination point of view many practical questions are asked on the topic. This topic is significant in the professional exams for both undergraduate and graduate courses, especially for