Which of the following is the lower energy cyclohexane conformer? A-values: Br = 0.6 kcal/mol; isopropyl = 2.1 kcal/mol. A B A Br B Br

Q: Draw an expanded structural formula of pent-1-en-3-yne/ CH3-CC-CH=CH2 and then label each carbon.…

A:

Q: Structure A Cis Isomer H₂C Trans Isomer Name of the Alkene H C=C CH₂CH₂ H [Choose ] [Choose ]…

A: Alkenes can exhibit geometrical isomerismConditions for geometrical isomerism              1.…

Q: 3 HC O Search HC H ite the IUPAC name of the product. || = CH H - CH3

A: For IUPAC naming of following steps are required First of all identify the longest carbon chain…

Q: Look at the following compound. The compound is an isomer of H H H H Propyne O Propane O Propene H…

A: -> Each of two or more Compounds with the same molecular formula but different arrangement of…

Q: 2. Provide IUPAC name for each structural formula. CH3CH,C(CH3)2CH2CH3 —с-с-ҫ-с-с-NH> -d- C-…

A: Since we only answer up to 3 sub-parts, we'll answer the first 3. Please resubmit the question and…

Q: Choose the correct IUPAC name for the following structure: CH 3 H H C(CH3)3…

A: The given structure is:The given names…

Q: What is the best name for the following molecule: H3C- CH3 H3C CH3 H3C 2,5-dimethyl-3-ethylhexane…

A: The given compound is alkane  IUPAC Nominclature rules for alkane :  Find and name the longest…

Q: Macmillan Learning H&C. CH2 H&C CH HC Consider alkene 2. CH3 ΤΟ =CH2 H2 H₂C 생 Consider alkene 3. H₂C…

A: The objective of the question is to correct the given names of the alkenes. The names of the alkenes…

Q: I. Write the IUPAC name of each organic compound. Structure Ç1 NH2-C-CH-C-СН 2-О-СH2-СНЗ 1.…

A: We are authorized to answer three subparts at a time, since you have not mentioned which part you…

Q: Write the IUPAC name for the compound shown. CH3 H;C CH3

A: Given compound: We have to write the IUPAC name of this compound.

Q: The following structures represent all stereoisomers for the: * CH3 CH3 CH3 Br Br Br - Br Br Br H-…

A: We are to check that for which acompound the given structures are stereoisomers, i.e. we are to givw…

Q: Identify the alkene from the following four molecules. HyC. CH HgC. CHa CH CH CH3 1. 2.

A: Alkenes are unsaturated hydrocarbons. They consist of at least of a single double bond.

Q: 7. Give the proper IUPAC name for the following compounds: CH;-CH -CH - CH, CH, Br CH Br H2- CH, CH…

A: IUPAC NOMENCLATURE based on following rule. Secondary prefix + primary prefix + word root + primary…

Q: Provide the IUPAC name the compound CH3(CH2)4-C=C-CH2CH=CH(CH2)7CH3. Parent name: Locants: IUPAC…

A: Given:-   •According to IUPAC rule we have to start the numbering from that side from where we get…

Q: Give systematic (IUPAC) name for each compound. H₂C-Cl IUPAC name: CH3 HỌC-CH-CH-CH-CH–CH, CI IUPAC…

A: The give compounds are:Determine the systematic IUPAC name of these compounds. assigned a specific…

Q: Which compound has the longest carbon-carbon bond(s)? O CH3CH3 O CH2=CH2 O HCCH CH3CH2CH3 O All…

A: BondBond OrderBond LengthC―C11.54 A0C=C21.34 A0C≡C31.20 A0

Q: Is cl-c-o-ch3 an alkyl? (Can a alkyl have a oxygen in it)

A:

Q: CH₂Cl www

A: In this question, we will see the reaction mechanism for this transportation.  You can see the…

Q: The angle of the -C-C-H bond. Br H. C=C CI F 109.5 120° 180° 90° This bicyclic alkanes share only…

A:

Q: Which structure below represents 4-methylpent-2-ene? a. CH3-CH2-CH2-CH2-C=CH2 O b. CH3-CH2-C=CH-CH3…

A:

Q: # of C's 1 2 3 Alkyl substituent structure CHA -CH3 CH3CH3 -CH₂CH3 CH3CH₂CH3 propane -CH₂CH₂CH3…

A: No. of carbon atoms   Word root 1meth2 eth3 prop4but5pent6hex7hept8octNomenclature of alkane : word…

Q: carboxylic acid

A: There is no carboxylic acid group. That's  -COOH group .

Q: In what functional groupings are the structures composed? 11 CH₂-CEC-CH₂OH на CH=CH2 A) A ketone and…

A: Since you have asked multiple question, we will solve the first question for you.If you want any…

Q: Name each compound. CH; CH, CH, · CH3-CH-CH-CH-CEC-H CH3

A: The given compound is,

Q: k. H2C=CH- -C- CH3 NABH4

A: The given reaction is reduction reaction in which carbonyl group will convert into alchols.

Q: 2. CH3-CH₂-CH-CH3 | I-C-CH3 CH3

A: Basic rules for IUPAC nomenclature:1) Select longest chain or block of carbon atoms as parent. 2)…

Q: CH3 CH;-C=C-CH,-CH-CH; What is the correct IUPAC name for the compound above? O 1-isopropyl-2-butyne…

A: We have structure of an organic compound , we have to predict the correct IUPAC nomenclature of…

Q: Give the IUPAC name for the following compound: CH,CH,CHỊCH,CH CH3 H H₂CH₂C CH3 X H 3 S

A: The objective of the question is to find the IUPAC (International Union of Pure and Applied…

Q: What is the name of the following compound? H₂C H H CH3 CH CH3 CH3…

A: We have to predict the name of the given structure.

Q: H₂C₂ CH3 CH3 CH₂ + H₂C CHCCH3 EN heat heat

A: Product of following reaction can be made by applying appropriate reaction mechanism.

Q: Which one of the following alkyl groups is the ethyl group? CH3 CH3- CH3CH,- CH3CH,CH,- CH3-C- CH3…

A: In this question, we have to choose the option which is ethyl group.

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.