3. If in dehydration experiment of 20.0 mL of Cyclohexanol, 12.0 grams of Cyclohexene was obtained, Calculate the theoretical and percentage yield of Cyclohexene. (Density of Cyclohexanol - 1.0 g/cm³). Show your solutions.

Q: What is the IUPAC name for the following molecule? ОН

A: The given compounds is : CH3CH2CH2CH2CH(OH)CH2CH2CH3 This compound is an alcohol as it contains -OH…

Q: 1 H-C-CH2 CH2-0-CH CH,

A: Some examples of functional groups are :  Carboxylic acid ( R-COOH) Alcoholic functional group (…

Q: Please do all 3D drawing for  1. KrBr2 2. H2CO 3.  NH4+

A: 3D drawing is the structure of the compounds.

Q: A three-dimensional representation of butane is shown. Translate the information about the…

A: In Newmann's representation, the conformers are represented in the shape of Y. A circle represents a…

Q: 4. Consider a compound with the formula CNS- a. Draw three possible Lewis dot structures, each one…

A: For the compound CNS-  we have to draw three Lewis structures. In the three structures, the central…

Q: 4. Identify which of the structures below correspond to a. b. d. e. x CH3CH₂CH₂CH(CH3)2 f.…

A:

Q: What type(s) of intermolecular forces are expected between CH3CH₂COOCH₂CH3 molecules? HH Н Indicate…

A:

Q: 1. Define coeffienct? 2. What is the valus of a subscript after a compound if one is not visible? 3.…

A: Coefficient is the stoichiometry of any compound that gives the quantitative ratio of compounds in a…

Q: Name these organic compounds: | Η Η | Η Η Η II | H=C=C=H Η | H —C =C=C=C=C=C=C=H structure H Η | Η H…

A: According to IUPAC nomenclature : Select the longest continuous chain of carbon atoms called as…

Q: 1. 6. :Cl: .. :CI-C-Ci: H-F .. :Cl:

A: Lewis structure is the useful technique to determine the binding between the atoms in the molecule .…

Q: For each of the following, circle the portion of the molecule that determines its functional group…

A:

Q: Write the systematic name of each organic molecule: structure ОН 0 ОН OH 0 ОН name О D D

A:

Q: What type(s) of intermolecular forces are expected between CH3CH₂COOCH₂CH3 molecules? H- H C H H H…

A: Based on the image, the molecule is a polar molecule. Therefore, the intermolecular forces that are…

Q: Hez molecule does not exist. Interpret this statement.

A:

Q: What type(s) of intermolecular forces are expected between CH3CH,CH2CH2CH2CH3 molecules H H. H H H H…

A: There are various types of interactions that happen between molecules. For example: Dipole-dipole…

Q: of c. H3C-CH-CH-CH2-c-NH-CH2-CH3 IUPAC H3C-CH-CH-CH2-C-NH-CH2-CH3 Common d. H3C-CH2-CH2 -C- -CH3…

A: All the organic compounds are made of a hydrocarbon chain with one or more functional groups…

Q: a polar compound will have a (smaller/larger)  Rf when a polar stationary phase is used

A: Rf value is given by: Rf=distance travelled by given componentdistance travelled by solvent front

Q: SOC2 Br NaCN A [1] (CH3)2CuLi [2] H20 [1] LIAIHA [2] H,0 CH3OH, H* PCC [1] DIBAL-H [1] CH,Li G [2]…

A: The products A, B, D, E, F, G, and H are shown as follows:

Q: Please show work and draw arrows

A: Organic compounds can be defined as compounds that contain carbon and hydrogen atoms. The carbon…

Q: HC 1.LIAIH 2. НО OH я OH

A: option -1 is correct due to hydride is attack on less sterically hinderded carbon

Q: a. H3C-CH2-NH-C-H IUPAC H3C-CH2-NH-ĉ-H Common H3C-CH-CH2-CH2-CH2-C-0-CH3 b. Br IUPAC…

A: (a)  IUPAC name : N-Ethylmethanamide Common name : N-Ethyl formamide     (b)  IUPAC name :…

Q: 3D drawing for  1.H2S 2. H3O+ 3. HCN 4. KrBr2 5. H2CO

A: Since we only answer up to 3 sub parts, we'll answer the first three. Please resubmit the question…

Q: Use the energy diagram below to answer questions 13-15. 14. Determine the potential energy of the…

A: 14. Potential energy of the reactant = 300kJ 15. Potential energy of the  product = 100 kJ

Q: QUESTION 19 Which of the following is the condensed structural formula for…

A:

Q: چله НО 12 НО ОН Н H₂/Pd-C Br 1. H/CH₂OH 2.TMSOT!/ Et,N: NBS CH₂O 1. Et,SIOT! 2. CHBr /1-BUOK Br 13 O…

A: The given reaction is organic reactions.

Q: CI AICI3 Y Br2 X HE SO3, H2SO4 FeBr3 V CICH2CH3 HNO3 W AICI3 H2SO4 AICI3 H2SO4, A S,T 2.H20 Br2 R uv…

A:

Q: Circle and name any and all functional groups present in each molecule (hint #1: two molecules have…

A: Functional groups are groups of atoms that shows a particular characteristics.

Q: Namanclature of the given compound

A:

Q: Consider the following 4 different structures: Find the relationship between them; you will have six…

A: The question is based on the concept of organic chemistry. we need to identify the relation between…

Q: Check the box under each compound that exists as a pair of mirror-image twins. If none of them do,…

A: Given are organic compounds.Compound which have Chiral carbon  exist as pair of mirror image…

Q: Check the box next to each molecule on the right that has the shape of the model molecule on the…

A:

Q: Draw a skeletal ("line") structure of this molecule: CH3 CH3 I CH2=C—CH—CH=CH…CH3

A: Skeletal structures are shown in two dimensions where element symbols are used for the atoms and…

Q: How can you classify molecules according to I values. Give examples.

A: Classification of molecules on the basis of moment of inertia The principal axes are ordered such…

Q: ·N model 2 3 4 I I I 5 I None of the above 6 7 8 I molecules (check all that apply) BrCN 03 ON3 □NO3

A: A question based on molecules. The displayed model is to be matched to the available molecules among…

Q: How many o bonds are in the structure of the organic molecule below? 0: :0: H N: C-H

A:

Q: Jl. Jen CH3 H KOH, CH₂OH heat CHO A) CH,CH-CC6H5 + B) C6H5CCH CHC6H5 유유 || C) C6H,CCH₂CC6H5 D)…

A: The condensation reaction of reaction two different aldehyde or between aldehyde and ketone to form…

Q: 1. Draw the major organic product for the following reactions: O O E D F A B C CH3 H3C 0 Br O= O H…

A: The major products of the reactions are given below-

Q: Q14: If you are given 3 samples of polypropylene (pp), one isotactic, one syndiotactic and one a…

A:

Q: Consider the molecule. * Rotate X G Rotate Y C OH Ⓡ Zoom In 5 Rotate Z Q Zoom Out A Label Atoms…

A: IUPAC nomenclature is used for naming the organic compound as per recommended by international union…

Q: B. Construct models for the following. Draw a sketch of each model. 1 CH, CH. OH 2. CH₂-C-H 11 H 3.…

A: “Since you have posted a question with multiple sub-parts, we will solve the first three sub parts…

Q: Q6) 1.03 2. (CH3)2S

A: The given reaction scheme is a typical example of ozonolysis, where the cycloaddition of ozone…

Q: Check the box next to each molecule on the right that has the shape of the model molecule on the…

A:

Q: Rank the following from weakest to strongest intermolecular force. CH3 (a) H3C-C-CH2-CH3 CH3 (b)…

A: Alkanes are the simplest organic molecules consisting of only C-C and C-H single bonds. There is no…

Q: 2. Find the geometries of the following ions using the VSEPR theory: SO;² and PO&".

A: As pe the guidelines we are supposed to answer the first question . To solve another question please…

Q: 1)A PBra 1) Mg он но NazCr2O7 HSO, H2O HOV K ко 2) H20 ÓH Br (H2SO.] 2) || -H,O H. 3) H:0 Mg BrMg…

A: For the synthesis of first product, CH3CH2Br is appropriate reactant because when it react with Mg…

Q: But why is KC1 inverted? I still dont understand why. why isn't it just Kc2 x Kc1.

A: The equilibrium constant for the reverse reaction is equal to the inverse of the equilibrium…