When NaHCO₃ completely decomposes, it can follow this balanced chemical equation:\[2\text{NaHCO}_3 \rightarrow \text{Na}_2\text{CO}_3 + \text{H}_2\text{CO}_3\]A. Determine the theoretical yields of each product using stoichiometry if the mass of the NaHCO₃ sample is 3.24 grams. (Show work for both)B. In an actual decomposition of NaHCO₃, the mass of one of the products was measured to be 2.01 grams. Identify which product this could be and justify your reasoning.C. Calculate the percent yield of the product identified in part B. (Show your work)

Answered: Image /qna-images/answer/b0023075-575c-459d-a5a0-07b5724b1ae5.jpgSolution is written above.

When NaHCO3 completely decomposes, it can follow this balanced chemical equation: 2NaHCO3 → Na₂CO3 + H₂CO3 A. Determine the theoretical yields of each product using stoichiometry if the mass of the NaHCO3 sample is 3.24 grams. (Show work for both) B. In an actual decomposition of NaHCO3, the mass of one of the products was measured to be 2.01 grams. Identify which product this could be and justify your reasoning. C. Calculate the percent yield of the product identified in part B. (Show your work)

When NaHCO3 completely decomposes, it can follow this balanced chemical equation: 2NaHCO3 → Na₂CO3 + H₂CO3 A. Determine the theoretical yields of each product using stoichiometry if the mass of the NaHCO3 sample is 3.24 grams. (Show work for both) B. In an actual decomposition of NaHCO3, the mass of one of the products was measured to be 2.01 grams. Identify which product this could be and justify your reasoning. C. Calculate the percent yield of the product identified in part B. (Show your work)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

2. Given: 1 P₁ +50₂ → 1 P40₁0 10 4 calculate a. The mass (in u) of P4 required to produce 2.66 x 10 23 molecules of product. b. The number of O₂ molecules required to react completely with 3.00 g P₁.
Balance/complete the following chemical equations, and identify the type of equation.a. KClO3 = KCl + O2b. Acetylene (C2H2) + oxygen = carbon dioxide + waterc. Fe + Cl2d. Barium chloride mixed with sodium sulfate
What type of chemical reaction
18-please fast The Hall process for the production of aluminum involves the reaction of aluminum oxide with elemental carbon to give aluminum metal and carbon monoxide. If the yield of this reaction is 82% and aluminum ore is 71% by mass aluminum oxide, what mass of aluminum ore must be mined in order to produce 1.0 × 103 kg (1 metric ton) of aluminum metal by the Hall process? Select one: a. 1.6 × 103 kg b. 2.2 × 103 kg c. 1.8 × 103 kg d. 1.1 × 103 kg e. 3.3 × 103 kg
Directions: Balance the following chemical equations:1. SiCl4 + H2O → SiO2 + HCl2. Au2S3 + H2 → Au + H2S3. Al + O2 → Al2O34. Ca3(PO4)3 + H2SO4 → CaSO4 + Ca(H2PO4)25. HClO4 + P4O10 → H3PO4 + Cl2O76. FeS + O2 → FeO3 + SO27. PCl5 + H2O → H3PO4 + HCl8. C2H6O + O2 → CO2 + H2O9. C4H10O + O2 → CO2 + H2O10. Fe + O2 → Fe2O3
How many grams of H2O are produced if 43.2 g of O2 are consumed in the following reaction? C3H8 + 5 O2 → 4 H2O + 3 CO2 a.)19.5 g b.)24.3 g c.)43.2 g d.)216. g
Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield
In the following reaction, oxygen is the excess reactant.SiCl4 + O2 → SiO2 + Cl2The table shows an experimental record for the above reaction. Experimental Record Trial Starting Amount of SiCl4 Starting Amount of O2 Actual Yield of SiO2 1 150 g 200 g 49.2 g 2 75 g 50 g 25.2 g Calculate the percentage yield for SiO2 for Trial 1. Also, determine the leftover reactant for the trial. Show your work. Based on the percentage yield in Trial 2, explain what ratio of reactants is more efficient for the given reaction. Source StylesNormal
3. Given: NaCl 1 NiCl₂ + 2 NaOH → 1 Ni(OH)₂ + 2 A student combines 2.44 g of NiCl₂ with 6.44 g NaOH. Determine a. The limiting reactant. b. The mass of the excess reactant that remains at the end of the reaction. c. The number of NaCl molecules that are formed if the reaction is 51% efficient.
A student heats a 2.8695g sample of a mixture that contains an unknown amount of potassium chlorate (KClO3). The KClO3in the mixture decomposes and releases its oxygen. The mass of the remaining sample residue was 2.0427g. KClO3(s) →KCl (s) + 3 O (g) a.How many grams of oxygen were in the KClO3sample? b.How many moles of oxygen atoms is this? c.How many moles of KClO3were in the original sample? d.How many grams of KClO3were in the original sample? e.What is the % of KClO3in the original sample?
When hydrogen sulfide gas is bubbled into a solution of NaOH, the reaction forms sodium sulfide and water according to the following unbalanced reaction. H₂S + 2NaOH → Na₂S + H₂O How many grams of sodium sulfide are formed if 2.75 g of hydrogen sulfide is bubbled into a solution containing 2.75 g of sodium hydroxide. (Atomic weights: Na 23.0, O 16.0, H 1.0, S 32.0)
Given the following decomposition reaction: 4C3H5O9N3 → O2 + 12CO2 + 10H2O +6N2. a. If 28.40 g H2O were produced, what mass of CO2 will be produced? b. If 110.5 g of C3H5O9N3 were decomposed and the yield of the reaction is 72.3%, determine the theoretical yield and actual yield.