Which of the following ions could exist as either a low-spin or a high-spinoctahedral complex depending on the crystal field splitting of the ligands?A) Mn2*B) Ni2*C) Sc*D) Cu2+E) Zn*

Answered: Image /qna-images/answer/479d90c2-241d-4fb5-8364-6ab4bb6b05b6.jpg

Answered: Which of the following ions could exist…

Which of the following ions could exist as either a low-spin or a high-sp octahedral complex depending on the crystal field splitting of the ligand A) Mn2* B) Ni2* C) Sc* D) Cu2+ E) Zn?*

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter19: Complex Ions

Section: Chapter Questions

Problem 41QAP: Give the number of unpaired electrons in octahedral complexes with strong-field ligands for (a) Rh3+...

See similar textbooks

Related questions

Q: What is the product when [PtL4]2+ reacts with 2 Y ligands? L has weaker trans effec strength than Y.…

A: Solution: Given a complex [PtL4]2+ reacts with 2 Y ligands. The trans effect of L is weaker than…

Q: Using ligand-metal interaction concepts (such as sigma type, pi donor and pi acceptor) explain which…

A: Crystal field splitting energy of halide complexes depend on extent of pi donar capacity of ligand…

Q: 13. A complex ion has been observed which starts with a violet color with six aqua ligands attached.…

Q: Which of the following complexes would exhibit cis- and trans- geometric isomers?

A: Cis and Trans isomerism in an octahedral complex is possible if the complex has a general formula of…

Q: Identify the ligands in the following complex ions. [AlCl4] - [Cu (NH3)4]2+ [Fe EDTA ]3+ 1 How…

Q: crystal-field splitting energy, A, in kJ/mol.

A: please check the attached file for the d1 system crystal field splitting energy calculation.

Q: A d¹ octahedral complex is found to absorb visible light, with the absorption maximum occurring at…

A: The splitting of degenerate level in the presence of ligand is known as crystal field splitting. The…

Q: A complex ion has been observed which starts with a violet color with six aqua ligands attached. It…

A: In transition metal complexes the d orbital of the central metal ion gets split into two sets of…

Q: 3+ When a certain strong-field ligand forms an octahedral complex with Mn³ cation, the energies of…

A: ll

Q: Crystal field splitting energy of the complex [CoBr (en), Cl, is A) 4 B) 5 - - 6. C) -A. 5 3 D) -2A,

A: Crystal field splitting in octahedral complex is into t2g and eg t2g have 3 orbitals and eg have 2…

Q: CN- ion is a strong field ligand whereas Clis usually a weak field ligand. Draw d orbital energy…

Q: 4. In transition metal complexes, ligands largely interact with metal center via lone pairs:…

A: Ethylenediamine intract metal with two lone pairs. Cl- Co and CN are monodentate ligand.

Q: Which of the following octahedral complex transition metal ions would have the same magnetic moment…

A: Given : ions

Q: octahedral complex is found to absorb visible light, with the absorption maximum occurring at 507…

A: The absorption with maximum wavelength by an electron is equal to the energy difference between…

Q: 1. In coordination compound [Cr(en)2Cla]Cl the ligands the the coordination number is the donor…

A: In the coordination compound [Cr(en)2Cl2]Cl , the central metal atom is Cr and the ligands are…

Q: When a certain strong-field ligand forms a tetrahedral complex with Cd²+ cation, the energies of the…

A: Given ,Strong field ligand : Cd2+ Objective :Determine if the ligand is…

Q: A d' octahedral complex is found to absorb visible light, with the absorption maximum occurring at…

Q: Na2[Fe(CN)4(en)] The complex ion of this compound is known to be diamagnetic. Draw the d-orbital…

Q: Q3. Calculate the crystal field stabilization energy (in terms of Da) for the complexes:…

A: Applying formula of CFSE =[ x×-0.4+y×0.6]∆° + ZP Where X is no of electrons in t2g Y is no of…

Q: a) Naz[Fe(CN)4(en)] b) The complex ion of this compound is known to be diamagnetic. Draw the…

A: Since CN- is a strong field ligand, it forms low spin complex and has large crystal field splitting.…

Q: <p>Draw a crystal field splitting diagram for a trigonal bipyramidal complex ion. Assume the…

A: In the trigonal bipyramidal geometry, the triangle remains in the xy plane while the two pyramids…

Q: The complex ion [CrCl6³ has a Xmax=735 nm. Calculate the crystal field splitting energy (in kJ/mol)…

A: The given complex CrCl63- is an octahedral complex which have splitted d orbitals on metal in…

Q: When a certain weak-field ligand forms a tetrahedral complex with Cocation, the energies of the…

A: A tetrahedral complex is created when a ligand binds to a cation Co2+The complex configuration of…

Q: Consider the metal complexes shown below. Identify if the complex is high-spin or low-spin. low-spin…

Q: (↑) In the complex ion, [ML6], M* has six d electrons and L is a weak field ligand. According to…

A: The question is asking for the number of unpaired electrons in a complex ion [ML6] where M has six d…

Q: 21) Which of the following metal ions can show both high-spin and low-spin configurations in…

A: We are given the following 4 metal ions, in +2 oxidation state. Zn2+ V2+ Cu2+ Co2+

Q: abilization Energy for the following complexes and classify the complexes as diamagnetic vs…

A: Crystal field stabilization energy (cfse) is the energy of splitting of d- orbital of a metal center…

Q: When a certain strong-field ligand forms an octahedral complex with Mn* cation, the energies of the…

A: Electronic configuration of Mn = [Ar] 3d5 4s2 Electronic configuration of Mn3+ = [Ar] 3d4 Under…

Q: a) Provide the name of the coordination complex Na[COCI,(NH3),] b) Calculate the orbital…

Q: 3) A transition metal complex ion with octahedral geometry has a value of 4.4 x 10*J for the crystal…

A: E= energy h= planks constant = 6.626 X10-34 J.s. c= 3.0 X 108 ms-1. λ=Wave length. E=hcλ

Q: The complex (Fe(H,O)]* is paramagnetic. Is the H,0 ligand inducing a strong or weak field?

A: The coordination complex is the compound that does not lose its identity in the solution. The…

Q: When a certain strong-field ligand forms a tetrahedral complex with Zn“' cation, the energies of the…

Q: Which of the following ions could exist as either a low-spin or a high-spin octahedral complex…

A: High spin complexes are formed with weak field ligands and low spin complexes are formed with strong…

Q: Given the coordination compound Na4[Fe(ONO)2(ox)2]. - What is the type of hybridization of the…

A: Coordination Chemistry is branch of chemistry in which we deal with coordination compounds. In these…

Q: The three complex ions [Mn(CN),]³-, [Mn(CN),J*¯, and [Mn(CN),]³- have all been synthesized and all…

A: All three complexes has cyanide ligand, CN- which is a strong field ligand , thus all complexes are…

Q: Which of the following complexes would exhibit cis- and trans- geometric isomers? A) [Ni(phen)]²+ B)…

A: Cis and Trans isomerism in an octahedral complex is possible if the complex has a general formula of…

Concept explainers

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.

Question

100%

Which of the following ions could exist as either a low-spin or a high-spin
octahedral complex depending on the crystal field splitting of the ligands?
A) Mn2*
B) Ni2*
C) Sc*
D) Cu2+
E) Zn*

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
Sketch and explain the most likely crystal field diagram for the following complex ion: Note: The CN ligand produces a much stronger crystal field than NH3. Assume the NH3 ligands lie on the z axis.
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
Give the number of unpaired electrons in octahedral complexes with strong-field ligands for (a) Rh3+ (b) Mn3+ (c) Ag+ (d) Pt4+ (e) Au3+
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
What is the coordination number of the central metal atom in the following complexes? (a) [Fe(H2O)63+] (b) [Pt(NH3)Br3] (c) [V(en)Cl42] (d) [Au(CN)2+]
For each d electron configuration, state the number of unpaired electrons expected in octahedral complexes. Give an example complex for each case. (Two answers are possible for some of these cases.) (a) d2 (b) d4 (c) d6 (d) d8
Consider the pseudo-octahedral complex ion of Cr3+, where A and B represent ligands. Ligand A produces a stronger crystal field than ligand B. Draw an appropriate crystal field diagram for this complex ion (assume the A ligands are on the z-axis).