Answered: . According to the following equation:2…

. According to the following equation:2 KClO3 (s) -> 2 KCl (s) + 3 O2 (g)a. How many grams of O2 are produced if 2.50 moles of KClO3 are completely decomposed by heating?

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.87PAE

See similar textbooks

Related questions

Q: Given the following equation: 2 KClO3 ---> 2 KCl + 3 O2 How many moles of O2 can be produced by…

A: We have to predict the amount of oxygen gas produced.

Q: What is the mass in grams of NO that will be produced from 51.8 g of NO₂ reacted with excess water…

A: For determining the amount of product, the mole ratio of reactants in a balanced reaction must be…

Q: many moles of O₂ would be required to generate 13.0 mol of NO₂ in the reaction below assuming the…

A: In this reaction nitrogen oxide and oxygen are react with each other to form nitrogen dioxide. Here…

Q: What is the mass in grams of carbon dioxide that would be required to react with 43.9 g of LiOH in…

A: The above problem is based on mole concept (stoichiometry).

Q: How many grams of HCl can be produced by the reaction of 25.0 g of NaCl with excess sulfuric acid?…

A: Given Balanced chemical equation Nacl is limiting reagent 25.0g NaCl How much HCl produced

Q: Hydrochloric acid can be prepared by the following reaction: NaCl(s)+ H2SO4(aq)--> HCl(g) +…

A: Solution stoichiometry involves the calculation of concentration of solutions in the given…

Q: What is the mass in grams of NO that can be formed from 4.30 moles of NO₂ in the reaction below? 3…

A: The chemical reaction,3NO2(g)+H2O(g)→2HNO3(g)+NO(g)and number of moles of NO2 = 4.30 molewe are…

Q: What is the mass in grams of NO that will be produced from 10.7 g of NO₂

A: Given :- 3 NO₂(g) + H₂O(l) → 2 HNO₃(g) + NO(g) Mass of NO2 = 10.7 g To calculate :-…

Q: How many moles of lithium hydroxide would be required to produce 57.0 g of Li₂CO₃ in the following…

Q: The first step in the industrial manufacture of nitric acid is the oxidation of ammonia: 4NH32 +…

A: Given chemical reaction, 4 NH3 (g) + 5 O2 (g) → 4 NO (g) + 6 H2O Mass of oxygen, O2 = 0.765 g…

Q: Starting with the following equation, Fe₂O₃(s) + Al(s) → Fe(l) + Al₂O₃(s) calculate the moles of…

Q: What is the mass in grams of NO that can be formed from 5.42 moles of NO₂ in the reaction below? 3…

A: The balanced chemical reaction .............(A) Moles of NO2 = 5.42 mol Mass of NO = ?…

Q: What is the mass in grams of H₂ that can be formed from 70.4 grams of NH₃ in the following reaction?…

A: Given, 70.4 grams of NH₃

Q: moles of lithium hydroxide would be required to produce 59.5 g of Li₂CO₃ in the following chemical…

A: The given chemical equation is as follows: 2LiOH + CO2 →Li2CO3 + H2O

Q: What is the mass in grams of carbon dioxide that would be required to react with 17.1 g of LiOH in…

A: Given, 2 LiOH(s) + CO₂(g) → Li₂CO₃(s) + H₂O(l) mass of LiOH react = 17.1 g mass of CO2 required = ?…

Q: 2 NaN3(s) ------> 2 Na(s) + 3 N2(g) How many grams of nitrogen are produced when 10. grams of…

A: The given reaction is, 2 NaN3(s) ------> 2 Na(s) + 3 N2(g) Clearly, from…

Q: For the chemical reaction 2NaOH+H2SO4⟶Na2SO4+2H2O, how many moles of sodium sulfate will be produced…

A: 1- First calculate the moles of NaOH : moles of NaOH = ( mass / molar mass of NaOH) moles of NaOH…

Q: What is the mass in grams of H₂ that can be formed from 43.6 grams of NH₃ in the following reaction?…

A: Molar mass of NH3 = Atomic mass of N + H x 3 = 14 g/mol + 1 g/mol x 3…

Q: Some chemical reactants are listed in the table below. Complete the table by filling in the…

A: Oxidation number represents the number of electrons lost or gain by the atom to get stable…

Q: What is the identity of the %H2O of CuSO4•3H2O?

A: The three molecules of water present in each molecule of CuSO4.3H2O are called as water of…

Q: moles

A: Dear student this question is related to mol concept.

Q: What is the mass in grams of carbon dioxide that would be required to react with 20.2 g of LiOH in…

Q: How many moles of O₂ would be required to generate 13.0 mol of NO₂ in the reaction below assuming…

Q: How many moles of HNO₃ will be produced from the reaction of 19.5 g of NO₂ with excess water

A: Number of moles = mass/molar mass Molar mass of NO2 = 46.0 g/ mol

Q: Based on the balanced reaction: 2 Al + 3 Cl2→ 2 AlCl3, what is the maximum number of moles of AlCl3…

A: The number of moles of Al and Cl2 is 2.11×101 mol and 1.990×101 mol, respectively.

Q: What is the mass in grams of carbon dioxide that would be required to react with 57.7 g of LiOH in…

A: 2 LiOH(s) + CO2(g) → Li2CO3(s) + H2O(l) Molar mass of lithium hydroxide=23.95 g/molmass of lithium…

Q: How many moles of lithium hydroxide would be required to produce 35.0 g of Li₂CO₃ in the following…

A: Given: mass of Li₂CO₃ = 35.0 g molar mass of Li₂CO₃ = 70.0 g/mol

Q: How many moles of O₂ would be required to generate 13.0 mol of NO₂ in the reaction below assuming…

Q: calculate the theoretical yield in grams All3 from the complete reaction of 18.3 g Al According to…

A: in Balanced chemical equation number of atoms are equal on both reactent and products side.

Q: Given the equation, 2NaClO3 → 2NaCl + 3O2:

A: In the given reaction, two moles of NaClO3reacts to form two moles of NaCl and three moles of O2.…

Q: That mass of C;Hg is needed to produce 5.25 moles of carbon dioxide?

A: Combustion of hydrocarbons: C3H8 + 5O2 → 3 CO2 + 4 H2O moles of carbon dioxide = 5.25 moles

Q: How many grams of NO will be produced from 55.7 g of NO₂ reacted with excess water in the following…

A: The given reaction is as follows: 3NO2(g) + H2O(l) → 2HNO3(g) + NO(g) The given mass of NO2 = 55.7 g…

Q: Given 2 CL2 + Ti ---> TiCl4, how many moles of products will be produced from 1,205.3 grams of…

Q: What is the mass in grams of H₂ that can be formed from 54.4 grams of NH₃ in the following reaction?…

A: The number of moles of a substance is given as the mass upon molar mass.

Q: or the reaction represented by the equation SO3+H2O-->H22SO4 how many grams of sulfuric acid…

A: Given SO3 + H2O → H2SO4Mass of SO3 given = 460 gMass of H2O given = 197 gMass of H2SO4 produced = To…

Q: What is the mass in grams of NO that will be produced from 36.8 g of NO₂ reacted with excess water…

A: The balanced reaction taking place is given as, => 3 NO2 (g) + H2O (l) -----> 2 HNO3 (g) + NO…

Q: A flask containing 450 mL of 0.50 M H2SO4 was accidentally knocked to the floor. How many grams of…

A: Acid reacts with base to form salt and water. This reaction is known as neutralization reaction. The…

Q: What is the mass in grams of carbon dioxide that would be required to react with 15.0 g of LiOH in…

A: The balanced reaction taking place is given as, => 2 LiOH (s) + CO2 (g) -------> Li2CO3 (s) +…

Q: How many moles of lithium hydroxide would be required to produce 82.0 g of Li₂CO₃ in the following…

A: Given: For the reaction: 2LiOH(s) + CO₂(g) → Li₂CO₃(s) + H₂O(l) 2 mol 1 mol 1 mol…

Question

. According to the following equation:
2 KClO3 (s) -> 2 KCl (s) + 3 O2 (g)
a. How many grams of O2 are produced if 2.50 moles of KClO3 are completely decomposed by heating?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Trending now

This is a popular solution!

Step by step

Solved in 1 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

What is the molarity of a solution of sodium hydrogen sulfate that is prepared by dissolving 9.21 g NaHSO4 in enough water to form 2.00-L solution? What is the molarity of each ion in the solution?
4.19 How many metric tons of carbon are required to react with 7.83 metric tons of Fe2O3 according to the following reaction? 2Fe2O3+3C3CO2+4Fe How many metric tons of iron are produced?
Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
One of the ways to remove nitrogen monoxide gas, a serious source of air pollution, from smokestack emissions is by reaction with ammonia gas, NH3. The products of the reaction, N2 and H2O, are not toxic. Write the balanced equation for this reaction. Assign an oxidation number to each element in the reactants and products, and indicate which element is oxidized and which is reduced.
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
What is the molarity of a solution of strontium chloride that is prepared by dissolving 4.11 g SrCl2 in enough water to form 1.00-L solution? What is the molarity of each ion in the solution?
Assume the methanol synthesis has an 85.0% yield and you want to make 1.00 kg CH3OH. Calculate the mass (g) of H2 you should use if you have sufficient CO.
A sample of H2C2O4.2H2O of mass 3.35 g is heated to drive off the waters of hydration (designated separately in the chemical formula). What mass of H2C2O4 remains once the water has been removed by heating?
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Ethanol, C2H5OH, is a gasoline additive that can be produced by fermentation of glucose. C6H12O62C2H5OH+2CO2 (a) Calculate the mass (g) of ethanol produced by the fermentation of 1.000 lb glucose. (b) Gasohol is a mixture of 10.00 mL ethanol per 90.00 mL gasoline. Calculate the mass (in g) of glucose required to produce the ethanol in 1.00 gal gasohol. Density of ethanol = 0.785 g/mL. (c) By 2022, the U. S. Energy Independence and Security Act calls for annual production of 3.6 1010 gal of ethanol, no more than 40% of it produced by fermentation of corn. Fermentation of 1 ton (2.2 103 lb) of corn yields approximately 106 gal of ethanol. The average corn yield in the United States is about 2.1 105 lb per 1.0 105 m2. Calculate the acreage (in m2) required to raise corn solely for ethanol production in 2022 in the United States.
Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.
How many molecules of the sweetener saccharin can be prepared from 30 C atoms, 25 H atoms, 12 0 atoms, 8 S atoms, and 14 N atoms?