Write a balanced equation to form sodium methoxide from methanol. Choose a reactant that is strong enough to favor products. Show the mechanism of this reaction with proper arrow-pushing formalism. Give the pKa values for each acidic reactant and product and explain how you know that your reaction is product-favored.

Write a balanced equation to form sodium methoxide from methanol. Choose a reactant that is strong enough to favor products. Show the mechanism of this reaction with proper arrow-pushing formalism. Give the pKa values for each acidic reactant and product and explain how you know that your reaction is product-favored.

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter19: Enolate Anions And Enamines

Section19.9: Crossed Enolate Reactions Using Lda

Problem JQ

See similar textbooks

Similar questions

Organic Chemistry
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
If the equilibrium constant for the reaction of acetic acid and ethanol to form ethyl acetate is 4.02, what is the concentration of ethyl acetate at equilibrium if the reaction is carried out with equal amounts of acetic acid and ethanol? a.What is the concentration of ethyl acetate at equilibrium if the reaction is carried out with 10 times more ethanol than acetic acid? Hint: Recall the quadratic equation: for ax2 + bx + c = 0, b.What is the concentration of ethyl acetate at equilibrium if the reaction is carried out with 100 times more ethanol than acetic acid?
When propene reacts with gaseous hydrogen bromide, HBr, two products, 1-bromopropane and 2-bromopropane are formed. The reaction is a two-step process in which the electrophilic attack occurs in the first step. Identify the electrophile in this reaction Draw a diagram showing the first step of the reaction that leads to the production of 2-bromopropane.
i cant find the answers
6. Predict the position of the equilibrium and calculate the equilibrium constant, Keq, for the following acid-base reaction. CH3NH₂+ + CH3COO- CH3NH₂ + CH3COOH methylamine acetic acid acetate ion pK₂ = 4.74 methylammonium ion pK₂ = 10.64
Nitration of an aromatic ring involves an electrophilic substitution reaction. Draw the structure of the electrophile that is attacked by the aromatic ring and the intermediate formed after attachment of the electrophile to the ring. Be sure to show formal charges.
For the Reaction: NH3+ H2O = NH4+ OH- When adding NH3+ phenolphthalien+ HCl What stress is applied and what direction does the equilibrium shift? When adding NH3+ phenolphthalien+ NH4Cl What stress is applied and what direction does the equilibrium shift? When adding NH3+ phenolphthalien+ NaOH What stress is applied and what direction does the equilibrium shift? When adding NH3+ phenolphthalien+ HCl What stress is applied and what direction does the equilibrium shift?
Synthesize the following compounds starting from benzene. Reactions contain more than two steps. Assume that you can separate ortho and para isomers if necessary
An ion with a positively charged nitrogen atom in a three-membered ring is called an aziridinium ion. The following aziridinium ion reacts with sodiummethoxide to form compounds A and B: If a small amount of aqueous Br2 is added to A, the reddish color of Br2 persists, but the color disappears when Br2 is added to B. When the aziridinium ion reacts with methanol, only A is formed. Identify A and B.
Bhu Please don't provide handwritten solution Write the mechanism of the reaction show with proper arrow formations. Do not combine in one step
Under certain reaction conditions, 2,3-dibromobutane reacts with two equivalents of base to give three products, each of which contains two new p bonds. Product A has two sp hybridized carbon atoms, product B has one sp hybridized carbon atom, and product C has none. What are the structures of A, B, and C?