What is Ecell for a galvanic cell represented by the combination of the following half-reactions? E= 0.92 V 2Hg2*(ag) + 2e Hg2 (aq) Cr3+ Cr*(aq) + 3e Cr(s) E=-0.74 Multiple Choice 2.12 V 1.66 V 018 V 1.28 V

What is Ecell for a galvanic cell represented by the combination of the following half-reactions? E= 0.92 V 2Hg2(ag) + 2e Hg2 (aq) Cr3+ Cr(aq) + 3e Cr(s) E=-0.74 Multiple Choice 2.12 V 1.66 V 018 V 1.28 V

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 108QAP

See similar textbooks

Related questions

Q: Consider the standard reduction potentials and redox couples used in a galvanic cell. Unbalanced…

A: First the reaction need to be balance and then complete reaction needs to be written to determine…

Q: A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard…

Q: Consider the standard reduction potentials and redox couples used in a galvanic cell. Unbalanced…

Q: Consider a galvanic electrochemical cell constructed using Cr/Cr³⁺ and Zn/Zn²⁺ at 25 °C. The…

A: The question is based on the concept of electrochemistry. the electrode which has higher reduction…

Q: For the reaction shown below (in a galvanic cell), what is the actual cell voltage (not the standard…

Q: In a galvanic cell based on the half reactions Ni²⁺(aq) + 2e⁻ → Ni(s) E° = -0.250 V 2H⁺(aq) + 2e⁻ →…

A: As the electrode potential of Ni²⁺(aq) + 2e⁻ → Ni(s) is negative so it will be a stronger reducing…

Q: half-reaction standard reduction potential Br,()+2e 2 Br (aq) E =+1.065 V red MnO (aq)+8H (aq)+5e Mn…

A: The half cell for which the value E°red is higher, will be preferred as the cathode. Here, MnO4-…

Q: Calculate AG° for the overall redox reaction: 2x3+(aq) + 2H2O(1) → H2O2(aq) + 2H*(aq) + 2x2+(aq)…

A: Gibbs energy delta G = -nFE.

Q: 0.10 М MnOg 0.40 М Cr3+ 0.20 М Mn2* 0.30 М Cr,0,2- 0.010 МН" 0.010 МН'

A: Given data: Eocell for Mn = 1.52 V Eocell for Cr = 1.33 V Formula used: Q=[products][reactants]

Q: Consider a galvanic electrochemical cell constructed using Cr/Cr³⁺ and Zn/Zn²⁺ at 25 °C. The…

Q: standard cell potential f

Q: A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard…

A: We have to predict the reaction at cathode , anode and overall cell reaction , also we have to…

Q: Consider a galvanic electrochemical cell constructed using Cr/Cr** and Zn/Zn2* at 25 °C. The…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: In a galvanic cell based on the half reactions Ni²⁺(aq) + 2e⁻ → Ni(s) E° = -0.250 V 2H⁺(aq) + 2e⁻ →…

A: First calculate the E0 value of the cell. E0cell=E0ox+E0red=0.250V+0.000V=0.250V

Q: Consider the galvanic cell based on the following half-reactions. Ag+ + e− → Ag ℰ° = +0.80 V…

A: The cell's feasibility as well as potential are estimated using Nernst equation which derives the…

Q: Consider a galvanic electrochemical cell constructed using Cr/Cr³+ and Zn/Zn²+ at 25 °C. The…

A: Given ,

Q: Consider the following standard reduction potentials, Al3+(aq) + 3 e- → Al(s)…

A: An oxidizing agent accepts electrons in a redox reaction and become reduced. And a reducing agent…

Q: How many faradays are transferred in an electrolytic cell when a current of 2.0 A flows for 12…

Q: Consider a cell constructed from standard Q2+/Q and D+/D electrodes. Q and D are symbols of…

Q: Alkaline dry-cell batteries have a voltage of 1.50 V under standard conditions. Given this standard…

A: Common flashlight batteries are called dry-cell batteries since they do not contain large amounts of…

Q: What is E cell for a galvanic cell represented by the combination of the following half-reactions?…

Concept explainers

Electrolysis

Electrolysis is defined as the process of breaking down ionic compounds into their constituent elements by passing a direct electric current through the compound in a fluid state. The cathode reduces cations, while the anode oxidizes anions. An electrolyte, electrodes, and some form of external power source are the main components required for conducting electrolysis. A partition, such as an ion-exchange membrane or a salt bridge, may also be used, but this is optional. These are primarily used to prevent the products from diffusing near the opposing electrode.

Question

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

An active (metal) electrode was found to lose mass as the oxidation-reduction reaction was allowed to proceed. Was the electrode part of the anode or cathode? Explain.
If a 2.5 A current is run through a circuit for 35 minutes, how many coulombs of charge moved through the circuit?
Atomic masses can be determined by electrolysis. In one hour, a current of 0.600 A deposits 2.42 g of a certain metal, M, which is present in solution as M+ ions. What is the atomic mass of the metal?
Consider the electrolysis of NiCl2 to Ni(s) and Cl2(g). (a) What is the minimum voltage required to carry out this reaction at standard conditions? (b) If a voltage of 3.0 V is actually used, and 10.00 kJ of energy are consumed, how many grams of Ni(s) are obtained? (1J=1volt-coulomb)
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
Using data from Table 17-1, place the following in order of increasing strength as reducing agents (all under standard conditions). Cu+,F,H,H2O,I2,K
A single HallHeroult cell (as shown in Fig. 17-22) produces about 1 ton of aluminum in 24 h. What current must be used to accomplish this?
Consider the following galvanic cell: a. Label the reducing agent and the oxidizing agent, and describe the direction of the electron flow. b. Determine the standard cell potential. c. Which electrode increases in mass as the reaction proceeds, and which electrode decreases in mass?
What is wrong with the following statement: The best concentration cell will consist of the substance having the most positive standard reduction potential. What drives a concentration cell to produce a large voltage?
Glucose is the major fuel for most living cells. The oxidative breakdown of glucose by our body to produce energy is called respiration. The reaction for the complete combustion of glucose is C6H12O6(s)+6O2(g)6CO2(g)+6H2O(l) If this combustion reaction could be harnessed as a fuel cell, calculate the theoretical voltage that could be produced at standard conditions. (Hint: Use Gf values from Appendix 4.)
An active (metal) electrode was found to gain mass as the oxidation-reduction reaction was allowed to proceed. Was the electrode part of the anode or cathode? Explain.
The Nernst equation allows determination of the cell potential for a galvanic cell at nonstandard conditions. Write out the Nernst equation. What are nonstandard conditions? What do , n, and Q stand for in the Nernst equation? What does the Nernst equation reduce to when a redox reaction is at equilibrium? What are the signs of G and when K 1? When K 1? When K = 1? Explain the following statement: determines spontaneity, while determines the equilibrium position. Under what conditions can you use to predict spontaneity?