Which of the following definitions correlate to the term spontaneous change? O Possible configuration or arrangement of matter and energy within a system O Process that takes place without a continuous input of energy from an external source O Change in entropy for a reaction calculated using the standard entropies O Process that requires continual input of energy from an external source

Which of the following definitions correlate to the term spontaneous change? O Possible configuration or arrangement of matter and energy within a system O Process that takes place without a continuous input of energy from an external source O Change in entropy for a reaction calculated using the standard entropies O Process that requires continual input of energy from an external source

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter10: Entropy And The Second Law Of Thermodynamics

Section: Chapter Questions

Problem 10.62PAE: Recall that incomplete combustion of fossil fuels occurs when too little oxygen is present and...

See similar textbooks

Similar questions

The statement Energycan beneithercreatednor destroyedis sometimes used as an equivalent statement of the first law of thermodynamics. There areinaccuracies to the statement, however. Restate it tomake it less inaccurate.
When a rocket is launched, the burning gases are the source of the motion. If the system is the rocket (including fuel), what is the sign of the work?
9.20 State the first law of thermodynamics briefly in your own words.
Explain in your own words what is meant by the term entropy. Explain how both matter spread and energy spread are related to the concept of entropy.
For each process, tell whether the entropy change of the system is positive or negative. Water vapor (the system) deposits as ice crystals on a cold windowpane. A can of carbonated beverage loses its fizz. (Consider the beverage but not the can as the system. What happens to the entropy of the dissolved gas?) A glassblower heats glass (the system) to its softening temperature.
Coal is used as a fuel in some electric-generating plants. Coal is a complex material, but for simplicity we may consider it to be a form of carbon. The energy that can be derived from a fuel is sometimes compared with the enthalpy of the combustion reaction: C(s)+O2(g)CO2(g) Calculate the standard enthalpy change for this reaction at 25C. Actually, only a fraction of the heat from this reaction is available to produce electric energy. In electric generating plants, this reaction is used to generate heat for a steam engine, which turns the generator. Basically the steam engine is a type of heat engine in which steam enters the engine at high temperature (Th), work is done, and the steam then exits at a lower temperature (Tl). The maximum fraction, f, of heat available to produce useful energy depends on the difference between these temperatures (expressed in kelvins), f = (Th Tl)/Th. What is the maximum heat energy available for useful work from the combustion of 1.00 mol of C(s) to CO2(g)? (Assume the value of H calculated at 25C for the heat obtained in the generator.) It is possible to consider more efficient ways to obtain useful energy from a fuel. For example, methane can be burned in a fuel cell to generate electricity directly. The maximum useful energy obtained in these cases is the maximum work, which equals the free-energy change. Calculate the standard free-energy change for the combustion of 1.00 mol of C(s) to CO2(g). Compare this value with the maximum obtained with the heat engine described here.
One statement of the second law of thermodynamics is that heat cannot be turned completely into work. Another is that the entropy of the universe always increases. How are these two statements related?
The overall reaction that occurs when sugar is metabolized is C12H22O11(s)+12O2(g)12CO2(g)+11H2O(l) For this reaction, H° is -5650 kJ and G° is -5790 kJ at 25°C. (a) If 25% of the free energy change is actually converted to useful work, how many kilojoules of work are obtained when one gram of sugar is metabolized at body temperature, 37°C? (b) How many grams of sugar would a 120-lb woman have to eat to get the energy to climb the Jungfrau in the Alps, which is 4158 m high? ( w=9.79103mh, where w= work in kilojoules, m is body mass in kilograms, and h is height in meters.)
The reaction SO3(g)+H2O(l)H2SO4(aq) is the last step in the commercial production of sulfuric acid. The enthalpy change for this reaction is 227 kJ. In designing a sulfuric acid plant, is it necessary to provide for heating or cooling of the reaction mixture? Explain.
Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
Explain why the statement No process is 100 efficient is not the best statement of the second law of thermodynamics.
9.17 If a machine does 4.8103kJ of work after an input of 7.31104kJ of heat, what is the change in internal energy for the machine?