4. Explain the following. a. Which is the stronger acid and why, 2-fluoroacetic acid or 2,2-difluoroacetic acid. b. Give the structure of the hydroxyl compound from which you would expect to obtain the lactone

4. Explain the following. a. Which is the stronger acid and why, 2-fluoroacetic acid or 2,2-difluoroacetic acid. b. Give the structure of the hydroxyl compound from which you would expect to obtain the lactone

Chemistry for Today: General, Organic, and Biochemistry

9th Edition

ISBN:9781305960060

Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Publisher:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Chapter15: Carboxylic Acids And Esters

Section: Chapter Questions

Problem 15.69E

See similar textbooks

Related questions

Q: Explain why Ei3 for Ca is considerably greater than either Ei1 or Ei2.

A: Ionization energy (EI): When an electron is removed from the outermost shell of an isolated gaseous…

Q: If pk1= 2.34 and pk2= 9.60, then the isoelectric point pl is? A. 5.87 B. 5.97 C. 3.67 D. 4.56

A: The isoelectric point (PI) of amino acid with one carboxylic acid and one amine group can be…

Q: 1. ^ MgBr, ether H H. 2. HО, Ht

A: HCHO when reacts Grignard Reagent in presence of ether followed by hydrolysis gives primary alcohol.

Q: 17. Which of the following structures is different from the other three ?

A: We can find a different structure out of four by determining their IUPAC names. structure with…

Q: See the Attached compound A. Ques: Label the weakest C–C bond.

Q: Which compound below would you most appropriately call hydrophobic? a. CH4 b. H2CO c. HCl d. NaCl

A: Hydrophobic is the property to repel water. It will be non-polar molecules. Water is a polar…

Q: Which of the following represents the chair structure when drawn in hexagonal line notation? HO a A…

A: Stereochemistry is branch of chemistry in which we deal with three-dimensional arrangement of atoms…

Q: H-N N-4 H N. The enzyme chymotrypsin would cleave this molecule. Show where by drawing a line…

A: In this question, we will draw a line through the peptide bond ( bonds ) break by the chymotrypsin…

Q: 1. BZOOBZ, NBS, CCI4 2. Mg, THF; then Pd°Ln, PhBr 3. HNO3, H2SO4 4. Zn, HCI

Q: B.

Q: 1. Is the pointed structure intra or intermolecular bond 2. What is it? 3. What other IFA is…

A: intramolecular bond because it is with in the same molecule when the bond is between two different…

Concept explainers

Reactions of Ethers

Ethers (R-O-R’) are compounds formed by replacing hydrogen atoms of an alcohol (R-OH compound) or a phenol (C6H5OH) by an aryl/ acyl group (functional group after removing single hydrogen from an aromatic ring). In this section, reaction, preparation and behavior of ethers are discussed in the context of organic chemistry.

Epoxides

Epoxides are a special class of cyclic ethers which are an important functional group in organic chemistry and generate reactive centers due to their unusual high reactivity. Due to their high reactivity, epoxides are considered to be toxic and mutagenic.

Williamson Ether Synthesis

An organic reaction in which an organohalide and a deprotonated alcohol forms ether is known as Williamson ether synthesis. Alexander Williamson developed the Williamson ether synthesis in 1850. The formation of ether in this synthesis is an SN2 reaction.

Question

4. Explain the following.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

3. Draw the structures of phenyl chloride and benzyl chloride (the purpose of this is so that you can see how the “benz" prefix refers to something other than the simple benzene ring, and hence why benzoate has the structure it does). 4. Methyl benzoate can be formed from the esterification of benzoic acid and methanol, using sulfuric acid as a catalyst. Give an equation for this reaction.
I. Complete the table. Classification of Carboxylic Acids and its derivatives No. Common Name Structure IUPAC Name 1. CH3CH2CH2COONA COOH(CH2)SCOOH 3. CH3CH2CH2CH2CH2COOH 4. C6HSCOOCOC6H5 5. CICOCH2CH2CH2CH2OH 6. CH3(CH2)7CONH2 7. CH3(CH2)3CH2COOCH2(CH2).CH3 CH3CH2OCOCH2CH2CH2CH2CH2CH2 8. CH3 9. CH3CH2CH2CH2CH2CH2CH2CH2COCI 10. H2NCOCH2CH2CH2CH3 2.
1. Esters can be formed by the condensation of a carboxylic acid with the hydroxyl group of an alcohol or phenol. a) Use structures to show the condensation of acetic acid (IUPAC: ethanoic acid) with the hydroxyl of cyclohexanol. b) Explain why 'condensation' is an appropriate name for this reaction. c) You'll synthesize the ester in aspirin by condensing the phenol group of salicylic acid not with acetic acid, but with acetic anhydride. Explain why the experiment calls for the use of an anhydride, rather than an acid.
Q1 This question has two parts Part A and Part B. Part 1: Acetone can react with a base to give the enolate ion A, which can further react with another acetone molecule to give B. Upon quenching with water, B generates C, the final product of this reaction. :Base H20 A H3C H. H3C H. Acetone a) Draw the structure of A, B, and C b) Using curly arrows, draw the mechanism of the reaction between A and acetone to give compound B. What's the name of this reaction. - c) Draw the two resonance forms (A and D) of the enolate (A) generated by the deprotonation of the a-carbon on acetone and show the interconversion between the two using curly arrows: I Base H3C H A D H Acetone d) Knowing that the pka of the a-proton on acetone is 19, choose amongst the following bases those who will be able to remove the proton, given the pKa of their corresponding conjugated acids. H3C-C-H H H :Base H-Base + conjugate acid pka = 19 pКa 3 а, b, с, d a) Ammonia; pKa = 9.2 b) Sodium amide; pka = 38 c) Sodium…
1. Write a balanced chemical equation to show the dissociation of Butanoic acid (C3H7COOH). Physical states must be included. 2. When butanoic acid (C3H7COOH) reacts with the strong base potassium hydroxide (KOH), potassium butanoate (C3H7COOK), a salt of the weak acid is formed. Write a balanced chemical equation to show the dissociation of the potassium butanoate (C3H7COOK). Physical states must be included.
4. Draw the structure of a carbene, and explain using your drawing why it can function as either a nucleophile or an electrophile.
Predict the products of the reaction of phenylaceetaldehyde , C6H5CH2CHO, with a. NaBH4 the H3O+ b. Aqueous acidic CrO3 c. NH2OH d.CH3MgBr then H3O+ e, CH3OH,H+ catalyst
6. Which of the following molecules can be oxidized to a carboxylic acid? НО HO- ОН ОН b. ОН d. a. c. e.
Can you please give an explanation for question 5 (A, B, and C)? 5 continues on the 2nd page. Thank you
Draw the structure(s) of the major organic product(s) of the following reaction. an 1. in benzene 2. aqueous HCI
78) Why are primary alcohols more acidic than tertiary alcohols, in general? Because tertiary alcohols have less acidic hydrogens. Because primary alcohols have less electron-donating groups which create more effective charge separation between oxygen and hydrogen atom, making it more acidic. Because primary alcohols are more polar than tertiary alcohols. Because primary alcohols have less electron-donating groups which decrease electron density on oxygen, making it more susceptible for H+ to depart from the structure.
Hydrolysis of the ester CH3-CH2-COO-CH2-CH2-CH3 in dilute acid, gives a. acetic acid and ethanol b. propanoic acid and ethanol c. propanoic acid and 1- propanol d. acetic acid and 1-propanol