What is the product of the following reaction? Bra H₂O

Q: Draw the structure of the major organic product for the following reaction:

A: Carbonyl compounds react with a secondary amine to form an enamine. Enamines are nitrogen analogous…

Q: What is the product of the following reaction sequence? 1. Mgº 2. CO2 Br ?? 3. CI

A: Option 3rd is the correct answer. That is,

Q: What is the product of this reaction? OH ОН H2SO4

A: The given substituents are benzoic acid and phenol and H2SO4.

Q: What is the product of this reaction? но H2SO4, Heat go

A: Ans D

Q: What is the product of the following reaction? OH CrO3 aqueous H₂SO4

A: Secondary can be oxidized to ketones by using chromic acid as the oxidizing agent. Chromic acid,…

Q: 2) Complete the reaction: NO- FECL

A: In this question, we want to complete the Reaction.  You can see below details Solution.

Q: What is the final product of the reaction?

A:

Q: Acetylsalicylic acid (aspirin) can be synthesized by combining salicylic acid and acetic acid…

A: Acetylsalicylic acid (aspirin) can be synthesized by combining salicylic acid and acetic acid…

Q: What are the products formed from the reactants NH4OH + Na2CO3 ->?

A: NH4OH + Na2CO3 →?

Q: 1. Indicate the product which will be formed in the following reaction. OH T CI EtOH

A:

Q: 1. What are the products of a combustion reaction? 2. Describe how the formation of these products…

A: Combustion reaction of hydrocarbons

Q: What is the product of this reaction? HOCH,CH; HO. H2SO4 1) 2) 3)

A: Given: Reaction of benzoic acid with ethanol and sulphuric acid.  To find: Desired product.…

Q: 2. What is the product of the following reaction? NaOH, H₂O Δ

A: In intramolecular aldol condensation reaction, the compound has two carbonyl groups (dicarbonyl…

Q: What is the main product from the following reaction? NH,, KCN

A: Ketone reacts with amines form iminium ions

Q: What are the products formed from this reaction? do H20 H30*

A: Organic compounds are classified into different groups. Saturated, unsaturated and aromatic. The…

Q: CH3 1. BD3, THF 2. H₂O₂, NaOH(aq)

A: This reaction is an example of Hydroboration-oxidation reaction. In this reaction we get alcohols…

Q: What is the systematic name of the product P of this chemical reaction? OH O CH3-CH2-CH-C-OH + KOH…

A: The given reaction is a type of acid base reaction.here the acid isCH3−CH2−CH(OH)COOHand the base…

Q: Br H20 isopropyl alcohol

A:

Q: 6. What is the major product of this reaction? CH3 8 BHz, then H2O2, OH

A: An arrow always depicts from a region of high electron density to low electron density ; that is…

Q: What is the major product of the following reaction? H2SO4 (catalyst) H20 Но HO, HO a b d

A: The given reactants are,

Q: What is the major product of the following reaction? OH CrO3 CH,OH CHO COOH COOH сосн COOH COOH COOH

A:

Q: What is the product of the following reaction? MgBr 1) Et₂O 2) NH4CI, H₂O

A: It is and Grignard reagent given on arrow. It attacks on carbonyl carbon.

Q: What is the product of the following reaction? NaOH, H2O heat

A: On treating carbonyl compounds (aldehydes/ketones) with a strong base (nucleophile) formation of…

Q: Draw the structure of the intermediate (first product) of the following oxidation reaction.…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: what is the appropriate reactants for the following reaction ?​​​

A:

Q: What is the product of the following reaction ? NH 1) NaOH 2) PhCH₂Br ?

A: We start off with phthalamide, It is treated with base NaOH & alkyl halide i e, Ph-CH2-Br. In…

Q: What is the major product of the following reaction? 1. BF; CH; CH: 2. H.0

A: This is Friedel-crafts acylation. Furan on reaction with acetic anhydride in the presence of BF3…

Q: Indicate the principal product or complete the following chemical reactions. NH2 1. KMNO4, HO, calor…

A: Formation of quaternary amineHoffman eliminationOxidation of alkene to dicarboxylic acidAddition of…

Q: What is the systematic name of the product P of this chemical reaction? ད་ཁྱིག་༢༠ + NaOH OH [P] +…

A: Given,The reaction is:

Q: Which is the major product of this reaction? Br NaOH O O O

A: Alkyl halide compounds have a C-X bond that is highly polar in nature because of which it is highly…

Q: 2) What is the product of the following reaction? HBr Br₂ H₂O 3) Write the product of the following…

A: When alkene is reacted with HBr in water, we get alcohol product instead of alkyl bromide. Similarly…

Q: ÇH2-O-CO-(CH2)7-CH=CH-(CH2)7-CH3 CH-O-CO-(CH2)7-CH=CH-(CH2)7-CH3 e. CH2-OCO-(CH2)16-CH3 2H2 Ni

A: Alkenes are the organic compounds which contain at least one double bond. In the given compound,…

Q: What are the major products of the following reaction? 1 EtMgr. Eto 2. H₂O, H₂O* Et •XX "OH OH Et CH…

A: This is an SN2 reaction. Configuration is the inversion.