What is the potential of a cell made up of Zn / Zn2+ and Cu / Cu2+ half-cells at 25°C if [Zn2+] = 0.11 M and [Cu2+] = 0.41 M?

It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.

What is the standard cell potential you would obtain from a cell at 25C using an electrode in which I(aq) is in contact with I2(s) and an electrode in which a chromium strip dips into a solution of Cr3(aq)?

Calculate the standard cell potential of the cell corresponding to the oxidation of oxalic acid, H2C2O4, by permanganate ion. MnO4. 5H2C2O4(aq)+2MnO4(aq)+6H+(aq)10CO2(g)+2Mn2+(aq)+8H2O(l) See Appendix C for free energies of formation: Gf for H2C2O4(aq) is 698 kJ.

Assume the following electrochemical cell simulates the galvanic cell formed by copper and zinc in seawater at pH 7.90 and 25 C. Zn | Zn(OH)2(s) | OH(aq) || Cu(OH)2(s) | Cu(s) a. Write a balanced equation for the reaction that occurs at the cathode. b. Write a balanced equation for the reaction that occurs at the anode. c. Write a balanced chemical equation for the overall reaction. d. Determine the potential (in volts) of the cell.

The cell potential of the following cell at 25C is 0.480 V. ZnZn2+(1M)H+(testsolution)H2(1atm)Pt What is the pH of the test solution?

What is the maximum work you can obtain from 30.0 g of nickel in the following cell when the cell potential is 0.97 V? Ni(s)Ni2+(aq)Ag+(aq)Ag(s)

What is the cell potential (Ecell) of a spontaneous cell that is run at 25C and contains [Cr3+] = 0.10 M and [Ag+] = 1.0 104 M?

What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)

Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment (assume 1.00 L of total solution after the addition). The silver ion reacts with ammonia to form complex ions as shown: Ag+(aq)+NH3(aq)AgNH3+(aq)K1=2.1103AgNH3+(aq)+NH3(aq)Ag(NH3)2+(aq)K2=8.2103 Calculate the cell potential after the addition of 15.0 moles of NH3.