Answered: What is the change in internal energy…

What is the change in internal energy of a system that absorbs 600 KJ of heat energy at the same time does 450 KJ of work?

Living By Chemistry: First Edition Textbook

1st Edition

ISBN:9781559539418

Author:Angelica Stacy

Publisher:Angelica Stacy

ChapterU5: Fire: Energy , Thermodynamics, And Oxidation-reduction

Section: Chapter Questions

Problem 3RE

See similar textbooks

Similar questions

Under what circumstances is the heat of a process equal to the enthalpy change for the process?
The temperature of the cooling water as it leaves the hot engine of an automobile is 240 F. After it passes through the radiator it has a temperature of 175 F. Calculate the amount of heat transferred from the engine to the surroundings by one gallon of water with a specific heat of 4.184 J/g oC.
When solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?
A gas is cooled and loses 82 J of heat. The gas contracts as it cools, and work done on the system equal to 29 J is exchanged with the surroundings. What are q, w, and U?
9.42 Why is enthalpy generally more useful than internal energy in the thermodynamics of real world systems?
In which of the following systems is(are) work done by the surroundings on the system? Assume pressure and temperature are constant. a. 2SO2(g)+O2(g)2SO3(g) b.CO2(s)CO2(g) c. 4NH3(g)+7O2(g)4NO2(g)+6H2O(g) d.N2O4(g)2NO2(g) e.CaCO3(s)CaCO(s)+CO2(g)
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
A piston performs work of 210. L atm on the surroundings, while the cylinder in which it is placed expands from 10. L to 25 L. At the same time, 45 J of heat is transferred from the surroundings to the system. Against what pressure was the piston working?
In the process of isolating iron from its ores, carbon monoxide reacts with iron(III) oxide, as described by the following equation: Fe2O3(s)+3CO(g)2Fe(s)+3CO2(g)H=24.8kJ The enthalpy change for the combustion of carbon monoxide is 2CO(g)+O2(g)2CO2(g)H=566kJ Use this information to calculate the enthalpy change for the equation 4Fe(s)+3O2(g)2Fe2O3(s)H=?
Dry ice is solid carbon dioxide; it vaporizes at room temperature and normal pressures to the gas. Suppose you put 21.5 g of dry ice in a vessel fitted with a piston (similar to the one in Figure 6.9 but with the weight replaced by the atmosphere), and it vaporizes completely to the gas, pushing the piston upward until its pressure and temperature equal those of the surrounding atmosphere at 24.0C and 751 mmHg. Calculate the work done by the gas in expanding against the atmosphere. Neglect the volume of the solid carbon dioxide, which is very small in comparison to the volume of the gas phase.
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
Explain why absolute enthalpies and energies cannot be measured, and only changes can be determined.