What is the IUPAC name for the compound shown? CH3 CH3 CH (Br) CH2 CH3

Q: CH3 CH₂CHCH₂CH₂CH =O

A: Rule of IUPAC-   1) Longest chain as parent chain. 2) Numbering start from those side where more…

Q: H₂C you SH CH3 H₂C CH3 CH3 CH3

A:

Q: Name the compound according to the IUPAC system. H3C CH3 CH2-CH2 CH-CH2 CH2 H3C-CH2 CH-HC CH3 H3C…

A: The IUPAC name of the given compound is given in next step according to rules of IUPAC .

Q: What is the IUPAC name for the following compound? CH3 CH3-CH=CH-CH=CH-CH-CH3

A:

Q: Name the following compound using the IUPAC system. CH3–CH2–CH2–CH2–CH2–CH2–CHO O 1-heptanal…

A: Step 1. Find the highest priority functional group. Determine and name the longest continuous carbon…

Q: What is the IUPAC name of the following compound? CH3CH2CH2CH2C=CCH2CH3 Multiple Choice O O O…

A:

Q: What is the IUPAC name of the following compound?

A: The IUPAC name of the compound can be written on the basis of the number of carbon atoms in the main…

Q: Give the IMPAC name for each compound. 1. COOH COOH 2. Br 3. CH3 CHz COOH

A: Given we know about the iupac naming rule

Q: What is the IUPAC name for this:CH3CH(OH)CH(CH3)CH(CH3)CH(CH3)2 CH3CH(OH)CH(CH3)CH(CH3)CH(CH3)2

A: Identification of the parent chain is based on the maximum number of carbon attached in a continuous…

Q: Write the IUPAC name for the compound shown. CH3 H;C CH3

A: Given compound: We have to write the IUPAC name of this compound.

Q: Provide the correct common name for the compound shown here. CH3-CH2-O-CH-CH2-CH3 CH3

A:

Q: Give the IUPAC name of the least water-soluble compound in each pair. Pair Name CH3-CH2-CH2-OH…

A: Solubility of compound in water depends on  polarity of the substance. As 'like dissolve like' water…

Q: What is the IUPAC name for the compound shown? H HO H-C- H IUPAC name: C-O-H

A:

Q: Write the correct IUPAC name for each of the following: a b i CH3CH₂CH₂CH₂-C-OH IUPAC name:…

A: We have to determine the IUPAC name of the given structures

Q: What is the IUPAC name for the compound shown? H3C N' `CH3 ZI

A:

Q: Give IUPAC name for the following compound:

A: Select the longest carbon chain i.e. the principle carbon chain  Numbering according to the lowest…

Q: What is the correct IUPAC name for the compound below? HỌC CH H₂C-C-CH₂-CH₂-CH-CH₂…

A: First step of giving IUPAC  name is giving numbering according priority  and then naming by adding…

Q: CH2 CH3 CH2

A:

Q: Provide IUPAC names for the following compound.

A:

Q: OCH3 CH3

A: The IUPAC stands for Indian Union of Pure and Applied Chemistry. It is the System that provides the…

Q: What is the IUPAC name for the compound shown? CH3 НзС- -CH-CH2- CH2-CH3 -CH2—CHз ČH3 CH2—CНз IUPAC…

A: The systematic naming of organic compound is given by IUPAC. The naming of organic compound is done…

Q: CH3 CH;CHCH,CHČHCH3 1. CH3 CH3 „CH,CH3 `CH,CHCH3 ČH3

A:

Q: What is the IUPAC name of the following compound? 0 CH3CH2CCH2CH3

A: Step 1:To determine the IUPAC name of the given compound, let's break down its structure…

Q: Write the correct IUPAC name for the following molecu CH₂-OH H₂C

A: The IUPAC name of the compound is given by using the rules of IUPAC nomenclature.The rules can be…

Q: What is the IUPAC name for the following compound? Select one: O z-2-ethyl-2-pentene O…

A:

Q: Name the compound in iupac system

A: Rules for naming organic compound is as follows; Select the longest continuous carbon chain. In the…

Q: Give the IUPAC name for each compound.

A: a) The given structure is a chloroalkane.  IUPAC rules for naming alkanes: The name of an alkane…

Q: What is the IUPAC name for the given compound? H₂C. CH₂ CH₂ H₂C IUPAC name: -CH₂ CH₂. CH₂ -CH3

A: Rules for IUPAC naming :- Select the longest chain which contains carbon-carbon single bonds.…

Q: Write down the IUPAC name of the structure shown. HC CH CH3 он он CH

A: Naming of an organic compound is done considering all the available functional groups , number of…