uyahoga Comn mesha uailel Name Due: November 19 Extra Credit (10 points) Each question is worth 0.25 points. 1-8) Name the following molecules according to IUPAC rules: 1. CH, CH-CH2-CH2-CH, 2. 10) CM O-C-CH. CN,CH 3. CH3-CH2-CH2-CH2-CH2-CH2-CH3 O Tormal mdod Dram п Tos. Che follow 4. CH3-CH2-CH2-CH ro-i 11. cl O II CH3-CH2-CH2-CH2-C-CH3 5. honof NH2 6. CH,-CH-CH2-CH3

uyahoga Comn mesha uailel Name Due: November 19 Extra Credit (10 points) Each question is worth 0.25 points. 1-8) Name the following molecules according to IUPAC rules: 1. CH, CH-CH2-CH2-CH, 2. 10) CM O-C-CH. CN,CH 3. CH3-CH2-CH2-CH2-CH2-CH2-CH3 O Tormal mdod Dram п Tos. Che follow 4. CH3-CH2-CH2-CH ro-i 11. cl O II CH3-CH2-CH2-CH2-C-CH3 5. honof NH2 6. CH,-CH-CH2-CH3

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

IUPAC name for this compound
Write the IUPAC name of the following structures
Give correct handwritten answer
Give the classification of the following alcohols as to primary, secondary, or tertiary. 1. (CH3)3-С- ОН 2. CHз-CH2-CH2-сH2-ОН 3. СНз-(CH2)2-CН -ОН CH3- CH2-OH 5. (CH3)2-CH -OH 4.
What is the correct IUPAC name of the following compound? CH3 CH3 H;C а. 4-methyl-4, 6, 8-decadiene-2-one b. None of them С. 4-methyl-4, 6, 8-decatriene-2-one d. 6-methyl-4, 6, 8-decatriene-2-one е. 4-methyl-4, 6, 8-decatriene-1-one
estion 12 of 33 Write down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed: 0 CH2-0-C-(CH2)16-CH3 о о O= = = CH-O-C-(CH2)4-CH=CH-CH2-CH=CH-CH2-CH=CH-(CH2)4-CH3 Separate each name with a comma. You will find useful information in the ALEKS Data resource. Question 13 of 33 Write down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed: CH₂-01 CH-O ང CH₂-01 Separate each name with a comma. You will find useful information in the ALEKS Data resource. Question 14 of 33 Draw the skeletal ("line") structure of the triacylglycerol that could be formed from lauric acid.
What is the IUPAC name for this molecule?
r Provide the correct systematic name for the compound shown here. H3C Time's Up! 4- iso NH₂ CH3 (E)- (R)-(S)- (Z)- CH3 2- 6- 3- 5- sec- tri di cyclo tert- prop amino but meth nitro hex Submit +
None
Hello please help me with my homework, thank you I really appreciate it ?
elsitini bos wei0 (8 5) Draw and build ethene, CH¿CH2. Be sure your drawing correctly reflects the geometry in the model.