23. (30) Predict the major organic product of each reaction or provide the reagents needed tocomplete each transformation.AICI3HO,CI(a)FeCla , Cl2(b)Br2(c)CH3FeBr31. Cl2 , FeCl3(d)2. HNO3, H2SO41. HNO3, H2SO4(e)2. Br2, FeBr31. Cl2 , FeCl3(f)1.2. Mg , ether2. H20, H*(g)Hg, Zn, HCI-C-CHCIAICI3H2 Pd1000 psi(h-i)CICI1 equivalent(1) O,N.CH3S K*SO3(k-I)C-CH3AICI3H2SO42. excess NH2NH2КОнNaCH3CH2CH2CH3(m-n)KMNO4NH3excessCH2CH3Page 6 of 6

Answered: Image /qna-images/answer/c54863aa-1299-455f-b70d-2c4ad45d98ce.jpg

23. (30) Predict the major organic product of each reaction or provide the reagents needed to complete each transformation. AICI3 HO CI (a) FeClg, Cl2 (b) Br2 (c) CH3- FeBr3 1. Cl2 , FeCl3 (d) 2. HNO3, H2SO4 1. HNO3, H2SO4 (e) 2. Br2, FeBr3 1. Cl2 , FeCl3 1. (f) 2. Mg , ether 2. H20, H* (g) Hg, Zn, HCI -C-CH2CH3 CI H2 Pd 1000 psi AICI3 (h-i) 1 equivalent (1) O,N. CI CH3S K*

23. (30) Predict the major organic product of each reaction or provide the reagents needed to complete each transformation. AICI3 HO CI (a) FeClg, Cl2 (b) Br2 (c) CH3- FeBr3 1. Cl2 , FeCl3 (d) 2. HNO3, H2SO4 1. HNO3, H2SO4 (e) 2. Br2, FeBr3 1. Cl2 , FeCl3 1. (f) 2. Mg , ether 2. H20, H* (g) Hg, Zn, HCI -C-CH2CH3 CI H2 Pd 1000 psi AICI3 (h-i) 1 equivalent (1) O,N. CI CH3S K*

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

32. (14) Predict the major organic product of the following reactions or provide the reagents needed to complete each transformation. Clearly show stereochemistry where appropriate. (a-b) (c-d) (e-f) (g-h) (i-j) (m-n) KOH heat NBS hv 1. Br₂, light 2. CH3O+K, heat LDA heat CH3 NaBH4 CH3OH CH3 CH₂l2, Cu Zn H₂O „H Br Na+ CN H₂O cold KMnO4 1. CH3MgBr 2. H₂O, H+ CH3OH, heat CH3S- +Na acetone mCPBA
US 4. Provide a synthetic route / strategy, leading to the synthesis of compound (D) via electrophilic aromatic substitution (EAS). (D) CH2CH3 CH2CH3
What sequence of reagents would produce the folloing? (A) (B) (C) (D) 1. 2. Zn, HCI ??? AlCl3 CI, AlCl3 CH3CH₂CH₂Cl 1. Br₂, FeBr3 2. CH₂CH₂CH₂MgBr 1. Cl₂, AlCl3 2. CH3CH₂CH₂, AlCl3
G.31.
Give the major organic product(s) of the following reactions for c) or b)
31. (8) Provide one reagent that will complete each transformation. (a) (b) (c) (d) OH & OH OH -CH₂OH CH₂OH ? HBr ? ? -CH₂CI OH (e) (f) ? (g) (h) -O+K H ? OH KMnO4 -OCH₂CH3 32. (12) Predict the 4 products resulting from reaction of the alkene with 1 equivalent of HBr (8 pts). (b) label the kinetic product (2 pts). (c) label the thermodynamic product (2 pts). OCH3 -OCH3 H OTS
CH2023 Q3 (a)
(3) Mechanism. Provide the mechanism for the following reaction. OH H₂SO4 (cat.) OH
Draw the chemical structure for product (7) and provide a detailed (a) mechanism for the reaction [4] that explains the stereochemistry of product (8). (m-CPBA = meta-chloroperoxybenzoic acid) m-CPBA Он HCI C9H160 [4] (7) (8) [5] NaOH/H20 C9H1802
(17). Subject :- Chemistry
G.5.
Kk.360.