6. Which of the fatty acids below has the highest melting point? Но stearic acid Но но arachidonic acid palmitic acid Он Он oleic acid linoleic acid a. stearic acid b. palmitic acid c. oleic acid d. arachidonic acid e. linoleic acid

6. Which of the fatty acids below has the highest melting point? Но stearic acid Но но arachidonic acid palmitic acid Он Он oleic acid linoleic acid a. stearic acid b. palmitic acid c. oleic acid d. arachidonic acid e. linoleic acid

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: compounds will be the strongest acid?

A: In this question we have to choose option of the notation corresponds to the fatty acid with the…

Q: Identify the fatty acids present in the following structure (e.g., stearic, oleic, palmitoleic). Do…

A: Stearic fatty acid Arachidonic fatty acid Oleic fatty acid

Q: You are given 150 mL of an oil made up of a mixture of 3 fatty acids: palmitoleic acid (C 16:1…

A: Concept based on density and volume relation.

Q: Palmitic Acid 1. write the skeletal structure of the fatty acid 2. give the short notation. for…

A: Palmitic acid has 16 carbon atoms.

Q: The number of unsaturated bonds in this fatty acid is | ball & stick + labels

A: The given model is ball and stick models. These are three-dimensional models where atoms are…

Q: Which fatty acid has the lowest melting temperature? O 20:2 49.12 O 20:0 O 18:0 O 20:1 412 18:249.12

Q: TRUE regarding Fatty acids, EXCEPT: a.It has a carboxylic head which is hydrophilic b. It contains…

A: Fatty acids are consist of 2 parts- 1- hydrophilic head 2- hydrophobic tail.

Q: Why metals are deleterious to the stability of unsaturated fatty acids? I. They initiate free…

A: Unsaturated fatty acids can be defined as the fatty acids that contain one or more double or triple…

Q: 2. Write the equation showing triacylglycerol formation from 1 mol of glycerol and 1 mol each of…

A: The structures for the given molecules are shown below.

Q: Which is true about fatty acids? They are a category of carboxylic acids and represent a specific…

A: Fatty acids are building blocks of the fats in our bodies. They are important component of lipids in…

Q: 14 Classify each 61 monounsaturated, or polyunsaturated. a. CH3-(CH2)7-CH=CH-(CH),-COOH b.…

Q: These types of fatty acids lower blood chloesterol O Saturated O Monounsaturated Trans O…

A: Blood cholesterol levels are increased by the trans and saturated fatty acids.

Q: Suggest a reason why the cell membrane of bacteria grown at 20oC tend to have a higher proportion of…

A: Unsaturated fatty acids are a part of the phospholipid bilayer which can be found in all…

Q: B) Linolenic acid has cis double bonds with the formula CH3CH2CH=CHCH2CH=CHCH2CH-CH(CH2)7COOH. Write…

A: This problem is based on naming of fatty acids.

Q: How many different triacylglycerols are there in which one of the fatty acid components is lauric…

A: Since the general structure of triacylglycerols is as shown below.

Q: Draw the following fatty acids based on information provided: Lauric acid [12] Eicosenoic acid…

A: Lauric acid is a member of a saturated fatty acid family with 12 carbon in it. The structure of…

Q: 1. What is so important about the fatty acids in oil paint and what does that contribute to the…

A: Answer: 1) a) Important about the fatty acids in oil paint- b) Fatty acids in drying process. 2)…

Q: Draw the unsaturated fatty acid with the following carbon designations. [18:3], w-4 [16:1], w-7

A: Concept:-

Q: 11. A cyclical compound synthesized in the body from the 20-carbon unsaturated fatty acid…

A: Arachidonic acid is a unsaturated fatty acid, which contains 20-carbon and five cis-double bonds. It…

Q: 4. Which of the following best describe the physical properties of fatty acids? a. All physical…

A: Fatty acids are the building blocks of the fat in our bodies. Fatty acid molecules are usually…

Q: Which of the statements are true? Unsaturated fats have higher melting points than saturated fats.…

A: Ans a) False, because due to unsaturation molecular mass decrease and vander wall attraction…

Q: H,c-0-C-(CH2)10CH3 HC-0-C-(CH2)10CH3 H2ċ-o-c-(CH2)10CH3 1. Is it a mixed or a simple triglyceride?…

A: Triglyceride is a kind of lipid which is formed when a glycerol molecule combines with three fatty…

Q: Draw an 18-carbon saturated fatty acid. Is this a “straightchain” molecule or a “bent” molecule?

A: Fatty acids are composed of a long hydrocarbon chain attached to a carboxyl group at one end.

Q: 6. Why do carbohydrates burn less calories per gram than fatty acids?

A: 6. Given information, Carbohydrates burn less calories per gram than fatty acids

Q: Give the omega family of the folowing fatty acid OH

A: Introduction: Fatty acid: Fatty acids are the large hydrocarbon molecule with carboxylic acid at the…

Q: Which of the statements are true? Fats that contain more unsaturated fatty acid residues than…

A: We have to find which statements are correct, so We can expain them as following- 1. Fats that…

Q: 50. What is made of multiple triacylglycerols and is a solid at room temperature? A) cephalin B)…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: 1. Explain why egg whites and milk are used as antidotes for heavy metal poisoning.

Q: Per gram of oil, which of the following will have a higher saponification number? A mixture of…

A: Soapanification number = 3× M.W. of KOH×1000 / M.W. of fat M.W. of fat proportional to M.W. of acid…

Q: 12. Why does the introduction of a cis double bond, but not a trans double bond, lower the melting…

A: Melting point for a compound is directly proportional to the molar mass of the compound which is…

Q: True or False a. Stearic acid is an unsaturated fatty acid. b. Human fat has more unsaturated fatty…

A: Given, a. Stearic acid is an unsaturated fatty acid.b. Human fat has more unsaturated fatty acids…

Q: 2. Draw or classify the following fatty acids a) 10 carbon omega-3 fatty acid b) c) 8 carbon omega-2…

Q: он II OH II OH IV V

Q: 1. Draw the structure of a triacylglycerol made from glycerol and one molecule of palmitic acid, one…

A: we have to draw the structure of triacylglycerol which has glycerol palmitic acid oleic acid…

Q: How Z double bonds introduce kinks in the long hydrocarbon chain, decreasing the ability of the…

A: Fats Fats or triglycerides are esters of glycerol in which one molecule of glycerol is esterified…

Question

6. Which of the fatty acids below has the highest melting point?
Но
stearic acid
Но
но
arachidonic acid
palmitic acid
Он
Он
oleic acid
linoleic acid
a. stearic acid
b. palmitic acid
c. oleic acid
d. arachidonic acid
e. linoleic acid

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

Why does the introduction of a cis double bond, but not a trans double bond, lower the melting point of a fatty acid?
Consider the equilibrium for the transesterification reaction. H₂SO4 triacylglycerol + 1-propanol fatty acid propyl ester + glycerol How do you think the amount of catalyst affects the amount of product present when the reaction reaches equilibrium? (I.e. What happens to the amount of product if you add more catalyst (acid)?) Briefly explain your answer.
which molecule is not a natirally occuring fatty acid?
Select the essential fatty acids. EPA (eicosapentaenoic acid) linolenic acid palmitic acid palmitoleic acid linoleic acid
Is ethanol closest to a fat, sugar or protein? Why?
On a per molecule basis, which of these compounds is better at reducing disulfide bonds? a. Linoleic acid b. Stearic acid c. Alpha-linolenic acid d. Palmitic acid e. Oleic aicd
13. Draw structures to show how a triacylglycerol is formed using the following fatty acids: 16:1 A⁹, 18:3 A9,12,15, 20:4 A5,8,11,14. What functional group is found in triacylglycerols? Circle it in the triacylglycerol you drew. Is this triacylglycerol likely a fat or an oil? How do you know?
For the following fatty acids, indicate the FALSE alternative: a) Stearidonic acid is the most unsaturated. b) Nervonic and erucic acids are ω9. c) Gamma linolenic acid is polyunsaturated and erucic acid is monounsaturated. d) Stearidonic and gamma linolenic acids are ω3. e) All possible triglycerides of these fatty acids will be oils.
Dd.21.
Which of the following oils should be used to form an 18C fatty acid sodium salt? A. palmitineB. oleinC. stearinD. laurine
Match the derived unsaturated fatty acids with their precursors. Oleate 20:3 cis-A³, A. All 18:1 cis-All Palmitoleate 18:3 cis-A, A. A Answer Bank 22:6 cis-A, A7, A¹0. Linoleate 6,419 20:2 cis-A¹, A¹ Linolenate 22:1 cis-A¹
27. For the membrane lipid below, answer the following questions. но но H-C-N-C HHH H-N-C-C-0-P-O-C-H HHH H. Is it a phospholipid or glycolipid? a. b. Is the backbone derived from sphingosine or glycerol? Circle the backbone с. Is the fatty acid from which the lipid derived saturated or unsaturated? d. Is it a sphingomyelin glycerophospolipid or cerebroside? e. Label the Head and the tail and state which is polar and which is non-polar.