Using Fig. 2-30, list the elements (ignore the lanthanides and actinides) that have ground-state electron configurations that differ from those we would expect from their positions in the periodic table.
Using Fig. 2-30, list the elements (ignore the lanthanides and actinides) that have ground-state electron configurations that differ from those we would expect from their positions in the periodic table.
Using Fig. 2-30, list the elements (ignore the lanthanides and actinides) that have ground-state electron configurations that differ from those we would expect from their positions in the periodic table.
Expert Solution & Answer
Interpretation Introduction
Interpretation:
The elements having the ground-state electronic configurations different from what we would expect from their positions in the periodic table are to be listed.
Concept Introduction:
The distribution of the electrons present in an atom in the respective atomic orbitals is known as the electronic configuration. However, some elements have different ground-state configurations than expected from their placement in the periodic table.
To determine: The elements having different ground-state configurations than expected from their placement in the periodic table.
Answer to Problem 152AE
Answer
The elements
Cr,Cu,Nb,Mo,Tc,Ru,Rh,Pd,Ag,Pt,AuandRg exhibit electronic configurations different from their expected ones.
Explanation of Solution
The filling of orbitals according to their energy levels gives the expected ground-state electronic configurations for the elements. And the following elements exhibit ground-state configurations that are different from what was expected with respect to their placement in the periodic table.
In the case of Chromium and copper, the expected configuration in accordance to the Aufbau principle would be,
This happens as completely filled sub levels are more stable than the partly filled ones. Also, a half filled sub level is more stable than the partly filled one.
In the case of Niobium, the expected configuration in accordance to the Aufbau principle would be,
Nb=(1s22s22p63s23p63d104s24p65s24d3)
But the actual configuration it exhibits is,
Nb=(1s22s22p63s23p63d104s24p65s14d4)
The repulsion of two electrons within the same orbital pushes one electron from the
5s to the
4d orbital.
Some other elements that exhibit electronic configurations different from expected ones are,
The compounds that portray the
d10 systems do so in order to attain extra stability. In case of the
RuandRh, such configurations are attained by these compounds in order to attain extra stability by attaining a completely filled
T2g orbitals.
Conclusion
The elements having the ground-state electronic configurations different from what we would expect from their positions in the periodic table are
Cr,Cu,Nb,Mo,Tc,Ru,Rh,Pd,Ag,Pt,AuandRg.
Want to see more full solutions like this?
Subscribe now to access step-by-step solutions to millions of textbook problems written by subject matter experts!
1) a) Give the dominant Intermolecular Force (IMF) in a sample of each of the following
compounds. Please show your work. (8) SF2, CH,OH, C₂H₂
b) Based on your answers given above, list the compounds in order of their Boiling Point
from low to high. (8)
19.78 Write the products of the following sequences of reactions. Refer to your reaction road-
maps to see how the combined reactions allow you to "navigate" between the different
functional groups. Note that you will need your old Chapters 6-11 and Chapters 15-18
roadmaps along with your new Chapter 19 roadmap for these.
(a)
1. BHS
2. H₂O₂
3. H₂CrO4
4. SOCI₂
(b)
1. Cl₂/hv
2. KOLBU
3. H₂O, catalytic H₂SO4
4. H₂CrO4
Reaction
Roadmap
An alkene 5. EtOH
6.0.5 Equiv. NaOEt/EtOH
7. Mild H₂O
An alkane
1.0
2. (CH3)₂S
3. H₂CrO
(d)
(c)
4. Excess EtOH, catalytic H₂SO
OH
4. Mild H₂O*
5.0.5 Equiv. NaOEt/EtOH
An alkene 6. Mild H₂O*
A carboxylic
acid
7. Mild H₂O*
1. SOC₁₂
2. EtOH
3.0.5 Equiv. NaOEt/E:OH
5.1.0 Equiv. NaOEt
6.
NH₂
(e)
1. 0.5 Equiv. NaOEt/EtOH
2. Mild H₂O*
Br
(f)
i
H
An aldehyde
1. Catalytic NaOE/EtOH
2. H₂O*, heat
3. (CH,CH₂)₂Culi
4. Mild H₂O*
5.1.0 Equiv. LDA
Br
An ester
4. NaOH, H₂O
5. Mild H₂O*
6. Heat
7.
MgBr
8. Mild H₂O*
7. Mild H₂O+
Li+ is a hard acid. With this in mind, which if the following compounds should be most soluble in water?
Group of answer choices
LiBr
LiI
LiF
LiCl
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.
Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell
Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell
Quantum Numbers, Atomic Orbitals, and Electron Configurations; Author: Professor Dave Explains;https://www.youtube.com/watch?v=Aoi4j8es4gQ;License: Standard YouTube License, CC-BY