Chapter 12, Problem 7P

You did an experiment in which you found that 59.8 J was required to raise the temperature of 25.0 g of ethylene glycol (a compound used as antifreeze in automobile engines) by 1.00 K. Calculate the specific heat capacity of ethylene glycol from these data.

The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.

Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.

Which of the following quantities can be taken to be independent of temperature? independent of pressure? (a) H for a reaction (b) S for a reaction (c) G for a reaction (d) S for a substance

9.42 Why is enthalpy generally more useful than internal energy in the thermodynamics of real world systems?

An industrial process for manufacturing sulfuric acid, H2SO4, uses hydrogen sulfide, H2S, from the purification of natural gas. In the first step of this process, the hydrogen sulfide is burned to obtain sulfur dioxide, SO2. 2H2S(g)+3O2(g)2H2O(l)+2SO2(g);H=1124kJ The density of sulfur dioxide at 25C and 1.00 atm is 2.62 g/L, and the molar heat capacity is 30.2 J/(mol C). (a) How much heat would be evolved in producing 1.00 L of SO2 at 25C and 1.00 atm? (b) Suppose heat from this reaction is used to heat 1.00 L of the SO2 from 25C to 500C for its use in the next step of the process. What percentage of the heat evolved is required for this?

When 1.000 g of gaseous butane, C4H10, is burned at 25C and 1.00 atm pressure, H2O(l) and CO2(g) are formed with the evolution of 49.50 kJ of heat. a Calculate the molar enthalpy of formation of butane. (Use enthalpy of formation data for H2O and CO2.) b Gf of butane is 17.2 kJ/mol. What is G for the combustion of 1 mol butane? c From a and b, calculate S for the combustion of 1 mol butane.