13.20 Identify the chiral carbon in each of the following compounds: a. amphetamine (Benzedrine), stimulant, used in the treatment of hyperactivity CH3 | CH — CH—NН b. norepinephrine, increases blood pressure and nerve transmission ОН | CH–CH2- NH2 НО. НО

Q: Assign the correct stereochemical description to the chiral center in this molecule: CH,CH3 "Н H;C…

A: Every chiral carbon has specific configuration.these configuration are either R or S.

Q: Give three different examples of chiral compounds that do not have an asymmetrically substituted…

A:

Q: CH3 но -CH CH3 H3C 0-CH3 This compound has how many chiral carbons? 1 O 5 O 6 O 2 O 3

A:

Q: How many chiral carbons in the following? Оо О 1 О) 2 Оз О 4 0 5 О 6 ОН CH2OH ОН OH OH

A: Give the number of chiral centres in given molecule:

Q: In the steroid structure below: O O O 3 O H If there was a substituent on C3 trans to the methyl…

A:

Q: Identify the chiral carbon (s) in each of the following naturally occurring compounds, by stating…

A:

Q: How many chiral carbons are present in the following molecule? 5 07 pon F

A:

Q: What are the functional groups of the following compound? N=C=N N.…

A:

Q: Which of the following statements correctly describes the molecule below? H Br -Br -H OA. It has an…

A: Correct options should be B, C and D

Q: Assign stereochemical configurations (R/S) to the chiral carbons in the molecule below 2 = H = Cl =…

A:

Q: Which of the following characteristics does not contribute to carbon's uniqueness? Carbon forms four…

A: Here, we have to find the characteristic of carbon that does not contribute to carbon's uniqueness.…

Q: Explain with example the differences between aromatic and aliphatic compounds

A: Organic compounds are mainly made of carbon and hydrogen elements, but some times many other…

Q: 24.44 Identify the functional groups in each of the following compounds: (a) CH,CH,CH,CH;CH,CH3 H3C…

A: The given structures are,   and

Q: 6) Identify the main groups and one use of each of these compounds ; Functional Groups Application…

A: 1. Phosphoglyceride -----  Main group is esters ,and glycerol units. Function is serving a…

Q: How many chiral carbons are in the following molecule? 2 4 5 3 1 OH

A: Menthol is an organic compound with the chemical formula C10H20O and a structure based on a…

Q: what are polynuclear carbonyls ?

A: When the transition metal is attached to the carbon atom of the carbon monoxide ligand then it is…

Q: Draw a chiral isomer of  C4H9Br. Put an asterisk above the chiral carbon.

A: Chiral carbon is one which has all the four substituent (attachment ) to it a different group. The…

Q: Name the structural diagram for the following:

A: Since,Rule of IUPAC-1) Longest chain as parent chain.2) Numbering start from those side where more…

Q: What is the name of this chiral molecule?

A: The name of the chiral molecule is given below:

Q: Name the following molecules, for which the structure is given. CH,-CH3 CH,=C, CH3

A:

Q: How many chiral carbons are present in the following molecule? 3 4 5 6 CI Br

A: The number of chiral carbons present in the given molecule are: 5Explanation:

Q: Using wedge-and-dash bonds, modify the bonds on the chiral carbon in the molecule below so the…

A:

Q: Question 51 of 67 Identify the relationship between the following two compounds. gho A) identical B)…

A:

Q: Using wedge-and-dash bonds, modify the bonds on the chiral carbon in the molecule below so the…

A: The important rules for assigning the absolute configuration of a chiral center according to CIP…

Q: What is the IUPAC name for the following compound? diamidopropane pentanediamine pentanediamide…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Label Chiral carbon atoms of Propranolol

A:

Q: compound? H2N OH This compound has one chiral carbon. This compound has no chiral carbon.

A: A chiral center is defined as an atom in a molecule that is bonded to four different chemical group…

Q: 3. Indicate the chiral carbons in each of the following molecules. b) НО. Н НО- H Н HO НО -OH H -OH…

A: -> In molecule chiral carbon is carbon which has all four different groups attached.

Q: Name the family to which each organic compound belongs. The first answer has been filled in for you.…

A: Since,Functional group represent the characteristics of the compound.Example-For methanol or ethanol…

Q: How many chiral centers are in the following compound? Но. O 2 O 3 O 4 0 5 0 6

A: The molecule given is,

Q: H. |1 C=0 H C OH 3 CH2OH Number of chiral carbon atoms: Name of the structure

A: Given that : We have to determine the number of chiral carbon atoms in the following structure and…

Q: 2. How many chiral carbon atoms are in the following compound? CH:(OH)CH(OH)CH(OH)CH(OH)CH;OH a) 1…

A: A chiral carbon atom or asymmetric carbon atom is one whose four valencies are occupied by four…

Q: Identify the chiral carbon atoms in each structure. If no chiral carbon atoms are present write:…

A: The carbon atom to which four different groups are attached called as chiral carbon.

Q: How many chiral centers are in the molecule below? Hom 'N CH3 one two four three N-H

A: An carbon atom is said to be chiral if it is attached to 4 different atoms or groups

Q: Rank the following functional groups in the order of decreasing polarity: -NH2, - (CH2)7 CH3, -CN, -…

A: Polarity means molecule has some dipole moment. Higher the dipole moment, higher the polarity of the…

Q: uish between the following pairs of organic compounds including a chemi

A: The chemical tests are used to distinguish the different chemical compounds. It is possible because…

Q: Draw the skeletal (line-bond) structure of CH3CH2NO2

A: Since, In condensed structural formula, All the atom written in one line without any space left. In…

Q: How many chiral carbon atoms are there in the pictured molecule? H2N-CH-COH CH2CHCH3 CH3 O 2 O 5 O 4…

A: