Answered: Which model(s) accounts for the…

Which model(s) accounts for the magnetism and color of coordination compounds? I. Lewis model II. localized electron model III. crystal field model O I II II O I, II none accounts for both phenomena

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 6Q: Four different octahedral chromium coordination compounds exist that all have the same oxidation...

See similar textbooks

Related questions

Q: A complex with the composition [MA₂B₂]X₂ is found to have no geometrical isomers. Both A and B are…

A: Given -> Complex -> [MA2B2]X2

Q: What is the product when [PtL4]2+ reacts with 2 Y ligands? L has weaker trans effec strength than Y.…

A: Solution: Given a complex [PtL4]2+ reacts with 2 Y ligands. The trans effect of L is weaker than…

Q: The compound formula is [Al(OH)&]Clh 1. Indicate central ion and its oxidation number. 2. Write down…

A: Coordination compounds: The compounds having coordination covalent bonds which form when metal ions…

Q: Consider an octahedral complex where strong field ligands are bound to a central metal having a d…

Q: The basic term for the [Cu(H2O)6]2+ octahedral ion is 2T2g > 2Eg, will be the same as the term for…

A: Since you have asked multiple questions, we will answer only first question for you. In order to get…

Q: The crystal field splitting energy of a complex is 3.53 x 10-19 J. What wavelength of light does…

A: Given: Energy = 3.53 × 10-19 J

Q: All the following statements are correct EXCEPT: a. The pattern of d orbital splitting is…

A: In coordination chemistry, central metal ion is bonded to ligand. Ligand donate electrons to central…

Q: >Which complex ion geometry has the potential to exhibit cis–trans isomerism: linear,…

A: The complex having linear geometry (MAB) or tetrahedral geometry (MA2B2) cannot show cis-trans…

Q: K2[Cu(CN)2Cl2] a.Systematic name b.The coordination number c.The correct hybridization for the…

Q: 11. The complex ion [Ti(H2O)«]³* is violet in solution. Calculate the crystal field splitting energy…

A: Given, the complex ion [Ti(H2O)6]3+ is violet in solution.we are asked to calculate the crystal…

Q: In the visible region of the spectrum, the trans-[Co(NH3)4Cl2] ion + shows a band at 15,000 cm-1.…

A: This question is related to Crystal field theory which explains the breaking of degeneracies of…

Q: <p>Many transition metal compounds are colored. How does crystal field theory account for…

A: The color of transition metal compounds is due to the absorbance of visible light. According to the…

Q: How many unpaired electrons are there in a strong field iron(II) octahedral complex? 0 1 2 3

A: Since you have asked multiple type questions, we will solve only first questions for you. If you…

Q: Ligands X, Y, and Z form octahedral complexes with Cu2* ion resulting to yellow, orange, and red…

A: ✓Following is the increasing order of ligand field strength Z<Y<X So the correct answer is (C)…

Q: <p>Draw a crystal field splitting diagram for a trigonal planar complex ion. Assume the plane…

A: The d orbital electrons of a transition metal split into high and low energy levels in ligand field.…

Q: Apply the concept of crystal-field theory to explain some of the interesting spectral and magnetic…

A: The Crystal Field Theory (CFT) is a theory for the bonding interaction between transition metals and…

Q: When a certain strong-field ligand forms a tetrahedral complex with Cd²+ cation, the energies of the…

A: Given ,Strong field ligand : Cd2+ Objective :Determine if the ligand is…

Q: The maximum absorption for a complex ion occurs at 620 nm. Calculate the crystal field splitting in…

A: Applying formula E= NAhc/lemda

Q: what is a coordination complex and provide two examples of such complexes

A: we have to define a coordination complex and write 2 examples

Q: <p>Draw a crystal field splitting diagram for a trigonal bipyramidal complex ion. Assume the…

A: In the trigonal bipyramidal geometry, the triangle remains in the xy plane while the two pyramids…

Q: The complex ion [CrCl6³ has a Xmax=735 nm. Calculate the crystal field splitting energy (in kJ/mol)…

A: The given complex CrCl63- is an octahedral complex which have splitted d orbitals on metal in…

Q: When a certain weak-field ligand forms a tetrahedral complex with Cocation, the energies of the…

A: A tetrahedral complex is created when a ligand binds to a cation Co2+The complex configuration of…

Q: Which cation is expected to give the greatest k value in an octahedral complex? * Fe2+ Ru2+ Os2+ O…

Q: (↑) In the complex ion, [ML6], M* has six d electrons and L is a weak field ligand. According to…

A: The question is asking for the number of unpaired electrons in a complex ion [ML6] where M has six d…

Q: The crystal field splitting energy for complex X is 3.34 x 10-19 J and complex Y is 3.78 x 10-19 J.…

A: To solve this problem, we will use the equation :-…

Q: Explain the difference between coordination isomers and ionization isomers. Provide an example of…

Q: Give an example of coordination isomerism.

A: Coordination isomerism In this isomerism, if the coordination compound contain cation as well as…

Q: When a certain strong-field ligand forms an octahedral complex with Mn* cation, the energies of the…

A: Electronic configuration of Mn = [Ar] 3d5 4s2 Electronic configuration of Mn3+ = [Ar] 3d4 Under…

Q: Define give an example of coordination compound.

A: Metal ions act as Lewis acids and thus, they are able to accept the electrons. Ligands act as the…

Q: K2[Cu(CN)2Cl2] a. Systematic name or formula b. The coordination number c. The possible geometry…

A: As per our guidelines, I can answer only first three sub-parts. Because you have posted multiple…

Q: Coordination complexes

A: In this question we have to explain that the following statement is true or false, coordination…

Q: Consider the coordination compound [FeCl2(NH3)4][FeBr4]. The geometry of the complex cation is…

Q: 29. A transition metal complex ion with octahedral geometry has a value of 4.4 x 10–19 J for the…

A: The relationship between wavelength and energy is -

Q: When a certain strong-field ligand forms a tetrahedral complex with Zn“' cation, the energies of the…

Q: Consider the coordination compound, K2[Cu(CN)4]. Between which species a coordinate covalent bond…

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

100%

Which model(s) accounts for the magnetism and color of coordination compounds?
I. Lewis model
II. localized electron model
III. crystal field model
O I
II
II
O I, II
none accounts for both phenomena

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1 Theory

VIEW

Step 2 The answer

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Give the coordination number for each metal ion in the following compounds: (a) [Co(CO3)3]3- (note that CO32- is bidentate in this complex). (b) [Cu(NH3)4]2+. (c) [Co(NH3)4Br2]2(SO4)3. (d) [Pt(NH3)4][PtCl4]. (e) [Cr(en)3](NO3)3. (f) [Pd(NH3)2Br2] (square planar). (g) K3[Cu(Cl)5]. (h) [Zn(NH3)2Cl2]
A certain coordination compound has the simplest formula PtN2H6Cl2. It has a molar mass of about 600 g/mol and contains both a complex cation and a complex anion. What is its structure?
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
(a) Name this coordination compound: [Ag(NH3)2]NO3. (b) Write the formula of pentaaquaisothiocyanatoiron(III) chloride.
The transition metals form a class of compounds called metal carbonyls, an example of which is the tetrahedral complex Ni(CO)4. Given the following thermodynamic data (at 298 K): (a) Calculate the equilibrium constant for the formation of Ni(CO)4(g) from nickel metal and CO gas. (b) Is the reaction of Ni(s) and CO(g) product- or reactant-favored at equilibrium? (c) Is the reaction more or less product-favored at higher temperatures? How could this reaction be used in the purification of nickel metal?
has a crystal field splitting energy, o, of 2.60102 kJ/mol. What is the wavelength responsible for this energy?
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
The complex ion PdCl42is diamagnetic. Propose a structure for PdCl42.
Classify each ligand as monodentate, bidentate, and so on. (a) (CH3)3P (b) H2N(CH2)2NH(CH2)2NH2 (c) H2O