2)Bromochlorodifluoromethane has been used in fire extinguishers. However, its breakdown products were found to be toxic. a)Draw the displayed formula of bromochlorodifluoromethane. b)CF3CH2F is being introduced as a replacement for various CFCs in refrigerants and aerosols, Name this compound. C)What is the main environmental problem caused by the use of CFCs?

Q: Why chlorofluorocarbons (CFCs) are responsible for destroying ozone ?

A: Chlorofluorocarbons are chemical compounds made of chlorine, carbon and fluorine. These are…

Q: How many kg of CO2 are emitted from an automobile that completely combusts all the gasoline in its…

A: Data given, Volume of the gasoline (octane, C8H18) = 16.5 gallon 1 gallon means 3.7854 L 16.5 gallon…

Q: CFCs are family of compounds containing the elements carbon, fluorine and chlorine. Which of the…

A: CFC: Cfc is a compound which is mainly or specifically used in the refrigerator and other…

Q: <p>The two major components of the atmosphere are the diatomic molecules of nitrogen and…

A: Nitrogen is less reactive than oxygen. Because of the strong nitrogen-nitrogen triple bond.

Q: Loss of atmospheric ozone has led to an ozone “hole” overAntarctica. The process occurs in part by…

A: (a) Ozone depletion occurs in 3 steps. Step 1: Chlorine atoms react with ozone (O3) to form chlorine…

Q: True or False: One way oxygen can get into the water is oxygen from the atmosphere dissolves and…

A:

Q: (a) What is the difference between chlorofluorocarbonsand hydrofluorocarbons? (b) Why are…

A: (a) Chlorofluorocarbon is a compound that contains chlorine, fluorine and carbon atoms, whereas…

Q: 3) a) State briefly what are the following (including their purpose in oil refining): i)…

A: i) Answer - Hydrocarbon and oil Hydrocarbon - A hydrocarbon is an organic chemical compound composed…

Q: HCFCs are a temporary solution to... HCFCs are a temporary solution to the problem of ozone…

A: The question is asking about the class of compounds that will replace Hydrochlorofluorocarbons…

Q: 4. Photochemical smog is a type of air pollution in the troposphere of our planet produced when…

A:

Q: Which of the following compounds is categorize by EPA (Environmental Protection Agency) as principal…

A:

Q: What effects do CFCs have on Earth's temperature

A: CFCs, short for chloroflorocarbons, are greenhouse gases that absorb heat from sunlight.

Q: How many kg of CO2 are emitted from an automobile that completely combusts all the gasoline in it:…

A: Volume of octane = 13.9 gallon  1 gallon = 3.7854 L Density of octane = 703 g/L Mass = Density…

Q: If gasoline produces only carbon dioxide and water when it burns completely, why is automobile…

A: We have to tell how automobile exhaust a source of air pollution.

Q: Explain why the concentration of CFCs increased in the atmosphere.

A: Chlorofluorocarbons(CFCs) are a chlorine-containing compound used in several appliances and cause…

Q: A friend of yours has seen each of the following items innewspaper articles and would like an…

A: Since we only answer up to 3 sub-parts, we’ll answer the first3. Please resubmit the question and…

Q: Describe two ways that people can change their habits and choices to reduce their personal…

A: The two ways that people can change their habits and choices to reduce their personal greenhouse gas…

Q: What emissions from human activities lead to ozone depletion? What are the chlorine reactions that…

A: Ozone layer act as protective shield for earth's atmosphere and prevent harmful ultra violet (UV)…

Q: Explain the following briefly: 1. Ozone layer depletion through chlorofluorocarbons

A: Ozone layer is present in stratosphere.  It protects the earth from the harmful UV radiation of the…

Q: How many kg of CO2 are emitted from an automobile that completely combusts all the gasoline in its…

A:

Q: Which of the following molecules are CFC's capable of destroying stratospheric ozone? (A) CF2Cl2 (B)…

A: “Since you have posted a question with multiple sub-parts, we will solve first question for you. To…

Q: Explain how the choices consumers make can help limit greenhouse gas emissions and therefore offset…

A: There are certain choices consumers can make to limit the green house gas emission this directly…

Q: 7) Explain how NOx and SOx gases contribute to acid rain. 8) Explain how CFCS contribute to the…

A: Answer - Acid rain - Acid rain, or acid deposition, is a broad term that includes any form of…

Q: True or False: Nitrogen Oxide is a precursor for both photochemical smog and acid rain.

A: Given, Nitrogen Oxide is a precursor for both photochemical smog and acid rain.

Q: what properties of CFC's make them ideal for various commercial application but also make them a…

A: Therefore the physical properties of CFC's make them ideal for various application like freezers,…

Q: What is the difference between associated gas and natural gas

A: The energy source from fossils which are deep beneath the surface of the earth is natural gas. They…

Q: O Molecula

A:

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.