7. a) Identify all the chiral/stereogenic centres in the following molecules. Circle the chiralcarbon(s).OHCI-BrCIОНO,NCIBrCICIABOHHO,.CIBrHOOHb) For each chiral center, prioritize the groups (1-4) attached to each chiral center(s)Based on your priorities, assign R or S configurations to the chiral center(s).i)Ноii)H2N HОНноOHiv)OHOHv)H,N-ČH,OHDraw the most stable chair conformation for each of the following cyclohexanes.Now, "flip" the ring and redraw the molecule in the higher energy form.i) chlorocyclohexaneii) cis-1-chloro-2-methylcyclohexaneiii) trans-1-methyl-3-propylcyclohexane

Following are the chiral centres and appropriate R/S notation.

7. a) Identify all the chiral/stereogenic centres in the following molecules. Circle the chiral carbon(s). OH CI -Br CI ОН ČI Br A B OH HO .CI Br HO OH D b) For each chiral center, prioritize the groups (1-4) attached to each chiral center(s) Based on your priorities, assign R or S configurations to the chiral center(s). i) HO H,N° ii) H.. HO, Но OH H. iv) ÕH OH v) H,N-H

7. a) Identify all the chiral/stereogenic centres in the following molecules. Circle the chiral carbon(s). OH CI -Br CI ОН ČI Br A B OH HO .CI Br HO OH D b) For each chiral center, prioritize the groups (1-4) attached to each chiral center(s) Based on your priorities, assign R or S configurations to the chiral center(s). i) HO H,N° ii) H.. HO, Но OH H. iv) ÕH OH v) H,N-H

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Br HN Assign the absolute configuration of the chiral centers indicated. 1 = S 02 =S 3 = R 1=R 0 2 = S 3 =R 1= R 2 =R 3= achiral 1= R 02 = S 3- achiral %3D 1=S 2 S 3- achiral 1=R 2 R 3-R 2.
NH2 Br OH HS CI N. N. Draw the stereoisomer where all the chiral centers have the R configuration. ZI IZ
7
For the following molecules, draw all possible stereoisomers using line-angle formulas with wedge/dash notation. Label the stereocenters as R or S. Indicate which ones are enantiomers and which ones are diastereomers. (Remember: there are 2 stereoisomers possible for a molecule with n chiral centers) (A) (B) (C) (1 chiral center) Br OH (2 chiral centers) CI OH CH3 (3 chiral centers)
Identify the configuration of each chiral center in the following compound: 10 HO 11 8 9 16 14 13...mEt 3 15 Cl In the boxes below, first input the number(s) corresponding to the chiral center(s) in numerical order as (e.g., "1,3,4"). Then input the configuration(s) of the chiral center(s) in the same order and format (e.g., chiral center location(s): Configuration(s): "
a. C1- C3- For each chiral carbon labeled in the structures below (see the numbers), assign R or S absolute configuration in the boxes provided - you only need to enter R or S. Then, state (in the box provided) whether the molecules are enantiomers, identical, diastereomers, or not related. 0 OH OH 2 OH X 3 and 1-44 C2- C4- OH and OH 2 Related- hp
8
Please do A and B
2. Identify the following molecules as chiral or achiral. e) f) Br OH ч к ОН h) ОН
Please help thank you
1) Identify each of the following molecules as chiral or achiral. Assign R/S configuration for any chiral centers in them. HO. НО. OH NH₂ HO. HO HO Br OH OH НО OH OH .NH₂ OH OH
a,b,c,d