23. (30) Predict the major organic product of each reaction or provide the reagents needed tocomplete each transformation.AICI3HO,CI(a)FeCla , Cl2(b)Br2(c)CH3FeBr31. Cl2 , FeCl3(d)2. HNO3, H2SO41. HNO3, H2SO4(e)2. Br2, FeBr31. Cl2 , FeCl3(f)1.2. Mg , ether2. H20, H*(g)Hg, Zn, HCI-C-CHCIAICI3H2 Pd1000 psi(h-i)CICI1 equivalent(1) O,N.CH3S K*SO3(k-I)C-CH3AICI3H2SO42. excess NH2NH2КОнNaCH3CH2CH2CH3(m-n)KMNO4NH3excessCH2CH3Page 6 of 6

Answered: Image /qna-images/answer/c54863aa-1299-455f-b70d-2c4ad45d98ce.jpg

23. (30) Predict the major organic product of each reaction or provide the reagents needed to complete each transformation. AICI3 HO CI (a) FeClg, Cl2 (b) Br2 (c) CH3- FeBr3 1. Cl2 , FeCl3 (d) 2. HNO3, H2SO4 1. HNO3, H2SO4 (e) 2. Br2, FeBr3 1. Cl2 , FeCl3 1. (f) 2. Mg , ether 2. H20, H* (g) Hg, Zn, HCI -C-CH2CH3 CI H2 Pd 1000 psi AICI3 (h-i) 1 equivalent (1) O,N. CI CH3S K*

23. (30) Predict the major organic product of each reaction or provide the reagents needed to complete each transformation. AICI3 HO CI (a) FeClg, Cl2 (b) Br2 (c) CH3- FeBr3 1. Cl2 , FeCl3 (d) 2. HNO3, H2SO4 1. HNO3, H2SO4 (e) 2. Br2, FeBr3 1. Cl2 , FeCl3 1. (f) 2. Mg , ether 2. H20, H* (g) Hg, Zn, HCI -C-CH2CH3 CI H2 Pd 1000 psi AICI3 (h-i) 1 equivalent (1) O,N. CI CH3S K*

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

3. Stereochemistry. Predict the stereochemistry of the major product formed for each of the following reactions. Give an explanation for your choice. а. ÇHO SiMe3 A `OPMB MgBr2 • Et20 95% (20:1) b. a. MegAI, Cp2ZrCl2 (cat.) CICH2CH2CI B b. 70% Br, ZnCl2 (1 eq) Pd(0) (cat.) с. 1. CBr4, Ph3P, Zn 2а. п-BuLi (2.1 eq), hexane, THF 2b. H20 workup CHO 3. 56% BH, THE 4. Pd(PPH3)4 (cat.) NaOEt, toluene, 80 °C Br d. Me 2. TSOH• H20 (1.2 ec) TBSO. 1а. Ме2CuLi, Elyо D2 (bicyclic) 94% D1 1b. NC-CO2ME, HMPA 91% 1c. aq NH,CI workup toluene, reflux
What sequence of reagents would produce the folloing? (A) (B) (C) (D) 1. 2. Zn, HCI ??? AlCl3 CI, AlCl3 CH3CH₂CH₂Cl 1. Br₂, FeBr3 2. CH₂CH₂CH₂MgBr 1. Cl₂, AlCl3 2. CH3CH₂CH₂, AlCl3
21. (26) Predict the reagent or product necessary to complete the following transformations. KCN , HCI, H2O H20 (a-b) H. 1 equiv. CH3OH 2 equiv. CH3OH (c-d) H. H+ H+ CH;CH2NHCH2CHs CH3CH2NH2 , H* H. (e-f) H+ H2CrO4 , H20 HO HO (g-h) H. H+ CuLi LIAIH[OC(CH3)33 (i-) CI H2C=PPH3 (k-l) What is the name of this reaction? What is the name this reaction?
32. (14) Predict the major organic product of the following reactions or provide the reagents needed to complete each transformation. Clearly show stereochemistry where appropriate. (a-b) (c-d) (e-f) (g-h) KOH heat LDA heat CH3 1. Br₂, light 2. CH3O+K, heat CH3 NaBH4 CH3OH Br S Na+ CN H₂O cold KMnO4 1. CH3MgBr 2. H₂O, H+
5.9. Suggest mechanisms that account for the outcome of the following reactions: а. Si(CH3)3 1) Br2, CH2C12 2) NaOCH3, CHgОн Br b. Si(CH3)3 NaO2CCH3 CH3CO,H ОН с. Br Br heat Br Br optically active racemic d. Br2 Br. Br
4. Draw the organic products formed in each of the following reactions. il b. C. 1₂ (excess) -OH CE .CO₂Et [1] LDA CHz(CO,Et)2 [2] CH₂CH₂Br [3] H₂O+, A [1] NaOEt [2] CH₂CH₂Br [1] NaOEt [2] CHSCH₂Cl (3) H₂O*, A d. 'OEI [1] NaOE1 [2] CH₂CH₂CH₂CH₂Br [3] H₂O*, A [1] LDA [2] CH₂CH₂Br
D. Hidrazor 3. The major organic product which results when PHCHO is treated with the following sequence of reagents: 1. CH3CH2M9B1; 2. H3O+; 3. Na2Cr207, H2SO4 is: A. PHCOCH3. B. PHOCH2CH3 C. PHCH2COCH3 D. PHCOCH2CH3 Su 4. Which of the following is also known as a Schiff base? A. an imine B. a cyanohydrin C. a hydrate D. sodium hydroxide Hulu MiniTool Power Dat.. COe | support +1-844-865-6999 口 || A 2 P Type here to search DELL F10 F11 F8 F9 F6 F7 F3 F4 F5 F1 F2 Fn
select reagents: cyclopentanone Reagents a. C6H5CHO b. NaOH, ethanol c. Pyrrolidine, cat. Hj. d. H₂C=CHCN e. H3O+ f. LDA g. A) bg EtOC(=O)CO₂Et h. i. B) ka k. I. m. O: BrCH₂CH=CH₂ NatOEt, ethanol Br₂, H+ K+ t-BUO™ CH2(CO2Et)z heat C) jh CO₂Et D) Im
Predict the correct product from the reaction shown. (1) Hg(OAc); THF, HO (1) (2) NaBH, HO (2) HO HO Compound (3) a. b. Compound (1) Compound (4) C. Compound (2) d.
What is the MAJOR product of the following reaction sequence? 1) NaOEt, ELOH, heat 2а) ВН,; THF 2b) H2O2, NaOH CI ... + en .... В ... + en SE ... en OH
15. Give the major organic product, paying attention to stereochemistry (syn/anti). Indicate if a racemic mixture is expected. a. a. BH3 b. H2O2, OH a. BH3 b. b. H2O2, OH a. BH3 a. BH3 C. d. b. H2O2, OH b. H₂O2, OH e. a. BH3 b. H₂O2, OH
Which set of reagents would be appropriate to synthesize bromobenzene from benzene? O 1. HNO3 in H2SO4; 2. H2CrO4 and heat O 1. H2CrO4 and heat; 2. H2 Pd/C O Br2 and FeBr3 O 1. CH3CH2CHCI and AICI3; 2. H2CRO4 and heat O4B12 and Fe O Heat and Br2 OBR2, HCI