4. Evaluate the strain hardening increment to the yield strength of Li [BCC, G (shear modulus) = 32 GPa, a (lattice constant) = 3 Å] alloy with a microstructure due to a dislocation density of 3x1013 m-2. Make appropriate assumptions, if any.
Q: Determine the cell reaction and standard cell potential for a cell made from a cathode consisting of…
A: The objective of this question is to determine the cell reaction and standard cell potential for a…
Q: balance the equation in the photo
A: The objective of this question is to balance the given chemical equation. Balancing a chemical…
Q: 1) Using any reagents necessary (Cn, n<5 incorporated into final product), develop a synthesis for…
A: Step 1: Step 2:Hope you understand Please do rate ..... Thankyou
Q: Balance the reaction between NO and Ni²+ to form NO3 and Ni in acidic solution. When you have…
A: Let's try to balance the reaction in acidic solution. Step 1: DIVIDE THE REACTION INTO HALF…
Q: You are interested in evaluating the thermochemistry of acid-base reactions.You mix 100.0 mL of…
A: ### Part AIn a coffee cup calorimeter, which is designed to maintain constant pressure, the heat…
Q: Which of the following sequences would perform the transformation shown? Copyrighted Graded 1)…
A:
Q: Br 1. N3 2. LiAlH4 3. H₂O NH₂ 26 Preparation of primary amines using azide ion avoids the problem of…
A: Step 1:Step 2:Step 3:Step 4:
Q: Question 16
A: Step 1:Limiting reagent is the reactant that exhaust first in the chemical reaction and decides the…
Q: 5. The element Chromium has a KB X-ray wavelength of 0.209nm. The K-shell binding energy is 5989eV.…
A: Step 1: Step 2: Step 3: Step 4:
Q: What is the binding energy in kJ/mol nucleons for copper-63? kJ/mol nucleons 63 1 1 Cu 29 H + 34 n…
A: Question 1: cu= 29 ( 1h ) +34 ( 1N) = 29(1.00783) +34 (1.00867) =63.52185 g mol-1 Δ m=63.52185 -…
Q: A sample of neon gas at a pressure of 863 mm Hg and a temperature of 52 °C, occupies a volume of…
A: The objective of the question is to find the final volume of a sample of neon gas when it is heated…
Q: Question 19 Predict the expected product for each reaction and provide IUPAC name for the correct…
A: Epoxidation of starting alkene 2-methylbut-1-ene occur to form epoxide intermediate and in step-2…
Q: Draw structures for the alkene (or alkenes) that gives the following reaction product. ? H₂/Pd CH3…
A: Given product: CH3CH(CH3)CH2CH(CH3)CH3This product suggests the addition of two moles of hydrogen…
Q: Order these according to decreasing stability; 1 being the most stable, 4 the least stable. A B C D
A: Step 1:C This item is considered the most stable. In this context, "C" might represent something…
Q: Provide a major product for the reaction below: OH OH Conc H2SO4
A:
Q: T₂ H(T₂) = H(T) + [²C,dT T₁ T₂ A‚H°(T,) = A‚H°(T; ) + √„ª ACT (2C.6) Kirchhoff's law (2C.7a) P T₁ -…
A: Sure, I can help you with this. The text in the image pertains to thermochemistry, which is a branch…
Q: match the corresponding molecule to the spectrum (only one molecule per spectrum )
A: Step 1:Given Two infrared spectra of organic compounds. Match the spectrum with compounds. Step…
Q: Quickly need help figuring out how to complete the following chemical equations.
A: Step 1: Step 2: Step 3: Step 4:
Q: Please don't provide handwritten solution ...
A: The molecule shown above is a a type of lipid called a triglyceride. It is an ester made of a…
Q: Which statement is false about the resonance structure? Water molecule has one Lewis structure…
A: False statement: Resonance structures of the same molecule have different total of electrons. True…
Q: Solve
A: Step 1:Step 2:Step 3:Step 4:Step 5:
Q: Use this information to answer each question: A student constructs an electrochemical cell with a…
A: To calculate the experimental standard state free energy change, ΔGo, we can use the following…
Q: How long will it take for the concentration of A to decrease from 0.500 M to 0.200 M in the…
A: Step 1:Step 2:
Q: 3. The chemical equation for the decomposition of potassium chlorate is 2 KClO3(s) → 2 KCI(s) +…
A: To solve this problem, we first need to find the molar mass of potassium chlorate (KClO3) and then…
Q: Show work, thank you!
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: A student reads a barometer in the laboratory and finds the prevailing atmospheric pressure to be…
A:
Q: Determine a reasonable synthetic scheme for a multi step synthesis using substitution, elimination,…
A: Approach to solving the question:In this scheme, an alkene is first given a halogen addition, then a…
Q: 5 Write the nuclear reaction for the beta decay of Th-234. Who is the daughter nuclide? 234 91 Pa…
A: The beta decay of Th-234 involves the emission of a beta particle (β⁻). Here's the complete nuclear…
Q: Draw the structure(s) of the major organic product(s) of the following reaction. CI N₂ KI Draw one…
A: When compound reacts with potassium iodide (KI), a substitution reaction may occur, leading to the…
Q: Solve.
A:
Q: QUESTION 2 Which one of the following is not a redox reaction? A) Al(OH)4(aq) + 4H+(aq) → A13+ (aq)…
A: Step 1: Step 2: Step 3: Step 4:
Q: What volume of carbon dioxide (in L) will 2.14 g of antacid made of calcium carbonate produce at…
A: Given mass of calcium carbonate = 2.14 g Molar mass of calcium carbonate= 100. g/molNo. of moles of…
Q: A sawn-lumber column of 5.0 × 7.5-in. cross section has an effective length of 8.5 ft. The grade of…
A: Step 1: Rewrite required properties dLe=58.5×12=20.4Area is given by ;Area=b×d=5×7.5=37.5 in2 The…
Q: None
A: Alkene 2:The structural formula of Alkene 2 shows a double bond between the carbon atoms.The…
Q: ore: 74.9% A Check A ☐ Resources Cx Give Up? Q Hint 13 of 6 > Draw both organic products of the…
A:
Q: Hydrogen gas can be prepared by the reaction of zinc with hydrochloric acidas shown below:2 HCl (aq)…
A: Given mass of Zn = 2.750 gMolar mass of Zn= 65.4 g/molNumber of moles of Zn reacted= given…
Q: f 15.0 g S8 (molar mass = 256.56 g/mol) is made to react with 2.0 L O2 at 30 oC and 1.0 atm, what is…
A: Reaction involved is :-S8(s) + 12O2(g) -> 8SO3 (g) Given mass of S8 = 15.0 gMolar mass of S8 =…
Q: Show a detailed arrow pushing mechanism for the reaction of the Aryl Diazonium Salt with an electron…
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: Dinitrogen tetraoxide, a colorless gas, exists in equilibrium with nitrogen dioxide, a reddish brown…
A: Step 1: (1) First reaction:N2 (g) + 2O2 (g) ⇌ N2O4 (g) K1 = [Product]/[Reactant]K1 =…
Q: solve step by step
A: .Step 1: From the given data we can calculate the melting point of ice at this condition using…
Q: Draw structural formulas for organic products A and B in the window below. -Br Li pentane Cul A B…
A: Step 1:Bromobenzene reacts with Li to form phenyllithium (organolithium reagent). Step…
Q: Come up with a detailed mechanism for the following cyclization that also includes all resonance…
A: Step 1: The reason why the alkyl bromide portion of a molecule can remain intact in certain…
Q: Problems: 1. Predict the product of the following reaction and show the mechanism. O 0 1) KOiPr,…
A: Step 1:α− Alkylation of carbonyl (aldehyde or ketone) and ester:The α−H of the carbonyl/ester group…
Q: Balance the following equation CaCl2 + KOH = Ca(OH)2 + KCI
A: The objective of this question is to balance the given chemical equation. Balancing a chemical…
Q: No answer from Chat GPT please will downvote The hand written solution is not allowed.
A: The second law of thermodynamics, which states that the entropy of the universe tends to increase…
Q: what is the pka of 50.00mL of 0.12M NH3 and 3.50mL of 1.0M HCl
A: Step 1:To find the pKapKa of the resulting solution after mixing NH3 and HCl, we need to consider…
Q: *Reaction is in image* Questions based on reaction in image: The oxidizing agent is: The reducing…
A:
Q: None
A: Here's a breakdown of why each option is correct or incorrect:Option (a):- The hydroxyl group on the…
Q: Use Le Chatelier’s Principle to predict the color change, if any, when you add more NH3solution to…
A: The objective of the question is to predict the color change, if any, when more NH3 solution is…
Q: Bilayer leaflet CO COON 1. Unfolded peptide aqueous phase 2. Unfolded peptide in membrane 3. α-helix…
A: ### 1. **Name of the Secondary Structure**: Random CoilThe term "random coil" refers to a…
4. Evaluate the strain hardening increment to the yield strength of Li [BCC, G (shear modulus) = 32 GPa, a (lattice constant) = 3 Å] alloy with a microstructure due to a dislocation density of 3x1013 m-2. Make appropriate assumptions, if any.
Step by step
Solved in 2 steps with 1 images
- 2. A three-point loading scheme for measuring the stress-strain behavior and flexural strength, σF, (stress at fracture) of brittle ceramics for rectangular and circular cross sections materials are shown below. 3FfL = πR³ 2bd2 (depending on the FfL The flexural strength σF, can be calculated as: σFƒ cross section shape). = Calculate the ceramic flexural strength when Fƒ=1030 N, L=3.5 cm and 2R=b=d=1 cm and define which structure is stronger. Show your work. Note when you calculate, don't forget to unit conversion! Ff R Compression Tensiona) Calculate the basicity and acidity of a slag composed of 41 wt% SiO2; 13 wt% FeO; 39 wt% CaO, 7 wt% MgO. (Molecular Weights; Ca: 40.08, O: 16.0, Fe: 55.85, Si: 28.08, Mg: 24.31) b) Describe the formation stage of white matte during the pyrometallurgical production of copper. Calculate the theoretical amount of Cu in the white matte. (Molecular Weights; O: 16, Fe: 55.85, Si: 28.08, Cu: 63.5, S: 32.06).Calculate the acidity and basicity degrees for the slag composed of 56 % SiO2; 18 % FeO; 5 % Cao, 21 % Mgo (Molecular Weights; Ca: 40.08, O: 16, Fe: 55.85, Si: 28.08, Mg: 24.3). Examine this result in accordance with viscosity and melting point of that kind of slags. Calculate the amount of Cao that must be added to the slag to increase the basicity value to 1.5 for this slag.
- At room temperature (i.e., 300 K), a semiconductor made of gallium arsenide (GaAs) has an intrinsic electron concentration (ni) of 1.8×10^6 cm^-3 , an electron mobility (μe) of 8500 cm^2 V^1 s^-1 , and a hole mobility (μh) of 400 cm^2 V^-1 s^-1 . \ (a) Calculate the intrinsic electric conductivity and resistivity of GaAs at 300 K. (b) When GaAs is doped with an ionized donor concentration of 10^15 cm^-3 , where is the Fermi level? Calculate the electric conductivity of the doped GaAs. (c) If the semiconductor sample discussed in (b) is further doped with an ionized acceptor concentration of 9×10^14 cm^-3 , what is the free hole concentration and electric conductivity of the sample?Metallurgical and materials engineers are often called upon to design alloys with high strength, but with some ductility and toughness; typically, ductility is sacrificed when an alloy is reinforced. Various hardening techniques are available to an engineer, and often the selection of the alloy depends on the material's ability to be adapted to the mechanical characteristics required for a specific application. There are several methods to increase the hardening of metals, each suited to different applications and strength requirements. Some of these methods include heat treatment, such as annealing and quenching, which alter the crystalline structure of the metal to make it harder. Additionally, cold working, such as cold rolling and forging, can increase the metal's strength by reducing its grain size and increasing its dislocation density. The introduction of alloying elements or the controlled precipitation of particles can also strengthen a metal. Each technique is chosen based on…Using Cu-Ka radiation (I = 154 pm), The Bragg angle is 22.2 for the (110) type planes for a BCC crystal of lattice parameter 288 pm and n = 1. Are these reflections allowed?
- The thickness of the chromium plate on an auto fender is determined by dissolving a 30.0-cm2 section in acid and oxidizing Cr3+ to Cr2O7 2-with peroxydisulfate. After removing excess peroxydisulfate by boiling, 500.0 mg of Fe(NH4 )2 (SO4 )2•6H2O is added, reducing the Cr2O7 2- to Cr3+ . The excess Fe2+ is back titrated, requiring 18.29 mL of 0.00389 M K2Cr2O7 to reach the end point. Determine the average thickness of the chromium plate given that the density of Cr is 7.20 g/cm3 . Note: thickness = volume /area2. (d) Describe three of the functions of the matrix in fibrereinforced composites. (e) With the aid of sketches compare and contrast the fatigue fracture appearance between an alloy that failed at a low fatigue load and one that failed at a high fatigue load. (f) Propose and briefly describe one non-destructive method that can be used to detect small cracks on the surface of a metallic alloy .3. Find lattice constant and atomic radius of Silver from the X-Ray spectra for Silver nanoparticles given below and compare with appendix (wavelength of incident X-Ray is 0.154 nm ) 40 (111) 35 30 25 20 (200) 15 (311) (220) 10 |(222) 5 10 30 2 Theta 50 70 90 Fig. 3. X-ray diffraction patterns of silver nanoparticles embedded ultra-thin film solar cell.
- Give only typing answer with explanation and conclusionX-ray diffractionanalysis(using a Cu anode)of a specimen with a known cubiccrystal structure reveals that the peak generated as a result of reflection from the (110) plane occurs at a 2θ=32°. Determine the unit cell volume of this materiaSuggest and explain in detail one heat treatment procedure that can strengthen or harden (the medium- carbon steel). Sketch the microstructure of the steel after being hardened. Compare the mechanical behaviour of the hardened steel to the plain carbon steel based on their microstructures.
