Physical Science
Physical Science
10th Edition
ISBN: 9780073513898
Author: Bill Tillery
Publisher: MCGRAW-HILL HIGHER EDUCATION
bartleby

Concept explainers

Question
Book Icon
Chapter 10, Problem 4PEB

(a)

To determine

To write: The balanced chemical equation for the reaction NO + O2NO2

(a)

Expert Solution
Check Mark

Answer to Problem 4PEB

Solution:

The complete and balanced chemical equation for the reaction is 2NO + O22NO2.

Explanation of Solution

Introduction:

A chemical equation is a way of depicting a chemical reaction using chemical symbols and formulae.

A balanced chemical equation is the one in which the number of atoms for each element and the total charge are same on both the sides of the equation. This is done to avoid the violation of the conservation of mass principle.

Explanation:

The number of atoms of N on the right hand side and the left hand sides are equal but the number of atoms of O is not equal on the right hand side and the left hand side. So to balance the number of O atoms multiply 2 with NO2 and NO.

Now the equation becomes.

2NO + O22NO2

Conclusion:

Hence, the balanced chemical equation for the reaction is 2NO + O22NO2.

(b)

To determine

To write: The balanced chemical equation for the reaction KClO3KCl+O2

(b)

Expert Solution
Check Mark

Answer to Problem 4PEB

Solution:

The complete and balanced chemical equation for the reaction is 2KClO32KCl+3O2.

Explanation of Solution

Introduction:

A chemical equation is a way of depicting a chemical reaction using chemical symbols and formulae.

A balanced chemical equation is the one in which the number of atoms for each element and the total charge are same on both the sides of the equation. This is done to avoid the violation of the conservation of mass principle.

Explanation:

The number of atoms of K and Cl on the right hand side and the left hand sides are equal but the number of atoms of O is not equal on the right hand side and the left hand side. So to balance the number of O atoms multiply 2 with KCl and KClO3. The K and Cl atoms are balanced, now to balance O multiply 3 with O2.

Now the equation becomes.

2KClO32KCl+3O2

Conclusion:

Hence, the balanced chemical equation for the reaction is 2KClO32KCl+3O2.

(c)

To determine

To write: The balanced chemical equation for the reaction NH4Cl+Ca(OH)2CaCl2+NH3+H2O

(c)

Expert Solution
Check Mark

Answer to Problem 4PEB

Solution:

The complete and balanced chemical equation for the reaction is 2NH4Cl+Ca(OH)2CaCl2+2NH3+2H2O.

Explanation of Solution

Introduction:

A chemical equation is a way of depicting a chemical reaction using chemical symbols and formulae.

A balanced chemical equation is the one in which the number of atoms for each element and the total charge are same on both the sides of the equation. This is done to avoid the violation of the conservation of mass principle.

Explanation:

The number of atoms of N and Ca on the right hand side and the left hand side are equal but the number of atoms of H, O and Cl are not equal on the right hand side and the left hand side. So to balance the number of H, O and Cl atoms multiply 2 with NH3, H2O and NH4Cl.

Now the equation becomes.

2NH4Cl+Ca(OH)2CaCl2+2NH3+2H2O

Conclusion:

Hence, the balanced chemical equation for the reaction is 2NH4Cl+Ca(OH)2CaCl2+2NH3+2H2O.

(d)

To determine

To write: The balanced chemical equation for the reaction NaNO3+H2SO4Na2SO4+HNO3

(d)

Expert Solution
Check Mark

Answer to Problem 4PEB

Solution:

The complete and balanced chemical equation for the reaction is 2NaNO3+H2SO4Na2SO4+2HNO3.

Explanation of Solution

Introduction:

A chemical equation is a way of depicting a chemical reaction using chemical symbols and formulae.

A balanced chemical equation is the one in which the number of atoms for each element and the total charge are same on both the sides of the equation. This is done to avoid the violation of the conservation of mass principle.

Explanation:

The number of Na atom on the left hand side is 1 and on the right hand side is 2 which is not balanced. Similarly, number of Na atom on the left hand side is 1 which is not equal to the number of N atom on the left hand side of the equation. Number of S and O atoms on the left hand side of the equation are same. In order to balance the number of atoms on both sides of the equation we need to multiply NaNO3 by 2 and HNO3 by 2.

Now the equation becomes.

2NaNO3+H2SO4Na2SO4+2HNO3

Conclusion:

Hence, the balanced chemical equation for the reaction is 2NaNO3+H2SO4Na2SO4+2HNO3.

(e)

To determine

To write: The balanced chemical equation for the reaction PbS+H2O2PbSO4+H2O

(e)

Expert Solution
Check Mark

Answer to Problem 4PEB

Solution:

The complete and balanced chemical equation for the reaction is PbS+4H2O2PbSO4+4H2O.

Explanation of Solution

Introduction:

A chemical equation is a way of depicting a chemical reaction using chemical symbols and formulae.

A balanced chemical equation is the one in which the number of atoms for each element and the total charge are same on both the sides of the equation. This is done to avoid the violation of the conservation of mass principle.

Explanation:

The number of Pb, S and H atoms are balanced on both sides of the equation and are equal but number of O atoms are not equal on the both side of this chemical equation. In order to balance the number of atoms on both sides of the equation we need to multiply H2O2 by 4 and HNO3 by 4.

Now the equation becomes.

PbS+4H2O2PbSO4+4H2O

Conclusion:

Hence, the balanced chemical equation for the reaction is PbS+4H2O2PbSO4+4H2O.

(f)

To determine

To write: The balanced chemical equation for the reaction Al2(SO4)3+BaCl2AlCl3+BaSO4

(f)

Expert Solution
Check Mark

Answer to Problem 4PEB

Solution:

The complete and balanced chemical equation for the reaction is Al2(SO4)3+3BaCl22AlCl3+3BaSO4.

Explanation of Solution

Introduction:

A chemical equation is a way of depicting a chemical reaction using chemical symbols and formulae.

A balanced chemical equation is the one in which the number of atoms for each element and the total charge are same on both the sides of the equation. This is done to avoid the violation of the conservation of mass principle.

Explanation:

The number of Ba atoms is equal on both sides. The number of Al, S, H, Cl and O atoms are not equal on both the sides of the chemical equation. In order to balance the number of atoms on both sides of the equation we need to multiply BaCl2  by 3, AlCl3 by 2 and BaSO4 by 3.

Now the equation becomes.

Al2(SO4)3+3BaCl22AlCl3+3BaSO4

Conclusion:

Hence, the balanced chemical equation for the reaction is Al2(SO4)3+3BaCl22AlCl3+3BaSO4.

Want to see more full solutions like this?

Subscribe now to access step-by-step solutions to millions of textbook problems written by subject matter experts!
Students have asked these similar questions
Three point-like charges in the attached image are placed at the corners of an equilateral triangle as shown in the figure. Each side of the triangle has a length of 38.0 cm, and the point (C) is located half way between q1 and q3 along the side. Find the magnitude of the electric field at point (C). Let q1 = −2.80 µC, q2 = −3.40 µC, and q3 = −4.50 µC. Thank you.
Three point-like charges are placed as shown in the attach image, where r1 = r2 = 44.0 cm. Find the magnitude of the electric force exerted on the charge q3. Let q1 = -1.90 uC, q2 = -2.60 uC, and q3 = +3.60 uC. Thank you.
The drawing attached shows an edge-on view of two planar surfaces that intersect and are mutually perpendicular. Surface (1) has an area of 1.90 m², while Surface (2) has an area of 3.90 m². The electric field in magnitude of 215 N/C. Find the magnitude of the electric flux through surface (1 and 2 combined) if the angle theta made between the electric field with surface (2) is 30.0 degrees. Thank you.

Chapter 10 Solutions

Physical Science

Knowledge Booster
Background pattern image
Physics
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, physics and related others by exploring similar questions and additional content below.
Similar questions
SEE MORE QUESTIONS
Recommended textbooks for you
Text book image
An Introduction to Physical Science
Physics
ISBN:9781305079137
Author:James Shipman, Jerry D. Wilson, Charles A. Higgins, Omar Torres
Publisher:Cengage Learning
Text book image
Intro Spectroscopy
Physics
ISBN:9781305221796
Author:PAVIA
Publisher:Cengage