Answered: 3) Calculate the number of moles of:…

3) Calculate the number of moles of: a) Mg2+ ions in 8.320 mol of Mg3(PO4)2 b) acetate ions, CH3COO2, in 0.43 mol of Ca(CH3COO)2

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter2: Chemical Compounds

Section: Chapter Questions

Problem 80QRT

See similar textbooks

Similar questions

Salvarsan was long thought to be a single substance. Recently, however, a mass spectrometry study of the compound shows it to be a mixture of two molecules with the same empirical formula. Each has the composition 39.37% C, 3.304% H, 8.741% O, 7.652% N, and 40.932% As. One has a molar mass of 549 g/mol and the other has a molar mass of 915 g/mol. What are the molecular formulas of the compounds?
Calculate the mass in grams of 3.839 moles of (a) hydrazine, a rocket propellant. (b) caffeine, C4H5N2O. (c) theobromine, C7H8N4O2, the alkaloid present in chocolate and cocoa.
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.
The active ingredient in Pepto-BismoÂ® (an over- the-counter remedy for an upset stomach) is bismuth sub-salicylate, C7H5BiO4. Analysis of a 1.7500-g sample of Pepto-Bismol yields 346 mg of bismuth. What percent by mass is bismuth subsalicylate in the sample? (Assume that there are no other bismuth-containing compounds in Pepto-Bismol.)
How many moles of beryllium (Be) are needed to completely react with 10.0 moles of N2 in the synthesis of the compound Be3N2?
3.96 Methyl cyanoacrylate is the chemical name for the substance sold as Super Glue, and it has the chemical formula C5H5NO2. Calculate the number of molecules of this substance in a 1.0-ounce tube of Super Glue, assuming that the glue is 80% methyl cyanoacrylate by mass.
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
The molecular formula of acetylsalicylic acid (aspirin), one of the most commonly used pain relievers, is C9H8O4. a. Calculate the molar mass of aspirin. b. A typical aspirin tablet contains 500. mg C9H8O4. What amount (moles) of C9H8O4 molecules and what number of molecules of acetylsalicylic acid are in a 500.-mg tablet?
Chlorine exists mainly as two isotopes, 37Cl and 33Cl. Which is more abundant? How do you know?
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
3.121 If you have 21.1 g of iron(II) nitrate that is dissolved to give 1.54 L of solution, what is the molarity of the solution? What is the molarity of the nitrate ions?