### Experiment: Precipitation Reaction**Objective:** Determine the precipitate formed when mixing solutions of barium nitrate and ammonium sulfamate.**Materials:** - Barium nitrate, Ba(NO₃)₂- Ammonium sulfamate, NH₂SO₃H**Procedure:**1. A solution containing 1.4 g of Ba(NO₃)₂ and 2.4 g of NH₂SO₃H is boiled.2. Observe the formation of a precipitate.**Analysis:** - The precipitate may be one of the following compounds: - Ba(NH₂SO₃)₂ - BaSO₄ - Ba(NH₂)₂**Calculation:** a. **Calculate the number of moles of each reactant:** - Use the molar masses of Ba(NO₃)₂ and NH₂SO₃H to convert grams to moles.*Note: Detailed equations and molar mass calculations can be referenced from general chemistry resources.***Conclusion:** Determining the identity of the precipitate through balanced equations helps understand reaction outcomes.---This guide should assist in conducting the experiment and understanding the reactions involved. ### Experiment Instructions**b.** Determine the limiting reactant in each of the following three reactions. The limiting reactant that you determine here will be used directly in this experiment.- **Reaction producing Ba(NH2SO3)2:** - **Reaction producing BaSO4:**- **Reaction producing Ba(NH2)2:****c.** What conclusion can you reach about the limiting reactant in this experiment?

Above problem is based on stoichiometry ( limiting reagent)

When a solution containing 1.4 g of Ba(NO3)2 and 2.4 g of NH,SO3H is boiled, a precipitate forms. This precipitate may be Ba(NH,SO3)2, BaSO4, or Ba(NH2)2. You can find these products in the reactions whose equations you balanced in the first question. 2. a. Calculate the number of moles of each reactant.

When a solution containing 1.4 g of Ba(NO3)2 and 2.4 g of NH,SO3H is boiled, a precipitate forms. This precipitate may be Ba(NH,SO3)2, BaSO4, or Ba(NH2)2. You can find these products in the reactions whose equations you balanced in the first question. 2. a. Calculate the number of moles of each reactant.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: special sample of household vinegar contained 7.3% acidity. Determine the number of moles of acetic…

A: %mass of Aceticacid = 7.3 % Mass of sample = 242 g Mass of Acetic acid= 242 × 7.3/100 = 17.7 g

Q: What is the molarity of each ion present in aqueous solutions prepared by dissolving 19.83 g of the…

A: Molarity = moles of solute /volume of solution (in litre)Given - Mass of compound = 19.83 gVolume of…

Q: MISSED THIS? Watch KCV: Limiting Reactant, Theoretical Yield, and Percent Yield, IWE: Limiting…

A: Answer: These questions are based on the concept of limiting reagent. The reactant which exhaust…

Q: Consider the generic chemical equation: 2 A + 4 B --------> 3 C. 1. What type of reaction the…

A: 1. This reaction represent combination reaction as we can see A and B combine to give C.…

Q: Consider the following unbalanced equation - ____Al4C3 + ____ H2O ----------> _____ Al(OH)3…

A: Given unbalanced equation, Moles of CH4 formed is 0.574.

Q: Balance the following chemical reactions: _____ CaCl2 + _____ AgNO3 → _____ Ca(NO3)2 + _____ AgCl…

A: Balancing of chemical reactions.

Q: d. solid magnesium and diatomic nitrogen gas react to form solid magnesium nitride e. sulfuric acid…

Q: The following equation is not balanced: CaSO4+AlCl3→CaCl2+Al2(SO4) Notice that "SO4" appears in…

A: A balanced equation is one where the number of atoms of each element on either side are same If the…

Q: Find the limiting reactant for each initial amount of reactants. 2 Na(s) + Br2(g) → 2 NaBr(s) a. 2…

A: Since you have posted questions with multiple subparts, we will solve the first three for you, for…

Q: A. Balancing Chemical Equations Write balanced equations for the following reactions, and make a…

A: In the given question ,three unbalance reaction is provided and we have to balance reaction at…

Q: 4. Ethanol is produced industrially by the acid catalyzed reaction of ethylene with water. The…

Q: 3. If 50.0 g of O2 are mixed with 50.0 g of H₂ according to the balanced reaction below, what mass…

A: A question based on mole concept. A balanced equation for the formation of water from H2 gas and O2…

Q: Consider the following balanced reaction: Pb(s) + 2 Cl;(g) → P6CI,(s) Starting with 30.0g of Cl2 and…

A: Consider the following balanced reaction: Pb(s) + 2Cl2(g) → PbCl4(s) The mass of Cl2 given = 30.0 g…

Q: A 0.2356 g sample containing only NaCl and BaCl₂ yielded 0.4637 g of dried AgCl. Calculate the…

A: Given data:The amount of sample containing NaCl+ BaCl2 = 0.2356 gThe amount of AgCl (obtained)=…

Q: For the equation below, if you start with 310 ml of NaCl (2.16 g/ml), how many molecules of PBr3 do…

A: Given: The volume of NaCl is 310 mL. The concentration NaCl solution is 2.16 g/mL. Introduction:…

Q: 3. A log burns in a fireplace, warming the room. Is this an exothermic or an endothermic reaction?…

A: When a log is burning in presence of oxygen, it evolves heat. Acid base reaction where one axid…

Q: . Consider the following reaction: Al₂(SO4), + Na,PO4 → Na₂SO4 + AlPO4 If 2 moles of aluminum…

Q: Classify each chemical compound: compound type of compound Ca(CN)2 ___ ionic ___molecular…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: 12. Iron metal can be obtained from iron(III) oxide by reaction with carbon monoxide at elevated…

Q: Calculate the molarity of each of these solutions.

A: Step : 1 Calculate the molarity of each of these solutions.

Q: For the sentence below answer the following questions: Q1) Change the sentence into a chemical…

A: In a chemical reaction there reactant and product both must be present. Each chemical reaction…

Q: Balance the equation for the combustion of butane, C,H,. C.H10 + CO. + H,O a. If 31.4 grams of…

A: According to the Law of conservation of mass " all atoms of different elements must be equal on both…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

### Experiment: Precipitation Reaction

**Objective:** Determine the precipitate formed when mixing solutions of barium nitrate and ammonium sulfamate.

**Materials:**
- Barium nitrate, Ba(NO₃)₂
- Ammonium sulfamate, NH₂SO₃H

**Procedure:**
1. A solution containing 1.4 g of Ba(NO₃)₂ and 2.4 g of NH₂SO₃H is boiled.
2. Observe the formation of a precipitate.

**Analysis:**
- The precipitate may be one of the following compounds:
- Ba(NH₂SO₃)₂
- BaSO₄
- Ba(NH₂)₂

**Calculation:**
a. **Calculate the number of moles of each reactant:**
- Use the molar masses of Ba(NO₃)₂ and NH₂SO₃H to convert grams to moles.

*Note: Detailed equations and molar mass calculations can be referenced from general chemistry resources.*

**Conclusion:**
Determining the identity of the precipitate through balanced equations helps understand reaction outcomes.

---

This guide should assist in conducting the experiment and understanding the reactions involved.

### Experiment Instructions

**b.** Determine the limiting reactant in each of the following three reactions. The limiting reactant that you determine here will be used directly in this experiment.

- **Reaction producing Ba(NH<sub>2</sub>SO<sub>3</sub>)<sub>2</sub>:**

- **Reaction producing BaSO<sub>4</sub>:**

- **Reaction producing Ba(NH<sub>2</sub>)<sub>2</sub>:**

**c.** What conclusion can you reach about the limiting reactant in this experiment?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

A. Write the balanced reaction for the double displacement reaction between lead (II) nitrate and potassium iodide. B. If you have 10.00 g of lead (II) nitrate and 8.00 g of potassium iodide, how much lead (II) iodide will be produced? C. How many grams of the excess reactant will be left over?
If a reaction is run that is supposed to produce 125 g (theoretical yield) of product and the actual yield of product that was produced was 73.5 g, what is the percent of yield of this reaction? A. 170% B. 1.70% C. 73.5% D. 58.8%
Consider the generic chemical equation: 2 A + 4 B = 3 C What is the limiting reactant when each of the initial quantities of A and B are allowed to react? 1.) 2 mol A; 5 mol B 2.) 3 mol A; 4 mol B
CHAPTER 8 - SOLUTIONS Previous Page 18 of 35 Next O If 8.50 g Ca(NO3)2 is dissolved in enough water to make 0.750 L of solution, what is the molar concentration of Ca(NO3)2?
Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield
If 0.503 mol of zinc reacts with excess lead (IV) sulfate, how many grams of zinc sulfate will be produced in the reaction?
Could someone please Help! No plagiarism Please! 1. Consider the following reaction: 2H₂O (l) → 2H₂ (g) + O₂ (g) Which of the following statements is/are true for this reaction? A. This is a synthesis reaction. B. This is a decomposition reaction. C. This is a combustion reaction. D.None of the above 2. The reaction below shows the equation for the combustion of methane gas. How does the chemical equation demonstrate the Law of Conservation of Matter? A. There is one CH₄ molecule on the reactant side and one CO₂ molecule on the product side of the reaction. B. There are two O₂ molecules on the reactant side and two H₂O molecules on the product side in the reaction. C. There are four oxygen atoms, four hydrogen atoms and one carbon atom on both the reactant and product side of the reaction. D. The reaction does not satisfy the Law of Conservation of Matter. 3. Chemists use the activity…
Classify each equation as either decomposition, combination, or combustion.
Answer both subparts of question no. 9 in handwritten!
Sodium and chlorine react to form sodium chloride: What is the theoretical yield of sodium chloride for the reaction of 32.0 g Na with 107.2 g Cl2? A. 1.40 x 104 g NaCl B. 35.4 g NaCl C. 122 g NaCl D. 81.2 g NaCl
If 50 g of Iron(III) chloride react with 25 g of sodium hydroxide what is the maximum mass of Iron(III) hydroxide produced? FeCl3 + 3NaOH --> Fe(OH)3 + 3NaCl a. 0.208 grams b. 0.308 gramd c. 22.3 grams d 32.9 grams