Answered: What is the effect of decreasing the…

What is the effect of decreasing the pressure on the following equilibria? i. 2IBr ⇌ Br2 + I2 ii. 2SO2 + O2⇌ 2SO2 iii. CO + 2H2 ⇌ CH3OH iv. CO + H2O ⇌ CO2 + H2 v. 4NH3 + 7O2 ⇌ 4NO2 + 6H2O

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: Given the pair of reactions snown below, where all species are aqueous, with their equmibrium…

A: Given equilibrium reactions are 1. AB2 <--> A + 2 B…

Q: 2. In the reaction 2 Fe(s) + 3/2 0,(g) 2 Fe,0;(s) a. Write the equilibrium constant expression b.…

A: A) Equilibrium Constant Of Reaction K = 1[O2]3/2 Fe2O3 and Fe not considered in reaction, because…

Q: Consider the following reaction: N2 (g) + 3 H₂ (g) = 2 NH3 (9) Complete the following table. Assume…

A: Consider the following reaction: N2(g) + 3H2(g) <----> 2 NH3(g) Complete the given table.…

Q: How will an increase in temperature affect the following equilibria? How will a decrease in the…

Q: Give the equilibrium expressions. 1. 2SO2 + O2 ⇆ 2SO3 2. N2 + 3H2 ⇆ 2NH3 3. NH4Cl + H2O ⇆ HCl +…

A: Equilibrium expression :For any chemical reaction at equilibrium , the rate of forward reaction is…

Q: Consider the following reaction: H₂ (g) + I2 (g) = 2 HI(g) Complete the following table. Assume that…

A: In the expression of equilibrium constant(Kc) numerator contains concentration of product raised to…

Q: At 308 K, the reaction indicated has a Keq value equal to 1.60 x 10⁻⁵. Calculate the concentration…

Q: a. At equilibrium the concentrations of the ionized substances are: [C6H5NH₂] = 0.0537 mol/L…

A: Given , [C6H5NH2]=0.0537molL[C6H5NH3+]=4.79×10-6molL[OH-]=4.79×10-6molL

Q: Which of the following would not be found in the Law of Mass Action (expression for K) for this…

A: K is the ratio of product of concentration of products raised to their stoichiometric coefficient…

Q: Determine the value of Kc for the following reaction if the equilibrium concentrations are as…

Q: How many of the following equilibrium processes are expected to have a Keq > 1. `NH3 + HO `NH2 ОН II…

A: 1st reaction The pKa value of the acid is far lower than the base thus this reaction is spontaneous…

Q: Use the following reaction to answer the question that follows: CH4(g) + H2S(g) ⇌ CS2(g)…

Q: Part B Find [H₂] at 340 °C. Express your answer using two significant figures. for Part B for Part…

A: we have to calculate H2 at 340°C

Q: Write the equilibrium constant expressions (Ka, Kb, Kw and Kc), for the following reactions.a. C(s)…

A: For any reaction, aA + bB ⇌ cC + dDAt Equlibrium, equlibrium constant ( Kc) = Cc. DdAa. Bb

Q: Q1 a Predict the direction in which each of the following equilibria will shift if the pressure on…

A: According to Le Chatelier's principle if some factors (like temperature, pressure, molar…

Q: Calculate the equilibrium concentrations that result when 0.25 M O2 and 1.0 M HCl react and come to…

A: The equilibrium reaction is: The initial concentrations of O2 and HCl are 0.25M and 1.0M…

Q: Write equilibrium constant expressions for these heterogeneousequilibria.a. C 10 H 8 (s) ⇌ C 10 H 8…

A: Since you have posted a question with multiple subparts, we will solve the first three subparts for…

Q: Table D1: Formulas of Ionic Compounds For each given compound, show the correct formula of the…

A: Name Cation Anion Formula Potassium carbonate K+ CO32- K2CO3 Sodium nitrate Calcium…

Q: What is the equilibrium concentration (in M to three decimal places) of NO2 for the following…

A: K is the ratio of product of concentration of products raised to their stoichiometric coefficient…

Q: Study the reaction. CaCO3 (s)⇌CaO (s)+CO2 (aq) How will the equilibrium position shift when more…

A: The equilibrium reaction taking place is given as, => CaCO3 (s) ⇌ CaO (s) + CO2 (aq) Given : More…

Q: Use the reaction system below to answer the questions that follow. Predict the effect of changes in…

A: According to Le-Chatelier principle, when a reaction equilibrium is disturbed, the reaction moves in…

Q: A mixture in a 3.67 L flask initially contains 0.763 g H2 and 96.9 g I2. At equilibrium, there is…

A: The equilibrium reaction is as follows: H2(g) + I2(g) ⇌ 2HI(g) The volume of the reaction mixture =…

Q: KC = 3.5 x 10⁻⁵. If you start with 1.50 M NO and 0.75 M F

A: The equilibrium concentration of NOF is 6.3 x 10-2 M.

Q: .

A: Equillibrium constant is the ratio of concentaration of products to the concentration of reactants.

Q: For the reaction below, which way would the equilibrium shift, if we added inert gas in the reaction…

Q: Which of the following will disturb the system below that is at equilibrium?NH4SH(s)…

A: The given equilibrium reaction is as follows: NH4SH(s) ⇌ NH3(g)+H2S(g) The physical state of…

Q: 2NH38- -N23) + 3H2) Which way will the equilibrium shift and what will happen to the concentration…

A: A reversible chemical reaction can move in either forward or backward direction. The stage of a…

Q: Consider the reaction below. An increase in temperature causes the equilibrium to shift to? H2(g) +…

Q: 1 a Predict the direction in which each of the following equilibria will shift if the pressure on…

A: According to Le Chatelier's principle if some factors (like temperature, pressure, molar…

Q: Use Le Châtelier's principle to predict what will happen to the following equilibrium if the…

Q: Calculate the number of moles of each component in the equilibrium when 1.25 mol of H2 and 1.25 mol…

A: Equilibrium constant Kc is given as the ratio of product of concentration of product to the ratio of…

Q: 2: Assume that Kc equals 1.4 × 102 for the reaction: CO(g) + O2(g) ⇌ CO2(g). If a 3.00-L…

Q: what is the equilibrium concentration of HI?

Q: O3(g) ⇌ O2(g) + O(g) To which direction will the reaction shift if the inert gas Ar is added?

A: We can explain on the basis of lechatlier principle

Q: Two reactions and their equilibrium constants are given. A + 2 B 2C K = 2.59 2 C D K2 = 0.192…

A: Interpretation: The value of the equilibrium constant for the given chemical equation is to be…

Q: What is the equilibrium constant expression of this equation? 2H2 (g) + O2 (g) ⇌ 2H2O (g)

A: Equilibrium constant is defined as the ratio of products and reactants present in a chemical…

Q: If 0.54 molmol of Br2Br2 and 1.23 molmol of Cl2Cl2 are introduced into a 3.0-LL container at 400 KK,…

A: Given data : Number of moles of Br2 is 0.54 mol Number of moles of Cl2 is 1.23 mol Volume of…

Q: In which of the following equilibrium reactions does INCREASING the volume (keeping T constant)…

A: The equilibrium constant at a given pressure equal to the ratio of the partial pressure of product…

Q: Consider the equilibrium system described by the chemical reaction below, which has a value of Kc…

A: The relation between reaction quotient Qc and equilibrium constant Kc is as shown below: If Qc >…

Q: he reaction below is at equilibrium. Before the reaction began, the concentrations of the reactants…

A: We are given an equilibrium reaction for which the initial concentration of sulphur dioxide is…

Q: will the stress causes the equilibrium to shift towards reactants or products, or will it have no…

A: (1) Equilibrium shift to the product side (2) Equilibrium shift to the reactant Side (3) Equilibrium…

Question

100%

What is the effect of decreasing the pressure on the following equilibria?

i. 2IBr ⇌ Br₂+ I₂

ii. 2SO₂ + O₂⇌ 2SO₂

iii. CO + 2H₂⇌ CH₃OH

iv. CO + H₂O ⇌ CO₂ + H₂

v. 4NH₃ + 7O₂ ⇌ 4NO₂ + 6H₂O

Expert Solution

Step 1

Step by step

Solved in 3 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

The graph above represents the change in concentrations during a chemical reaction. What are the reactants in the reaction? Cannot be determined HI H2 I2 What are the products in the reaction? HI I2 H2 Cannot be determined Which point(s) are at equilibrium? E B D C A
CO (g) + 2 H2 (g) ⇌ CH3OH (g) How many grams of CO does it need to react with 4 moles of H2? 14.00 g 28.01 g 56.02 g 112.04 g
K=4.9x10-3 for the reaction CO₂(g)+H₂(g)⇒ CO(g)+H₂O(g). If [CO₂]=0.00025 M, [H₂]=0.0010 M, & [CO]=0.000015 M, what is the concentration at equilibrium of H₂O? 1.8x10-14M 8.2x10-5M 0.29 M 3.4 M
I. 2NO2 (g) ⇌ N2O4(g) II. N2(g) +3H2(g) ⇌ 2NH3(g) III. PCl5(g) ⇌ PCl3(g) +Cl2(g) Will these equilibria shift towards reactants or products or no change when the volume of the reaction vessel is increased?
MISSED THIS? Read Section 16.6 (Page); Watch IWE 16.5. Consider the following reaction: SO₂ Cl2 (g) SO2 (g) + Cl2 (g) A reaction mixture is made containing an initial [SO₂ C1₂] of 2.0×10-² M . At equilibrium, [Cl₂] = 1.1×10-² M. Part A Calculate the value of the equilibrium constant (Kc). Express your answer to two significant figures. for Part A for Part A do for Part redo fol Part A reset for Part. Ke= 2.2410-² Submit Previous Answers Request Answer X Incorrect; Try Again; 5 attempts remaining
A. Using the Le Chatelier’s principle, predict the shift in the direction of the equilibrium position and changes that will be observed (e.g. color) in each of the following equilibria when the indicated condition is applied.
At equilibrium, which of the following reactions will have the largest percentage of reactant remaining? A. CO2 (g) ⇌ 2 CO (g) + O2 (g) Kc = 3 × 10-92 B. 2 NO2 (g) ⇌ N2O4 (g) Kc = 4.70 C. 2 H2 (g) + O2 (g) ⇌ 2 H2O (g) Kc = 3 × 1081 D. H2O (g) + CO (g) ⇌ H2 (g) + CO2 (g) Kc = 24 E. More Information is needed
Which of the following statements about the reaction quotient, Q, is false? a. If Q> Kc, the reaction must move to equilibrium by forming more reactants. b. It has the same expression as Kc. C. If Q< Kc, the reaction must move to equilibrium by forming more products. d. The value of Q can be used to predict equilibrium concentrations. e. Its value is calculated using nonequilibrium concentrations.
For the reaction below, Kc = 7.2 × 10⁻⁴. What is the equilibrium concentration of NOF if the reaction begins with 0.92 M NO and 0.92 M F₂? 2 NO (g) + F₂ (g) ⇌ 2 NOF (g)
20. For each of the following equilibrium reactions and their associated K value, determine what species will be predominate at equilibrium.a. HC2H3O2(aq) + H2O(l) ⇄ H3O1+(aq) + C2H3O21-(aq) K=1.8x10-5b. Hydrochloric acid reacts with water to form the hydronium ion and the chloride ion. The K value is 1.8x1060c. Water reacts with water to form the hydronium ion and the hydroxide ion. The K value is 1.0x10-14d. NaC2H3O2(s) ⇄ Na1+(aq) + C2H3O21-(aq) K=2.5x1045
Which equilibrium system will show an increase in product formation when the volume is decreased?A. H2 (g) + I2 (g) ⇄ 2HI (g)B. 2NH3 (g) ⇄ N2 (g) + 3H2 (g)C. 2H2 (g) + O2 (g) ⇄ 2H2O (g)D. None of the above
In which direction does the following equilibrium shift when the gas mixture is compressed? Explain using Le Châtelier’s principle and in terms of forward and reverse reaction rates. 2 C(s) + O2(g) ⇌ 2 CO(g)