12:43l LTEQuestion 21 of 55SubmitWhat quantity of moles of H2SO, are required tocompletely react with 7.20mol of Al according to thebalanced chemical reaction:2Al(s) +H2SO.(aq) → Al2(SO.)a(aq) +3H2(g)STARTING AMOUNTADD FACTORANSWERRESET*( )2.4098.0810.8mol H2SO46.022 x 102326.983.60mol Al2.89 x 102421.62.027.20342.1426.50 x 102431Tap here or pull up for additional resources

Given Number of moles of Al = 7.20 mol 2Al(s) + 3H2SO4(aq)--------> Al2(SO4)3(aq) +3H2(g)

Answered: What quantity of moles of H,SO. are…

What quantity of moles of H,SO. are required to completely react with 7.20 mol of Al according to the balanced chemical reaction: 2 Al(s) + 3 H2SO.(aq) → Al2(SO4):(aq) + 3 H2(g)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: O₂(g) + 2 H₂(g) → 2 H₂O(1) - Assume 0.250 mol O₂ and 0.810 mol H₂ are present initially. After the…

A: The stoichiometry of the balanced chemical reaction states that one mole of oxygen reacts with two…

Q: Nitric acid is often manufactured from the atmospheric gases nitrogen and oxygen, plus hydrogen…

A: Balanced chemical equation is the equation in which number of atoms on both side of equation are…

Q: The reaction for producing glucose in plants, called photosynthesis, is 6CO2+6H2O−→−−light…

A: 6CO2 +6H2O −→ light + C6H12O6 + 6O2 Number of moles of C6H12O6 produced = 7.01 mol

Q: Aluminum hydroxide reacts with sulfuric acid as follows:…

A: Given, the balanced chemical equation - 1) Now by using the given mole ratios, we will calculate…

Q: Nitric acid is often manufactured from the atmospheric gases nitrogen and oxygen, plus hydrogen…

A: Given two steps for the manufacturing of HNO3 is : Step.1 :- N2 (g) + 3H2 (g) --------> 2NH3 (g)…

Q: Metal hydrides react with water to form hydrogen gas and metal hydroxide. For example, SrH₂(s) +…

Q: Sodium metal reacts with water in the following single-displacement reaction: 2Na(s) + 2H2O(l) →…

A: Here we have to determine the limiting reactant and mass of H2 gas produced when 2.0 g of Na is…

Q: consider the reaction 4HCl(aq)+MnO2(s)--->MnCl2(aq) + 2H2O(l) +Cl2 (g) A sample of 48.9 g MnO2 is…

A: The balanced equation is 4HCl(aq)+MnO2(s)--->MnCl2(aq) + 2H2O(l) +Cl2 (g) Molecular weight of…

Q: If 4.50 g of HCI are reacted with 15.00 g of CaCO3, according to the following balanced chemical…

Q: Given the balanced equation, Na2SO4(aq) + BaCl2(aq) --> 2 NaCl(aq) + BaSO4(s), how many miles of…

A: Sodium chloride reacts with barium chloride from the precipitate of barium sulfate and the aqueous…

Q: When hydrochloric acid reacts with iron(III) oxide, water and iron(III) chloride are produced. The…

A: According to the balanced chemical reaction, one mole of iron(III) oxide reacts with 6 moles of…

Q: 5. Aluminum hydroxide reacts with sulfuric acid as follows: 2Al(OH)3(s) + 3H₂SO4(aq) → Al2(SO4)3(aq)…

A: a) 2Al(OH)3(s) + 3H2SO4(aq) → Al2(SO4)3(aq) + 6H2O(l) moles of Al(OH)3 react = 0.500 mol moles of…

Q: The combustion of gasoline produces carbon dioxide and water. Assume gasoline to be pure octane…

A: Combustion reaction of octane 2C8H18 + 25O2 → 16CO2 + 18H2O From this Balanced chemical equation we…

Q: Nitrogen and hydrogen combine at a high temperature, in the presence of a catalyst, to produce…

A: The objective of the question is to determine the amount of ammonia produced, the limiting reactant,…

Q: Determine the limiting reactant in this reaction. Calculate the amount in grams of CO2 from the…

A: Percent yield is the ratio of actual yield to the theoritical yield.

Q: Consider the reaction: C4H10(g)+O2(g)→CO2(g)+H2O(g)C4H10(g)+O2(g)→CO2(g)+H2O(g). Part A: How many…

Q: The reaction for photosynthesis, which occurs in plants, is used to convert carbon dioxide and water…

Q: Determine the theoretical yield of HCl

A: Number of moles = mass/molar mass Mass of HCl = moles of HCl × molar mass of HCl

Q: In one experiment, 12.0 g of PCl5 was slowly added to 15.0 g of H2O according to the following…

A: Limiting reagent of a reaction is the compound which is completely consumed during the reaction. The…

Q: Consider the combustion of methane. CH4(g)+2O2(g)→CO2(g)+2H2O(g) Suppose 2.5 mol of methane are…

A: Given:Moles of CH4 = 2.5 mol.Moles of O2 = 3.5 mol.

Q: A sample of 8.61 g8.61 g of liquid 1‑propanol, C3H8O,C3⁢H8O, is combusted with 64.6 g64.6 g of…

A: It's a multiple part question. Given information, Mass of 1-propanol = 8.61 g Mass of oxygen gas =…

Q: Reaction: 2NaOH(s)+CO2(g)→Na2CO3(s)+H2O(l) Which reagent is the limiting reactant when 2.62 mol…

A: Balanced chemical reaction: 2NaOH(s)+CO2(g) → Na2CO3(s)+H2O(l)Given:Number moles of NaOH =…

Q: Consider the following reaction. 2Fe2O3(s)+3C(s)−→−heat4Fe(s)+3CO2(g) Calculate the number of…

A: From balanced reaction two mole of iron oxide react with three mole of carbon

Q: HCl (aq) + NaOH (s) → NaCl (s) + H20 (l) In the…

A: The given chemical reaction is as follows: HCl(aq) + NaOH(s) → NaCl(s) + H2O(l) The given mass of…

Q: For the chemical reaction, 2NaOH+H2SO4⟶Na2SO4+2H2O2NaOH+H2SO4⟶Na2SO4+2H2O what mass of…

A: The reaction is : 2 NaOH + H2SO4 ==> Na2SO4 + 2 H2O Moles of water given = 4.87 mol Molar mass…

Q: an iron nail has a mass of 1.12 g, what mass of rust would form

A: Number of moles = mass / molar mass Number of moles of Fe = mass of Fe /55.845gmol-1

Q: The balanced chemical equation for the reaction between hydrochloric acid and oxygen is: 4 HCI (aq)…

Q: CH4(g) + 2 O2(g) -------> CO2(g) + 2 H2O(g) What mass of water is produced by the…

A: 1- First determine the moles of methane : moles of methane = ( mass / molar mass) moles of methane…

Q: For the chemical reaction 2NaOH+H2SO4⟶Na2SO4+2H2O, how many moles of sodium sulfate will be produced…

A: 1- First calculate the moles of NaOH : moles of NaOH = ( mass / molar mass of NaOH) moles of NaOH…

Q: Al4C3 (s) + 12 H2O (l) → 4 Al(OH)3 (s) + 3 CH4 (g) In this reaction, 0.3455 mol of…

Q: Nitrogen and hydrogen combine at a high temperature, in the presence of a catalyst, to produce…

A: Given balanced equation: N2(g)+3H2(g)⟶2NH3(g) The initial moles of N2 = 0.180 mol The initial moles…

Q: Nitrogen and hydrogen react to form ammonia according to the following balanced equation: N2(g) +…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Aspirin (C9H8O4) is synthesized by reacting salicyclic acid (C7H6O3) with acetic anhydride (C4H6O3).…

Q: In one experiment, 12.0 g of PCl5 was slowly added to 15.0 g of H2O according to the following…

A: ♣ Limiting reactants are those reactants that are consumed completely in a chemical reaction. They…

Q: Consider the balanced chemical equation: H2SO4(aq)+2KOH(aq)=2H2O(l)+K2SO4(aq) How many moles of the…

A: The given chemical equation is represented as follows:

Q: HCl (aq) + NaOH (s) → NaCl (s) + H20 (l) In the…

A: Given the mass of HCl taken = 2.5 g Molar mass of HCl = 36.458 g/mol Conversion factor: 1 mol HCl…

Q: a. For the following balanced chemical equation, calculate how many grams of the products would be…

Q: The reaction for producing glucose in plants, called photosynthesis, is…

A: Given, moles of C6H12O6 = 9.76 molThe reaction for producing glucose in plants is: 6 CO2 + 6 H2O →…

Q: nitrogen

A: We will use stoichiometry of the reaction to get the answer

Q: A sample of 49.0 g of tetraphosphorous decoxide (P,O10) reacts with 49.0 g of water to produce…

Q: Nitrogen and hydrogen combine at a high temperature, in the presence of a catalyst, to produce…

A: The considered reaction is expressed as, N2 (g) + 3 H2 (g) →2 NH3(g)

Q: The balanced chemical equation is 8 Al₂S₃(s) → 16 Al(s) + 3 S₈(s). How many moles of Al can be…

A: A balanced chemical equation contain equal number of atoms of each elements on both sides of the…

Q: What amount of O2 is needed to produce 4.23 mol of CO2 in the reaction CH4+2O2=CO2+2H2O 6.36…

A: Given CH4 + 2O2 →CO2 + 2H2O Moles of CO2 = 4.23 mol

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For the following balanced reaction, how many moles of NO are formed from 4.50 moles of NO2 if there is plenty of water present? NO2(g) + H2O(l) → 2 HNO3(aq) + NO(g)
For the chemical reaction 2NaOH+H2SO4⟶Na2SO4+2H2O how many moles of sodium sulfate (Na2SO4) are produced from 8.0 mol of sodium hydroxide (NaOH)?
When sulfuric acid reacts with calcium hydroxide, calcium sulfate andwater are produced. The balanced equation for this reaction is: H2S04(aq) + Ca(OH)2(s) CaSO4(s) + 2H2O(l) If 2 moles of calcium hydroxide react, The reaction consumes moles of sulfuric acid. The reaction produces moles of calcium sulfate and moles of water.
The combustion of methane is shown in the following reaction:CH4(g) + 2O2(g) → CO2(g) + 2H2O(l) A) If 15.0 moles of CO2(g) is produced, how many moles of methane are required? B) If 20.0 moles of O2(g) are consumed, how many moles of water are produced?
Aspirin (C9H8O4) is synthesized by reacting salicyclic acid (C7H6O3) with acetic anhydride (C4H6O3). The chemical equation is:C7H6O3 + C4H6O3  C9H8O4 + HC2H3O2a. If we react 100. g of acetic anhydride with 100. g of salicyclic acid, what mass of aspirin do we expect to produce? (theoretical yield)b. If the percent yield comes out to 84%, what mass of aspirin did the reaction actually produce? (what is the actual yield?)
How many moles of water are produced when 6.33 moles of CH4 react? CH4 (g) + 2O2 (g) --> CO2 (g) + 2H2O (g) (balanced)
Given the (fictional) balanced equation: 2 Q(s) + 5 G (g) → Q2G5 (s) And the following formula masses: Compound: Formula mass (g/mol) 1.00 G. 2.00 Q2G5 12.00 Determine how many moles of G are required to fully react with 43 moles of Q to produce Q2G5.
Given the following reaction: AgNO3 (aq)+ NaI (aq) → AgI (s) + NaNO3 (aq) How many grams of AgI will be produced from 16.2 g of AgNO3? AgNO3 = (169.87 g/mol) AgI = (234.77 g/mol)
For the chemical reaction, 2NaOH+H2SO4⟶Na2SO4+2H2O2NaOH+H2SO4⟶Na2SO4+2H2O what mass of sulfuric acid in grams is needed to produce 4.39 mol4.39 mol of water?
Consider the following chemical reaction: Al2O3 (s) + 6HCl(aq) ---------->2AlCl3(aq) + 3H2O(l) How moles of AlCl3 are produced if 1.20 g of hydrochloric acid reacts with aluminum oxide? HCl =36.45 g/mole
if 80g of ethanol (CH5OH) are burnt completely, how many molecules of water would be produced ? CH5OH(I)+2O2(g)=CO2(g)+3H2O(I)
2hcl(aq)+Ca(oh)2 (s) → 2h2 O(l)+CaCl2 (aq) If 0.75 grams of Ca(HO)2 is used in the reaction, determine the following: a. number of moles of HCl (MM = 36.46 g/mol) needed to completely react with Ca(OH2). The molar mass of Ca(OH)2 IS 74.10 g/mol. b. ass of CaCl2 (MM = 110.98 g/mol) formed in the reaction.